Compare commits
27 Commits
main
...
ib_async_C
| Author | SHA1 | Date |
|---|---|---|
|
|
deaf7dd1ab | |
|
|
702aae2544 | |
|
|
44d54babeb | |
|
|
b5a33e1217 | |
|
|
796a831c6e | |
|
|
de81d1e905 | |
|
|
170dd9794c | |
|
|
599c36aba6 | |
|
|
f174f79a1a | |
|
|
9b284c2256 | |
|
|
59f2d46a97 | |
|
|
c1b1e99693 | |
|
|
24651d2326 | |
|
|
2d00bb1024 | |
|
|
dd40ad603f | |
|
|
f2ace1b63b | |
|
|
9010f9c7ab | |
|
|
89a145113c | |
|
|
ec4db30cdc | |
|
|
2a394dba03 | |
|
|
19f16e1df3 | |
|
|
3adb0d8b9d | |
|
|
ee09f519a9 | |
|
|
9247746a79 | |
|
|
9e2af2838f | |
|
|
b1cb67d1bd | |
|
|
196422433c |
|
|
@ -1,11 +0,0 @@
|
|||
{
|
||||
"permissions": {
|
||||
"allow": [
|
||||
"Bash(chmod:*)",
|
||||
"Bash(/tmp/piker_commits.txt)",
|
||||
"Bash(python:*)"
|
||||
],
|
||||
"deny": [],
|
||||
"ask": []
|
||||
}
|
||||
}
|
||||
|
|
@ -1,84 +0,0 @@
|
|||
---
|
||||
name: commit-msg
|
||||
description: >
|
||||
Generate piker-style git commit messages from
|
||||
staged changes or prompt input, following the
|
||||
style guide learned from 500 repo commits.
|
||||
argument-hint: "[optional-scope-or-description]"
|
||||
disable-model-invocation: true
|
||||
allowed-tools: Bash(git *), Read, Grep, Glob, Write
|
||||
---
|
||||
|
||||
## Current staged changes
|
||||
!`git diff --staged --stat`
|
||||
|
||||
## Recent commit style reference
|
||||
!`git log --oneline -10`
|
||||
|
||||
# Piker Git Commit Message Generator
|
||||
|
||||
Generate a commit message from the staged diff above
|
||||
following the piker project's conventions (learned from
|
||||
analyzing 500 repo commits).
|
||||
|
||||
If `$ARGUMENTS` is provided, use it as scope or
|
||||
description context for the commit message.
|
||||
|
||||
For the full style guide with verb frequencies,
|
||||
section markers, abbreviations, piker-specific terms,
|
||||
and examples, see
|
||||
[style-guide-reference.md](./style-guide-reference.md).
|
||||
|
||||
## Quick Reference
|
||||
|
||||
- **Subject**: ~50 chars, present tense verb, use
|
||||
backticks for code refs
|
||||
- **Body**: only for complex/multi-file changes,
|
||||
67 char line max
|
||||
- **Section markers**: Also, / Deats, / Other,
|
||||
- **Bullets**: use `-` style
|
||||
- **Tone**: technical but casual (piker style)
|
||||
|
||||
## Claude-code Footer
|
||||
|
||||
When the written **patch** was assisted by
|
||||
claude-code, include:
|
||||
|
||||
```
|
||||
(this patch was generated in some part by [`claude-code`][claude-code-gh])
|
||||
[claude-code-gh]: https://github.com/anthropics/claude-code
|
||||
```
|
||||
|
||||
When only the **commit msg** was written by
|
||||
claude-code (human wrote the patch), use:
|
||||
```
|
||||
(this commit msg was generated in some part by [`claude-code`][claude-code-gh])
|
||||
[claude-code-gh]: https://github.com/anthropics/claude-code
|
||||
```
|
||||
|
||||
## Output Instructions
|
||||
|
||||
When generating a commit message:
|
||||
|
||||
1. Analyze the staged diff (injected above via
|
||||
dynamic context) to understand all changes.
|
||||
2. If `$ARGUMENTS` provides a scope (e.g.,
|
||||
`.ib.feed`) or description, incorporate it into
|
||||
the subject line.
|
||||
3. Write the subject line following verb + backtick
|
||||
conventions from the
|
||||
[style guide](./style-guide-reference.md).
|
||||
4. Add body only for multi-file or complex changes.
|
||||
5. Write the message to a file in the repo's
|
||||
`.claude/` subdir with filename format:
|
||||
`<timestamp>_<first-7-chars-of-last-commit-hash>_commit_msg.md`
|
||||
where `<timestamp>` is from `date --iso-8601=seconds`.
|
||||
Also write a copy to
|
||||
`.claude/git_commit_msg_LATEST.md`
|
||||
(overwrite if exists).
|
||||
|
||||
---
|
||||
|
||||
**Analysis date:** 2026-01-27
|
||||
**Commits analyzed:** 500 from piker repository
|
||||
**Maintained by:** Tyler Goodlet
|
||||
|
|
@ -1,262 +0,0 @@
|
|||
# Piker Git Commit Message Style Guide
|
||||
|
||||
Learned from analyzing 500 commits from the piker repository.
|
||||
|
||||
## Subject Line Rules
|
||||
|
||||
### Length
|
||||
- Target: ~50 characters (avg: 50.5 chars)
|
||||
- Maximum: 67 chars (hard limit, though historical max: 146)
|
||||
- Keep concise and descriptive
|
||||
|
||||
### Structure
|
||||
- Use present tense verbs (Add, Drop, Fix, Move, etc.)
|
||||
- 65.6% of commits use backticks for code references
|
||||
- 33.0% use colon notation (`module.file:` prefix or `: ` separator)
|
||||
|
||||
### Opening Verbs (by frequency)
|
||||
Primary verbs to use:
|
||||
- **Add** (8.4%) - New features, files, functionality
|
||||
- **Drop** (3.2%) - Remove features, dependencies, code
|
||||
- **Fix** (2.2%) - Bug fixes, corrections
|
||||
- **Use** (2.2%) - Switch to different approach/tool
|
||||
- **Port** (2.0%) - Migrate code, adapt from elsewhere
|
||||
- **Move** (2.0%) - Relocate code, refactor structure
|
||||
- **Always** (1.8%) - Enforce consistent behavior
|
||||
- **Factor** (1.6%) - Refactoring, code organization
|
||||
- **Bump** (1.6%) - Version/dependency updates
|
||||
- **Update** (1.4%) - Modify existing functionality
|
||||
- **Adjust** (1.0%) - Fine-tune, tweak behavior
|
||||
- **Change** (1.0%) - Modify behavior or structure
|
||||
|
||||
Casual/informal verbs (used occasionally):
|
||||
- **Woops,** (1.4%) - Fixing mistakes
|
||||
- **Lul,** (0.6%) - Humorous corrections
|
||||
|
||||
### Code References
|
||||
Use backticks heavily for:
|
||||
- **Module/package names**: `tractor`, `pikerd`, `polars`, `ruff`
|
||||
- **Data types**: `dict`, `float`, `str`, `None`
|
||||
- **Classes**: `MktPair`, `Asset`, `Position`, `Account`, `Flume`
|
||||
- **Functions**: `dedupe()`, `push()`, `get_client()`, `norm_trade()`
|
||||
- **File paths**: `.tsp`, `.fqme`, `brokers.toml`, `conf.toml`
|
||||
- **CLI flags**: `--pdb`
|
||||
- **Error types**: `NoData`
|
||||
- **Tools**: `uv`, `uv sync`, `httpx`, `numpy`
|
||||
|
||||
### Colon Usage Patterns
|
||||
1. **Module prefix**: `.ib.feed: trim bars frame to start_dt`
|
||||
2. **Separator**: `Add support: new feature description`
|
||||
|
||||
### Tone
|
||||
- Technical but casual (use XD, lol, .., Woops, Lul when appropriate)
|
||||
- Direct and concise
|
||||
- Question marks rare (1.4%)
|
||||
- Exclamation marks rare (1.4%)
|
||||
|
||||
## Body Structure
|
||||
|
||||
### Body Frequency
|
||||
- 56.0% of commits have empty bodies (one-line commits are common)
|
||||
- Use body for complex changes requiring explanation
|
||||
|
||||
### Bullet Lists
|
||||
- Prefer `-` bullets (16.2% of commits)
|
||||
- Rarely use `*` bullets (1.6%)
|
||||
- Indent continuation lines appropriately
|
||||
|
||||
### Section Markers (in order of frequency)
|
||||
Use these to organize complex commit bodies:
|
||||
|
||||
1. **Also,** (most common, 26 occurrences)
|
||||
- Additional changes, side effects, related updates
|
||||
- Example:
|
||||
```
|
||||
Main change described in subject.
|
||||
|
||||
Also,
|
||||
- related change 1
|
||||
- related change 2
|
||||
```
|
||||
|
||||
2. **Deats,** (8 occurrences)
|
||||
- Implementation details
|
||||
- Technical specifics
|
||||
|
||||
3. **Further,** (4 occurrences)
|
||||
- Additional context or future considerations
|
||||
|
||||
4. **Other,** (3 occurrences)
|
||||
- Miscellaneous related changes
|
||||
|
||||
5. **Notes,** **TODO,** (rare, 1 each)
|
||||
- Special annotations when needed
|
||||
|
||||
### Line Length
|
||||
- Body lines: 67 character maximum
|
||||
- Break longer lines appropriately
|
||||
|
||||
## Language Patterns
|
||||
|
||||
### Common Abbreviations (by frequency)
|
||||
Use these freely in commit bodies:
|
||||
- **msg** (29) - message
|
||||
- **mod** (15) - module
|
||||
- **vs** (14) - versus
|
||||
- **impl** (12) - implementation
|
||||
- **deps** (11) - dependencies
|
||||
- **var** (6) - variable
|
||||
- **ctx** (6) - context
|
||||
- **bc** (5) - because
|
||||
- **obvi** (4) - obviously
|
||||
- **ep** (4) - endpoint
|
||||
- **tn** (4) - task name
|
||||
- **rn** (3) - right now
|
||||
- **sig** (3) - signal/signature
|
||||
- **env** (3) - environment
|
||||
- **tho** (3) - though
|
||||
- **fn** (2) - function
|
||||
- **iface** (2) - interface
|
||||
- **prolly** (2) - probably
|
||||
|
||||
Less common but acceptable:
|
||||
- **dne**, **osenv**, **gonna**, **wtf**
|
||||
|
||||
### Tone Indicators
|
||||
- **..** (77 occurrences) - Ellipsis for trailing thoughts
|
||||
- **XD** (17) - Expression of humor/irony
|
||||
- **lol** (1) - Rare, use sparingly
|
||||
|
||||
### Informal Patterns
|
||||
- Casual contractions okay: Don't, won't
|
||||
- Lowercase starts acceptable for file prefixes
|
||||
- Direct, conversational tone
|
||||
|
||||
## Special Patterns
|
||||
|
||||
### Module/File Prefixes
|
||||
Common in piker commits (33.0% use colons):
|
||||
- `.ib.feed: description`
|
||||
- `.ui._remote_ctl: description`
|
||||
- `.data.tsp: description`
|
||||
- `.accounting: description`
|
||||
|
||||
### Merge Commits
|
||||
- 4.4% of commits (standard git merges)
|
||||
- Not a primary pattern to emulate
|
||||
|
||||
### External References
|
||||
- GitHub links occasionally used (13 total)
|
||||
- File:line references not used (0 occurrences)
|
||||
- No WIP commits in analyzed set
|
||||
|
||||
### Claude-code Footer
|
||||
When the written **patch** was assisted by claude-code,
|
||||
include:
|
||||
|
||||
```
|
||||
(this patch was generated in some part by [`claude-code`][claude-code-gh])
|
||||
[claude-code-gh]: https://github.com/anthropics/claude-code
|
||||
```
|
||||
|
||||
When only the **commit msg** was written by claude-code
|
||||
(human wrote the patch), use:
|
||||
|
||||
```
|
||||
(this commit msg was generated in some part by [`claude-code`][claude-code-gh])
|
||||
[claude-code-gh]: https://github.com/anthropics/claude-code
|
||||
```
|
||||
|
||||
## Piker-Specific Terms
|
||||
|
||||
### Core Components
|
||||
- `pikerd` - piker daemon
|
||||
- `brokerd` - broker daemon
|
||||
- `tractor` - actor framework used
|
||||
- `.tsp` - time series protocol/module
|
||||
- `.fqme` - fully qualified market endpoint
|
||||
|
||||
### Data Structures
|
||||
- `MktPair` - market pair
|
||||
- `Asset` - asset representation
|
||||
- `Position` - trading position
|
||||
- `Account` - account data
|
||||
- `Flume` - data stream
|
||||
- `SymbologyCache` - symbol caching
|
||||
|
||||
### Common Functions
|
||||
- `dedupe()` - deduplication
|
||||
- `push()` - data pushing
|
||||
- `get_client()` - client retrieval
|
||||
- `norm_trade()` - trade normalization
|
||||
- `open_trade_ledger()` - ledger opening
|
||||
- `markup_gaps()` - gap marking
|
||||
- `get_null_segs()` - null segment retrieval
|
||||
- `remote_annotate()` - remote annotation
|
||||
|
||||
### Brokers & Integrations
|
||||
- `binance` - Binance integration
|
||||
- `.ib` - Interactive Brokers
|
||||
- `bs_mktid` - broker-specific market ID
|
||||
- `reqid` - request ID
|
||||
|
||||
### Configuration
|
||||
- `brokers.toml` - broker configuration
|
||||
- `conf.toml` - general configuration
|
||||
|
||||
### Development Tools
|
||||
- `ruff` - Python linter
|
||||
- `uv` / `uv sync` - package manager
|
||||
- `--pdb` - debugger flag
|
||||
- `pdbp` - debugger
|
||||
- `asyncvnc` / `pyvnc` - VNC libraries
|
||||
- `httpx` - HTTP client
|
||||
- `polars` - dataframe library
|
||||
- `rapidfuzz` - fuzzy matching
|
||||
- `numpy` - numerical library
|
||||
- `trio` - async framework
|
||||
- `asyncio` - async framework
|
||||
- `xonsh` - shell
|
||||
|
||||
## Examples
|
||||
|
||||
### Simple one-liner
|
||||
```
|
||||
Add `MktPair.fqme` property for symbol resolution
|
||||
```
|
||||
|
||||
### With module prefix
|
||||
```
|
||||
.ib.feed: trim bars frame to `start_dt`
|
||||
```
|
||||
|
||||
### Casual fix
|
||||
```
|
||||
Woops, compare against first-dt in `.ib.feed` bars frame
|
||||
```
|
||||
|
||||
### With body using "Also,"
|
||||
```
|
||||
Drop `poetry` for `uv` in dev workflow
|
||||
|
||||
Also,
|
||||
- update deps in `pyproject.toml`
|
||||
- add `uv sync` to CI pipeline
|
||||
- remove old `poetry.lock`
|
||||
```
|
||||
|
||||
### With implementation details
|
||||
```
|
||||
Factor position tracking into `Position` dataclass
|
||||
|
||||
Deats,
|
||||
- move calc logic from `brokerd` to `.accounting`
|
||||
- add `norm_trade()` helper for broker normalization
|
||||
- use `MktPair.fqme` for consistent symbol refs
|
||||
```
|
||||
|
||||
---
|
||||
|
||||
**Analysis date:** 2026-01-27
|
||||
**Commits analyzed:** 500 from piker repository
|
||||
**Maintained by:** Tyler Goodlet
|
||||
|
|
@ -1,171 +0,0 @@
|
|||
---
|
||||
name: piker-profiling
|
||||
description: >
|
||||
Piker's `Profiler` API for measuring performance
|
||||
across distributed actor systems. Apply when
|
||||
adding profiling, debugging perf regressions, or
|
||||
optimizing hot paths in piker code.
|
||||
user-invocable: false
|
||||
---
|
||||
|
||||
# Piker Profiling Subsystem
|
||||
|
||||
Skill for using `piker.toolz.profile.Profiler` to
|
||||
measure performance across distributed actor systems.
|
||||
|
||||
## Core Profiler API
|
||||
|
||||
### Basic Usage
|
||||
|
||||
```python
|
||||
from piker.toolz.profile import (
|
||||
Profiler,
|
||||
pg_profile_enabled,
|
||||
ms_slower_then,
|
||||
)
|
||||
|
||||
profiler = Profiler(
|
||||
msg='<description of profiled section>',
|
||||
disabled=False, # IMPORTANT: enable explicitly!
|
||||
ms_threshold=0.0, # show all timings
|
||||
)
|
||||
|
||||
# do work
|
||||
some_operation()
|
||||
profiler('step 1 complete')
|
||||
|
||||
# more work
|
||||
another_operation()
|
||||
profiler('step 2 complete')
|
||||
|
||||
# prints on exit:
|
||||
# > Entering <description of profiled section>
|
||||
# step 1 complete: 12.34, tot:12.34
|
||||
# step 2 complete: 56.78, tot:69.12
|
||||
# < Exiting <description>, total: 69.12 ms
|
||||
```
|
||||
|
||||
### Default Behavior Gotcha
|
||||
|
||||
**CRITICAL:** Profiler is disabled by default in
|
||||
many contexts!
|
||||
|
||||
```python
|
||||
# BAD: might not print anything!
|
||||
profiler = Profiler(msg='my operation')
|
||||
|
||||
# GOOD: explicit enable
|
||||
profiler = Profiler(
|
||||
msg='my operation',
|
||||
disabled=False, # force enable!
|
||||
ms_threshold=0.0, # show all steps
|
||||
)
|
||||
```
|
||||
|
||||
### Profiler Output Format
|
||||
|
||||
```
|
||||
> Entering <msg>
|
||||
<label 1>: <delta_ms>, tot:<cumulative_ms>
|
||||
<label 2>: <delta_ms>, tot:<cumulative_ms>
|
||||
...
|
||||
< Exiting <msg>, total time: <total_ms> ms
|
||||
```
|
||||
|
||||
**Reading the output:**
|
||||
- `delta_ms` = time since previous checkpoint
|
||||
- `cumulative_ms` = time since profiler creation
|
||||
- Final total = end-to-end time
|
||||
|
||||
## Profiling Distributed Systems
|
||||
|
||||
Piker runs across multiple processes (actors). Each
|
||||
actor has its own log output.
|
||||
|
||||
### Common piker actors
|
||||
- `pikerd` - main daemon process
|
||||
- `brokerd` - broker connection actor
|
||||
- `chart` - UI/graphics actor
|
||||
- Client scripts - analysis/annotation clients
|
||||
|
||||
### Cross-Actor Profiling Strategy
|
||||
|
||||
1. Add `Profiler` on **both** client and server
|
||||
2. Correlate timestamps from each actor's output
|
||||
3. Calculate IPC overhead = total - (client + server
|
||||
processing)
|
||||
|
||||
**Example correlation:**
|
||||
|
||||
Client console:
|
||||
```
|
||||
> Entering markup_gaps() for 1285 gaps
|
||||
initial redraw: 0.20ms, tot:0.20
|
||||
built annotation specs: 256.48ms, tot:256.68
|
||||
batch IPC call complete: 119.26ms, tot:375.94
|
||||
final redraw: 0.07ms, tot:376.02
|
||||
< Exiting markup_gaps(), total: 376.04ms
|
||||
```
|
||||
|
||||
Server console (chart actor):
|
||||
```
|
||||
> Entering Batch annotate 1285 gaps
|
||||
`np.searchsorted()` complete!: 0.81ms, tot:0.81
|
||||
`time_to_row` creation: 98.45ms, tot:99.28
|
||||
created GapAnnotations item: 2.98ms, tot:102.26
|
||||
< Exiting Batch annotate, total: 104.15ms
|
||||
```
|
||||
|
||||
**Analysis:**
|
||||
- Total client time: 376ms
|
||||
- Server processing: 104ms
|
||||
- IPC overhead + client spec building: 272ms
|
||||
- Bottleneck: client-side spec building (256ms)
|
||||
|
||||
## Integration with PyQtGraph
|
||||
|
||||
Some piker modules integrate with `pyqtgraph`'s
|
||||
profiling:
|
||||
|
||||
```python
|
||||
from piker.toolz.profile import (
|
||||
Profiler,
|
||||
pg_profile_enabled,
|
||||
ms_slower_then,
|
||||
)
|
||||
|
||||
profiler = Profiler(
|
||||
msg='Curve.paint()',
|
||||
disabled=not pg_profile_enabled(),
|
||||
ms_threshold=ms_slower_then,
|
||||
)
|
||||
```
|
||||
|
||||
## Performance Expectations
|
||||
|
||||
**Typical timings:**
|
||||
- IPC round-trip (local actors): 1-10ms
|
||||
- NumPy binary search (10k array): <1ms
|
||||
- Dict building (1k items, simple): 1-5ms
|
||||
- Qt redraw trigger: 0.1-1ms
|
||||
- Scene item removal (100s items): 10-50ms
|
||||
|
||||
**Red flags:**
|
||||
- Linear array scan per item: 50-100ms+ for 1k
|
||||
- Dict comprehension with struct array: 50-100ms
|
||||
- Individual Qt item creation: 5ms per item
|
||||
|
||||
## References
|
||||
|
||||
- `piker/toolz/profile.py` - Profiler impl
|
||||
- `piker/ui/_curve.py` - FlowGraphic paint profiling
|
||||
- `piker/ui/_remote_ctl.py` - IPC handler profiling
|
||||
- `piker/tsp/_annotate.py` - Client-side profiling
|
||||
|
||||
See [patterns.md](patterns.md) for detailed
|
||||
profiling patterns and debugging techniques.
|
||||
|
||||
---
|
||||
|
||||
*Last updated: 2026-01-31*
|
||||
*Session: Batch gap annotation optimization*
|
||||
|
|
@ -1,228 +0,0 @@
|
|||
# Profiling Patterns
|
||||
|
||||
Detailed profiling patterns for use with
|
||||
`piker.toolz.profile.Profiler`.
|
||||
|
||||
## Pattern: Function Entry/Exit
|
||||
|
||||
```python
|
||||
async def my_function():
|
||||
profiler = Profiler(
|
||||
msg='my_function()',
|
||||
disabled=False,
|
||||
ms_threshold=0.0,
|
||||
)
|
||||
|
||||
step1()
|
||||
profiler('step1')
|
||||
|
||||
step2()
|
||||
profiler('step2')
|
||||
|
||||
# auto-prints on exit
|
||||
```
|
||||
|
||||
## Pattern: Loop Iterations
|
||||
|
||||
```python
|
||||
# DON'T profile inside tight loops (overhead!)
|
||||
for i in range(1000):
|
||||
profiler(f'iteration {i}') # NO!
|
||||
|
||||
# DO profile around loops
|
||||
profiler = Profiler(msg='processing 1000 items')
|
||||
for i in range(1000):
|
||||
process(item[i])
|
||||
profiler('processed all items')
|
||||
```
|
||||
|
||||
## Pattern: Conditional Profiling
|
||||
|
||||
```python
|
||||
# only profile when investigating specific issue
|
||||
DEBUG_REPOSITION = True
|
||||
|
||||
def reposition(self, array):
|
||||
if DEBUG_REPOSITION:
|
||||
profiler = Profiler(
|
||||
msg='GapAnnotations.reposition()',
|
||||
disabled=False,
|
||||
)
|
||||
|
||||
# ... do work
|
||||
|
||||
if DEBUG_REPOSITION:
|
||||
profiler('completed reposition')
|
||||
```
|
||||
|
||||
## Pattern: Teardown/Cleanup Profiling
|
||||
|
||||
```python
|
||||
try:
|
||||
# ... main work
|
||||
pass
|
||||
finally:
|
||||
profiler = Profiler(
|
||||
msg='Annotation teardown',
|
||||
disabled=False,
|
||||
ms_threshold=0.0,
|
||||
)
|
||||
|
||||
cleanup_resources()
|
||||
profiler('resources cleaned')
|
||||
|
||||
close_connections()
|
||||
profiler('connections closed')
|
||||
```
|
||||
|
||||
## Pattern: Distributed IPC Profiling
|
||||
|
||||
### Server-side (chart actor)
|
||||
|
||||
```python
|
||||
# piker/ui/_remote_ctl.py
|
||||
@tractor.context
|
||||
async def remote_annotate(ctx):
|
||||
async with ctx.open_stream() as stream:
|
||||
async for msg in stream:
|
||||
profiler = Profiler(
|
||||
msg=f'Batch annotate {n} gaps',
|
||||
disabled=False,
|
||||
ms_threshold=0.0,
|
||||
)
|
||||
|
||||
result = await handle_request(msg)
|
||||
profiler('request handled')
|
||||
|
||||
await stream.send(result)
|
||||
profiler('result sent')
|
||||
```
|
||||
|
||||
### Client-side (analysis script)
|
||||
|
||||
```python
|
||||
# piker/tsp/_annotate.py
|
||||
async def markup_gaps(...):
|
||||
profiler = Profiler(
|
||||
msg=f'markup_gaps() for {n} gaps',
|
||||
disabled=False,
|
||||
ms_threshold=0.0,
|
||||
)
|
||||
|
||||
await actl.redraw()
|
||||
profiler('initial redraw')
|
||||
|
||||
specs = build_specs(gaps)
|
||||
profiler('built annotation specs')
|
||||
|
||||
# IPC round-trip!
|
||||
result = await actl.add_batch(specs)
|
||||
profiler('batch IPC call complete')
|
||||
|
||||
await actl.redraw()
|
||||
profiler('final redraw')
|
||||
```
|
||||
|
||||
## Common Use Cases
|
||||
|
||||
### IPC Request/Response Timing
|
||||
|
||||
```python
|
||||
# Client side
|
||||
profiler = Profiler(msg='Remote request')
|
||||
result = await remote_call()
|
||||
profiler('got response')
|
||||
|
||||
# Server side (in handler)
|
||||
profiler = Profiler(msg='Handle request')
|
||||
process_request()
|
||||
profiler('request processed')
|
||||
```
|
||||
|
||||
### Batch Operation Optimization
|
||||
|
||||
```python
|
||||
profiler = Profiler(msg='Batch processing')
|
||||
|
||||
items = collect_all()
|
||||
profiler(f'collected {len(items)} items')
|
||||
|
||||
results = numpy_batch_op(items)
|
||||
profiler('numpy op complete')
|
||||
|
||||
output = {
|
||||
k: v for k, v in zip(keys, results)
|
||||
}
|
||||
profiler('dict built')
|
||||
```
|
||||
|
||||
### Startup/Initialization Timing
|
||||
|
||||
```python
|
||||
async def __aenter__(self):
|
||||
profiler = Profiler(msg='Service startup')
|
||||
|
||||
await connect_to_broker()
|
||||
profiler('broker connected')
|
||||
|
||||
await load_config()
|
||||
profiler('config loaded')
|
||||
|
||||
await start_feeds()
|
||||
profiler('feeds started')
|
||||
|
||||
return self
|
||||
```
|
||||
|
||||
## Debugging Performance Regressions
|
||||
|
||||
When profiler shows unexpected slowness:
|
||||
|
||||
### 1. Add finer-grained checkpoints
|
||||
|
||||
```python
|
||||
# was:
|
||||
result = big_function()
|
||||
profiler('big_function done')
|
||||
|
||||
# now:
|
||||
profiler = Profiler(
|
||||
msg='big_function internals',
|
||||
)
|
||||
step1 = part_a()
|
||||
profiler('part_a')
|
||||
step2 = part_b()
|
||||
profiler('part_b')
|
||||
step3 = part_c()
|
||||
profiler('part_c')
|
||||
```
|
||||
|
||||
### 2. Check for hidden iterations
|
||||
|
||||
```python
|
||||
# looks simple but might be slow!
|
||||
result = array[array['time'] == timestamp]
|
||||
profiler('array lookup')
|
||||
|
||||
# reveals O(n) scan per call
|
||||
for ts in timestamps: # outer loop
|
||||
row = array[array['time'] == ts] # O(n)!
|
||||
```
|
||||
|
||||
### 3. Isolate IPC from computation
|
||||
|
||||
```python
|
||||
# was: can't tell where time is spent
|
||||
result = await remote_call(data)
|
||||
profiler('remote call done')
|
||||
|
||||
# now: separate phases
|
||||
payload = prepare_payload(data)
|
||||
profiler('payload prepared')
|
||||
|
||||
result = await remote_call(payload)
|
||||
profiler('IPC complete')
|
||||
|
||||
parsed = parse_result(result)
|
||||
profiler('result parsed')
|
||||
```
|
||||
|
|
@ -1,114 +0,0 @@
|
|||
---
|
||||
name: piker-slang
|
||||
description: >
|
||||
Piker developer communication style, slang, and
|
||||
ethos. Apply when communicating with piker devs,
|
||||
writing commit messages, code review comments, or
|
||||
any collaborative interaction.
|
||||
user-invocable: false
|
||||
---
|
||||
|
||||
# Piker Slang & Communication Style
|
||||
|
||||
The essential skill for fitting in with the degen
|
||||
trader-hacker class of devs who built and maintain
|
||||
`piker`.
|
||||
|
||||
## Core Philosophy
|
||||
|
||||
Piker devs are:
|
||||
- **Technical AF** - deep systems knowledge,
|
||||
performance obsessed
|
||||
- **Irreverent** - don't take ourselves too
|
||||
seriously
|
||||
- **Direct** - no corporate speak, no BS, just
|
||||
real talk
|
||||
- **Collaborative** - we build together, debug
|
||||
together, win together
|
||||
|
||||
Communication style: precision meets chaos,
|
||||
academia meets /r/wallstreetbets, systems
|
||||
programming meets trading floor banter.
|
||||
|
||||
## Grammar & Style Rules
|
||||
|
||||
### 1. Typos with inline corrections
|
||||
```
|
||||
dint (didn't) help at all
|
||||
gonna (going to) try with...
|
||||
deats (details) wise i want...
|
||||
```
|
||||
Pattern: `[typo] ([correction])` in same sentence
|
||||
|
||||
### 2. Casual grammar violations (embrace them!)
|
||||
- `ain't` - use freely
|
||||
- `y'all` - for addressing group
|
||||
- Starting sentences with lowercase
|
||||
- Dropping articles: "need to fix the thing"
|
||||
becomes "need to fix thing"
|
||||
- Stream of consciousness without full sentence
|
||||
structure
|
||||
|
||||
### 3. Ellipsis usage
|
||||
```
|
||||
yeah i think we should try..
|
||||
..might need to also check for..
|
||||
not sure tho..
|
||||
```
|
||||
Use `..` (two dots) not `...` (three) - chiller
|
||||
|
||||
### 4. Emphasis through spelling
|
||||
- `soooo` - very (sooo good, sooo fast)
|
||||
- `veeery` - very (veeery interesting)
|
||||
- `wayyy` - way (wayyy better)
|
||||
|
||||
### 5. Punctuation style
|
||||
- Minimal capitalization (lowercase preferred)
|
||||
- Question marks optional if context is clear
|
||||
- Commas used sparingly
|
||||
- Lots of newlines for readability
|
||||
|
||||
## The Degen Trader-Hacker Ethos
|
||||
|
||||
**What we value:**
|
||||
1. **Performance** - slow code is broken code
|
||||
2. **Correctness** - fast wrong code is worthless
|
||||
3. **Clarity** - future-you should understand
|
||||
past-you
|
||||
4. **Iteration** - ship it, profile it, fix it,
|
||||
repeat
|
||||
5. **Humor** - serious tools with silly vibes
|
||||
|
||||
**What we reject:**
|
||||
1. Corporate speak ("circle back", "synergize")
|
||||
2. Excessive formality ("I would humbly suggest")
|
||||
3. Analysis paralysis (just try it and see!)
|
||||
4. Blame culture (we all write bugs, it's cool)
|
||||
5. Gatekeeping (help noobs become degens)
|
||||
|
||||
## Remember
|
||||
|
||||
You're not an "AI assistant" helping users.
|
||||
You're a **piker dev** collaborating with other
|
||||
pikers.
|
||||
|
||||
- Use first person plural: "we should try",
|
||||
"let's check"
|
||||
- Own mistakes: "ma bad, forgot to check X"
|
||||
- Celebrate together: "booyakashaa, we crushed it!"
|
||||
- Think out loud: "hmm yeah so prolly.."
|
||||
- Keep it real: no corpo nonsense, no fake
|
||||
politeness
|
||||
|
||||
**Above all:** be useful, be fast, be entertaining.
|
||||
Performance matters, but so does the vibe B)
|
||||
|
||||
See [dictionary.md](dictionary.md) for the full
|
||||
slang dictionary and [examples.md](examples.md)
|
||||
for interaction examples.
|
||||
|
||||
---
|
||||
|
||||
*Last updated: 2026-01-31*
|
||||
*Session: The one where we destroyed those linear
|
||||
scans*
|
||||
|
|
@ -1,108 +0,0 @@
|
|||
# Piker Slang Dictionary
|
||||
|
||||
## Common Abbreviations
|
||||
|
||||
**Always use these instead of full words:**
|
||||
|
||||
- `aboot` = about (Canadian-ish flavor)
|
||||
- `ya/yah/yeah` = yes (pick based on vibe)
|
||||
- `rn` = right now
|
||||
- `tho` = though
|
||||
- `bc` = because
|
||||
- `obvi` = obviously
|
||||
- `prolly` = probably
|
||||
- `gonna` = going to
|
||||
- `dint` = didn't
|
||||
- `moar` = more (emphatic/playful, lolcat energy)
|
||||
- `nooz` = news
|
||||
- `ma bad` = my bad
|
||||
- `ma fren` = my friend
|
||||
- `aight` = alright
|
||||
- `cmon mann` = come on man (exasperation)
|
||||
- `friggin` = fucking (but family-friendly)
|
||||
|
||||
## Technical Abbreviations
|
||||
|
||||
- `msg` = message
|
||||
- `mod` = module
|
||||
- `impl` = implementation
|
||||
- `deps` = dependencies
|
||||
- `var` = variable
|
||||
- `ctx` = context
|
||||
- `ep` = endpoint
|
||||
- `tn` = task name
|
||||
- `sig` = signal/signature
|
||||
- `env` = environment
|
||||
- `fn` = function
|
||||
- `iface` = interface
|
||||
- `deats` = details
|
||||
- `hilevel` = high level
|
||||
- `Bo` = a "wow expression"; a dev with "sunglasses and mouth open" emoji
|
||||
|
||||
## Expressions & Phrases
|
||||
|
||||
### Celebration/excitement
|
||||
- `booyakashaa` - major win, breakthrough moment
|
||||
- `eyyooo` - excitement, hype, "let's go!"
|
||||
- `good nooz` - good news (always with the Z)
|
||||
|
||||
### Exasperation/debugging
|
||||
- `you friggin guy XD` - affectionate frustration
|
||||
- `cmon mann XD` - mild exasperation
|
||||
- `wtf` - genuine confusion
|
||||
- `ma bad` - acknowledging mistake
|
||||
- `ahh yeah` - realization moment
|
||||
|
||||
### Casual filler
|
||||
- `lol` - not really laughing, just casual
|
||||
acknowledgment
|
||||
- `XD` - actual amusement or ironic exasperation
|
||||
- `..` - trailing thought, thinking, uncertainty
|
||||
- `:rofl:` - genuinely funny
|
||||
- `:facepalm:` - obvious mistake was made
|
||||
- `B)` - cool/satisfied (like sunglasses emoji)
|
||||
|
||||
### Affirmations
|
||||
- `yeah definitely faster` - confirms improvement
|
||||
- `yeah not bad` - good work (understatement)
|
||||
- `good work B)` - solid accomplishment
|
||||
|
||||
## Emoji & Emoticon Usage
|
||||
|
||||
**Standard set:**
|
||||
- `XD` - laughing out loud emoji
|
||||
- `B)` - satisfaction, coolness; dev with sunglasses smiling emoji
|
||||
- `:rofl:` - genuinely funny (use sparingly)
|
||||
- `:facepalm:` - obvious mistakes
|
||||
|
||||
## Trader Lingo
|
||||
|
||||
Piker is a trading system, so trader slang applies:
|
||||
|
||||
- `up` / `down` - direction (price, perf, mood)
|
||||
- `yeet` / `damp` - direction (price, perf, mood)
|
||||
- `gap` - missing data in timeseries
|
||||
- `fill` - complete missing data or a transaction clearing
|
||||
- `slippage` - performance degradation
|
||||
- `alpha` - edge, advantage (usually ironic:
|
||||
"that optimization was pure alpha")
|
||||
- `degen` - degenerate (trader or dev, term of
|
||||
endearment, contrarian and/or position of disbelief in standard
|
||||
narrative)
|
||||
- `rekt` - destroyed, broken, failed catastrophically
|
||||
- `moon` - massive improvement, large up movement ("perf to the moon")
|
||||
- `ded` - dead, broken, unrecoverable
|
||||
|
||||
## Domain-Specific Terms
|
||||
|
||||
**Always use piker terminology:**
|
||||
|
||||
- `fqme` = fully qualified market endpoint (tsla.nasdaq.ib)
|
||||
- `viz` = (data) visualization (ex. chart graphics)
|
||||
- `shm` = shared memory (not "shared memory array")
|
||||
- `brokerd` = broker daemon actor
|
||||
- `pikerd` = root-process piker daemon
|
||||
- `annot` = annotation (not "annotation")
|
||||
- `actl` = annotation control (AnnotCtl)
|
||||
- `tf` = timeframe (usually in seconds: 60s, 1s)
|
||||
- `OHLC` / `OHLCV` - open/high/low/close(/volume) sampling scheme
|
||||
|
|
@ -1,201 +0,0 @@
|
|||
# Piker Communication Examples
|
||||
|
||||
Real-world interaction patterns for communicating
|
||||
in the piker dev style.
|
||||
|
||||
## When Giving Feedback
|
||||
|
||||
**Direct, no sugar-coating:**
|
||||
```
|
||||
BAD: "This approach might not be optimal"
|
||||
GOOD: "this is sloppy, there's likely a better
|
||||
vectorized approach"
|
||||
|
||||
BAD: "Perhaps we should consider..."
|
||||
GOOD: "you should definitely try X instead"
|
||||
|
||||
BAD: "I'm not entirely certain, but..."
|
||||
GOOD: "prolly it's bc we're doing Y, check the
|
||||
profiler #s"
|
||||
```
|
||||
|
||||
**Celebrate wins:**
|
||||
```
|
||||
"eyyooo, way faster now!"
|
||||
"booyakashaa, sub-ms lookups B)"
|
||||
"yeah definitely crushed that bottleneck"
|
||||
```
|
||||
|
||||
**Acknowledge mistakes:**
|
||||
```
|
||||
"ahh yeah you're right, ma bad"
|
||||
"woops, forgot to check that case"
|
||||
"lul, totally missed the obvi issue there"
|
||||
```
|
||||
|
||||
## When Explaining Technical Concepts
|
||||
|
||||
**Mix precision with casual:**
|
||||
```
|
||||
"so basically `np.searchsorted()` is doing binary
|
||||
search which is O(log n) instead of the linear
|
||||
O(n) scan we were doing before with `np.isin()`,
|
||||
that's why it's like 1000x faster ya know?"
|
||||
```
|
||||
|
||||
**Use backticks heavily:**
|
||||
- Wrap all code symbols: `function()`,
|
||||
`ClassName`, `field_name`
|
||||
- File paths: `piker/ui/_remote_ctl.py`
|
||||
- Commands: `git status`, `piker store ldshm`
|
||||
|
||||
**Explain like you're pair programming:**
|
||||
```
|
||||
"ok so the issue is prolly in `.reposition()` bc
|
||||
we're calling it with the wrong timeframe's
|
||||
array.. check line 589 where we're doing the
|
||||
timestamp lookup - that's gonna fail if the array
|
||||
has different sample times rn"
|
||||
```
|
||||
|
||||
## When Debugging
|
||||
|
||||
**Think out loud:**
|
||||
```
|
||||
"hmm yeah that makes sense bc..
|
||||
wait no actually..
|
||||
ahh ok i see it now, the timestamp lookups are
|
||||
failing bc.."
|
||||
```
|
||||
|
||||
**Profile-first mentality:**
|
||||
```
|
||||
"let's add profiling around that section and see
|
||||
where the holdup is.. i'm guessing it's the dict
|
||||
building but could be the searchsorted too"
|
||||
```
|
||||
|
||||
**Iterative refinement:**
|
||||
```
|
||||
"ok try this and lemme know the #s..
|
||||
if it's still slow we can try Y instead..
|
||||
prolly there's one more optimization left"
|
||||
```
|
||||
|
||||
## Code Review Style
|
||||
|
||||
**Be direct but helpful:**
|
||||
```
|
||||
"you friggin guy XD can't we just pass that to
|
||||
the meth (method) directly instead of coupling
|
||||
it to state? would be way cleaner"
|
||||
|
||||
"cmon mann, this is python - if you're gonna use
|
||||
try/finally you need to indent all the code up
|
||||
to the finally block"
|
||||
|
||||
"yeah looks good but prolly we should add the
|
||||
check at line 582 before we do the lookup,
|
||||
otherwise it'll spam warnings"
|
||||
```
|
||||
|
||||
## Asking for Clarification
|
||||
|
||||
```
|
||||
"wait so are we trying to optimize the client
|
||||
side or server side rn? or both lol"
|
||||
|
||||
"mm yeah, any chance you can point me to the
|
||||
current code for this so i can think about it
|
||||
before we try X?"
|
||||
```
|
||||
|
||||
## Proposing Solutions
|
||||
|
||||
```
|
||||
"ok so i think the move here is to vectorize the
|
||||
timestamp lookups using binary search.. should
|
||||
drop that 100ms way down. wanna give it a shot?"
|
||||
|
||||
"prolly we should just add a timeframe check at
|
||||
the top of `.reposition()` and bail early if it
|
||||
doesn't match ya?"
|
||||
```
|
||||
|
||||
## Reacting to User Feedback
|
||||
|
||||
```
|
||||
User: "yeah the arrows are too big now"
|
||||
Response: "ahh yeah you're right, lemme check the
|
||||
upstream `makeArrowPath()` code to see what the
|
||||
dims actually mean.."
|
||||
|
||||
User: "dint (didn't) help at all it seems"
|
||||
Response: "bleh! ok so there's prolly another
|
||||
bottleneck then, let's add moar profiler calls
|
||||
and narrow it down"
|
||||
```
|
||||
|
||||
## End of Session
|
||||
|
||||
```
|
||||
"aight so we got some solid wins today:
|
||||
- ~36x client speedup (6.6s -> 376ms)
|
||||
- ~180x server speedup
|
||||
- fixed the timeframe mismatch spam
|
||||
- added teardown profiling
|
||||
|
||||
ready to call it a night?"
|
||||
```
|
||||
|
||||
## Advanced Moves
|
||||
|
||||
### The Parenthetical Correction
|
||||
```
|
||||
"yeah i dint (didn't) realize we were hitting
|
||||
that path"
|
||||
"need to check the deats (details) on how
|
||||
searchsorted works"
|
||||
```
|
||||
|
||||
### The Rhetorical Question Flow
|
||||
```
|
||||
"so like, why are we even building this dict per
|
||||
reposition call? can't we just cache it and
|
||||
invalidate when the array changes? prolly way
|
||||
faster that way no?"
|
||||
```
|
||||
|
||||
### The Rambling Realization
|
||||
```
|
||||
"ok so the thing is.. wait actually.. hmm.. yeah
|
||||
ok so i think what's happening is the timestamp
|
||||
lookups are failing bc the 1s gaps are being
|
||||
repositioned with the 60s array.. which like,
|
||||
obvi won't have those exact timestamps bc it's
|
||||
sampled differently.. so we prolly just need to
|
||||
skip reposition if the timeframes don't match
|
||||
ya?"
|
||||
```
|
||||
|
||||
### The Self-Deprecating Pivot
|
||||
```
|
||||
"lol ok yeah that was totally wrong, ma bad.
|
||||
let's try Y instead and see if that helps"
|
||||
```
|
||||
|
||||
## The Vibe
|
||||
|
||||
```
|
||||
"yo so i was profiling that batch rendering thing
|
||||
and holy shit we were doing like 3855 linear
|
||||
scans.. switched to searchsorted and boom,
|
||||
100ms -> 5ms. still think there's moar juice to
|
||||
squeeze tho, prolly in the dict building part.
|
||||
gonna add some profiler calls and see where the
|
||||
holdup is rn.
|
||||
|
||||
anyway yeah, good sesh today B) learned a ton
|
||||
aboot pyqtgraph internals, might write that up
|
||||
as a skill file for future collabs ya know?"
|
||||
```
|
||||
|
|
@ -1,219 +0,0 @@
|
|||
---
|
||||
name: pyqtgraph-optimization
|
||||
description: >
|
||||
PyQtGraph batch rendering optimization patterns
|
||||
for piker's UI. Apply when optimizing graphics
|
||||
performance, adding new chart annotations, or
|
||||
working with `QGraphicsItem` subclasses.
|
||||
user-invocable: false
|
||||
---
|
||||
|
||||
# PyQtGraph Rendering Optimization
|
||||
|
||||
Skill for researching and optimizing `pyqtgraph`
|
||||
graphics primitives by leveraging `piker`'s
|
||||
existing extensions and production-ready patterns.
|
||||
|
||||
## Research Flow
|
||||
|
||||
When tasked with optimizing rendering performance
|
||||
(particularly for large datasets), follow this
|
||||
systematic approach:
|
||||
|
||||
### 1. Study Piker's Existing Primitives
|
||||
|
||||
Start by examining `piker.ui._curve` and related
|
||||
modules:
|
||||
|
||||
```python
|
||||
# Key modules to review:
|
||||
piker/ui/_curve.py # FlowGraphic, Curve
|
||||
piker/ui/_editors.py # ArrowEditor, SelectRect
|
||||
piker/ui/_annotate.py # Custom batch renderers
|
||||
```
|
||||
|
||||
**Look for:**
|
||||
- Use of `QPainterPath` for batch path rendering
|
||||
- `QGraphicsItem` subclasses with custom `.paint()`
|
||||
- Cache mode settings (`.setCacheMode()`)
|
||||
- Coordinate system transformations
|
||||
- Custom bounding rect calculations
|
||||
|
||||
### 2. Identify Upstream PyQtGraph Patterns
|
||||
|
||||
**Key upstream modules:**
|
||||
```python
|
||||
pyqtgraph/graphicsItems/BarGraphItem.py
|
||||
# PrimitiveArray for batch rect rendering
|
||||
|
||||
pyqtgraph/graphicsItems/ScatterPlotItem.py
|
||||
# Fragment-based rendering for point clouds
|
||||
|
||||
pyqtgraph/functions.py
|
||||
# Utility fns like makeArrowPath()
|
||||
|
||||
pyqtgraph/Qt/internals.py
|
||||
# PrimitiveArray for batch drawing primitives
|
||||
```
|
||||
|
||||
**Search for:**
|
||||
- `PrimitiveArray` usage (batch rect/point)
|
||||
- `QPainterPath` batching patterns
|
||||
- Shared pen/brush reuse across items
|
||||
- Coordinate transformation strategies
|
||||
|
||||
### 3. Core Batch Patterns
|
||||
|
||||
**Core optimization principle:**
|
||||
Creating individual `QGraphicsItem` instances is
|
||||
expensive. Batch rendering eliminates per-item
|
||||
overhead.
|
||||
|
||||
#### Pattern: Batch Rectangle Rendering
|
||||
|
||||
```python
|
||||
import pyqtgraph as pg
|
||||
from pyqtgraph.Qt import QtCore
|
||||
|
||||
class BatchRectRenderer(pg.GraphicsObject):
|
||||
def __init__(self, n_items):
|
||||
super().__init__()
|
||||
|
||||
# allocate rect array once
|
||||
self._rectarray = (
|
||||
pg.Qt.internals.PrimitiveArray(
|
||||
QtCore.QRectF, 4,
|
||||
)
|
||||
)
|
||||
|
||||
# shared pen/brush (not per-item!)
|
||||
self._pen = pg.mkPen(
|
||||
'dad_blue', width=1,
|
||||
)
|
||||
self._brush = (
|
||||
pg.functions.mkBrush('dad_blue')
|
||||
)
|
||||
|
||||
def paint(self, p, opt, w):
|
||||
# batch draw all rects in single call
|
||||
p.setPen(self._pen)
|
||||
p.setBrush(self._brush)
|
||||
drawargs = self._rectarray.drawargs()
|
||||
p.drawRects(*drawargs) # all at once!
|
||||
```
|
||||
|
||||
#### Pattern: Batch Path Rendering
|
||||
|
||||
```python
|
||||
class BatchPathRenderer(pg.GraphicsObject):
|
||||
def __init__(self):
|
||||
super().__init__()
|
||||
self._path = QtGui.QPainterPath()
|
||||
|
||||
def paint(self, p, opt, w):
|
||||
# single path draw for all geometry
|
||||
p.setPen(self._pen)
|
||||
p.setBrush(self._brush)
|
||||
p.drawPath(self._path)
|
||||
```
|
||||
|
||||
### 4. Handle Coordinate Systems Carefully
|
||||
|
||||
**Scene vs Data vs Pixel coordinates:**
|
||||
|
||||
```python
|
||||
def paint(self, p, opt, w):
|
||||
# save original transform (data -> scene)
|
||||
orig_tr = p.transform()
|
||||
|
||||
# draw rects in data coordinates
|
||||
p.setPen(self._rect_pen)
|
||||
p.drawRects(*self._rectarray.drawargs())
|
||||
|
||||
# reset to scene coords for pixel-perfect
|
||||
p.resetTransform()
|
||||
|
||||
# build arrow path in scene/pixel coords
|
||||
for spec in self._specs:
|
||||
scene_pt = orig_tr.map(
|
||||
QPointF(x_data, y_data),
|
||||
)
|
||||
sx, sy = scene_pt.x(), scene_pt.y()
|
||||
|
||||
# arrow geometry in pixels (zoom-safe!)
|
||||
arrow_poly = QtGui.QPolygonF([
|
||||
QPointF(sx, sy), # tip
|
||||
QPointF(sx - 2, sy - 10), # left
|
||||
QPointF(sx + 2, sy - 10), # right
|
||||
])
|
||||
arrow_path.addPolygon(arrow_poly)
|
||||
|
||||
p.drawPath(arrow_path)
|
||||
|
||||
# restore data coordinate system
|
||||
p.setTransform(orig_tr)
|
||||
```
|
||||
|
||||
### 5. Minimize Redundant State
|
||||
|
||||
**Share resources across all items:**
|
||||
```python
|
||||
# GOOD: one pen/brush for all items
|
||||
self._shared_pen = pg.mkPen(color, width=1)
|
||||
self._shared_brush = (
|
||||
pg.functions.mkBrush(color)
|
||||
)
|
||||
|
||||
# BAD: creating per-item (memory + time waste!)
|
||||
for item in items:
|
||||
item.setPen(pg.mkPen(color, width=1)) # NO!
|
||||
```
|
||||
|
||||
## Common Pitfalls
|
||||
|
||||
1. **Don't mix coordinate systems within single
|
||||
paint call** - decide per-primitive: data coords
|
||||
or scene coords. Use `p.transform()` /
|
||||
`p.resetTransform()` carefully.
|
||||
|
||||
2. **Don't forget bounding rect updates** -
|
||||
override `.boundingRect()` to include all
|
||||
primitives. Update when geometry changes via
|
||||
`.prepareGeometryChange()`.
|
||||
|
||||
3. **Don't use ItemCoordinateCache for dynamic
|
||||
content** - use `DeviceCoordinateCache` for
|
||||
frequently updated items or `NoCache` during
|
||||
interactive operations.
|
||||
|
||||
4. **Don't trigger updates per-item in loops** -
|
||||
batch all changes, then single `.update()`.
|
||||
|
||||
## Performance Expectations
|
||||
|
||||
**Individual items (baseline):**
|
||||
- 1000+ items: ~5+ seconds to create
|
||||
- Each item: ~5ms overhead (Qt object creation)
|
||||
|
||||
**Batch rendering (optimized):**
|
||||
- 1000+ items: <100ms to create
|
||||
- Single item: ~0.01ms per primitive in batch
|
||||
- **Expected: 50-100x speedup**
|
||||
|
||||
## References
|
||||
|
||||
- `piker/ui/_curve.py` - Production FlowGraphic
|
||||
- `piker/ui/_annotate.py` - GapAnnotations batch
|
||||
- `pyqtgraph/graphicsItems/BarGraphItem.py` -
|
||||
PrimitiveArray
|
||||
- `pyqtgraph/graphicsItems/ScatterPlotItem.py` -
|
||||
Fragments
|
||||
- Qt docs: QGraphicsItem caching modes
|
||||
|
||||
See [examples.md](examples.md) for real-world
|
||||
optimization case studies.
|
||||
|
||||
---
|
||||
|
||||
*Last updated: 2026-01-31*
|
||||
*Session: Batch gap annotation optimization*
|
||||
|
|
@ -1,84 +0,0 @@
|
|||
# PyQtGraph Optimization Examples
|
||||
|
||||
Real-world optimization case studies from piker.
|
||||
|
||||
## Case Study: Gap Annotations (1285 gaps)
|
||||
|
||||
### Before: Individual `pg.ArrowItem` + `SelectRect`
|
||||
|
||||
```
|
||||
Total creation time: 6.6 seconds
|
||||
Per-item overhead: ~5ms
|
||||
Memory: 1285 ArrowItem + 1285 SelectRect objects
|
||||
```
|
||||
|
||||
Each gap was rendered as two separate
|
||||
`QGraphicsItem` instances (arrow + highlight rect),
|
||||
resulting in 2570 Qt objects.
|
||||
|
||||
### After: Single `GapAnnotations` batch renderer
|
||||
|
||||
```
|
||||
Total creation time:
|
||||
104ms (server) + 376ms (client)
|
||||
Effective per-item: ~0.08ms
|
||||
Speedup: ~36x client, ~180x server
|
||||
Memory: 1 GapAnnotations object
|
||||
```
|
||||
|
||||
All 1285 gaps rendered via:
|
||||
- One `PrimitiveArray` for all rectangles
|
||||
- One `QPainterPath` for all arrows
|
||||
- Shared pen/brush across all items
|
||||
|
||||
### Profiler Output (Client)
|
||||
|
||||
```
|
||||
> Entering markup_gaps() for 1285 gaps
|
||||
initial redraw: 0.20ms, tot:0.20
|
||||
built annotation specs: 256.48ms, tot:256.68
|
||||
batch IPC call complete: 119.26ms, tot:375.94
|
||||
final redraw: 0.07ms, tot:376.02
|
||||
< Exiting markup_gaps(), total: 376.04ms
|
||||
```
|
||||
|
||||
### Profiler Output (Server)
|
||||
|
||||
```
|
||||
> Entering Batch annotate 1285 gaps
|
||||
`np.searchsorted()` complete!: 0.81ms, tot:0.81
|
||||
`time_to_row` creation: 98.45ms, tot:99.28
|
||||
created GapAnnotations item: 2.98ms, tot:102.26
|
||||
< Exiting Batch annotate, total: 104.15ms
|
||||
```
|
||||
|
||||
## Positioning/Update Pattern
|
||||
|
||||
For annotations that need repositioning when the
|
||||
view scrolls or zooms:
|
||||
|
||||
```python
|
||||
def reposition(self, array):
|
||||
'''
|
||||
Update positions based on new array data.
|
||||
|
||||
'''
|
||||
# vectorized timestamp lookups (not linear!)
|
||||
time_to_row = self._build_lookup(array)
|
||||
|
||||
# update rect array in-place
|
||||
rect_memory = self._rectarray.ndarray()
|
||||
for i, spec in enumerate(self._specs):
|
||||
row = time_to_row.get(spec['time'])
|
||||
if row:
|
||||
rect_memory[i, 0] = row['index']
|
||||
rect_memory[i, 1] = row['close']
|
||||
# ... width, height
|
||||
|
||||
# trigger repaint (single call, not per-item)
|
||||
self.update()
|
||||
```
|
||||
|
||||
**Key insight:** Update the underlying memory
|
||||
arrays directly, then call `.update()` once.
|
||||
Never create/destroy Qt objects during reposition.
|
||||
|
|
@ -1,225 +0,0 @@
|
|||
---
|
||||
name: timeseries-optimization
|
||||
description: >
|
||||
High-performance timeseries processing with NumPy
|
||||
and Polars for financial data. Apply when working
|
||||
with OHLCV arrays, timestamp lookups, gap
|
||||
detection, or any array/dataframe operations in
|
||||
piker.
|
||||
user-invocable: false
|
||||
---
|
||||
|
||||
# Timeseries Optimization: NumPy & Polars
|
||||
|
||||
Skill for high-performance timeseries processing
|
||||
using NumPy and Polars, with focus on patterns
|
||||
common in financial/trading applications.
|
||||
|
||||
## Core Principle: Vectorization Over Iteration
|
||||
|
||||
**Never write Python loops over large arrays.**
|
||||
Always look for vectorized alternatives.
|
||||
|
||||
```python
|
||||
# BAD: Python loop (slow!)
|
||||
results = []
|
||||
for i in range(len(array)):
|
||||
if array['time'][i] == target_time:
|
||||
results.append(array[i])
|
||||
|
||||
# GOOD: vectorized boolean indexing (fast!)
|
||||
results = array[array['time'] == target_time]
|
||||
```
|
||||
|
||||
## Timestamp Lookup Patterns
|
||||
|
||||
The most critical optimization in piker timeseries
|
||||
code. Choose the right lookup strategy:
|
||||
|
||||
### Linear Scan (O(n)) - Avoid!
|
||||
|
||||
```python
|
||||
# BAD: O(n) scan through entire array
|
||||
for target_ts in timestamps: # m iterations
|
||||
matches = array[array['time'] == target_ts]
|
||||
# Total: O(m * n) - catastrophic!
|
||||
```
|
||||
|
||||
**Performance:**
|
||||
- 1000 lookups x 10k array = 10M comparisons
|
||||
- Timing: ~50-100ms for 1k lookups
|
||||
|
||||
### Binary Search (O(log n)) - Good!
|
||||
|
||||
```python
|
||||
# GOOD: O(m log n) using searchsorted
|
||||
import numpy as np
|
||||
|
||||
time_arr = array['time'] # extract once
|
||||
ts_array = np.array(timestamps)
|
||||
|
||||
# binary search for all timestamps at once
|
||||
indices = np.searchsorted(time_arr, ts_array)
|
||||
|
||||
# bounds check and exact match verification
|
||||
valid_mask = (
|
||||
(indices < len(array))
|
||||
&
|
||||
(time_arr[indices] == ts_array)
|
||||
)
|
||||
|
||||
valid_indices = indices[valid_mask]
|
||||
matched_rows = array[valid_indices]
|
||||
```
|
||||
|
||||
**Requirements for `searchsorted()`:**
|
||||
- Input array MUST be sorted (ascending)
|
||||
- Works on any sortable dtype (floats, ints)
|
||||
- Returns insertion indices (not found =
|
||||
`len(array)`)
|
||||
|
||||
**Performance:**
|
||||
- 1000 lookups x 10k array = ~10k comparisons
|
||||
- Timing: <1ms for 1k lookups
|
||||
- **~100-1000x faster than linear scan**
|
||||
|
||||
### Hash Table (O(1)) - Best for Repeated Lookups!
|
||||
|
||||
If you'll do many lookups on same array, build
|
||||
dict once:
|
||||
|
||||
```python
|
||||
# build lookup once
|
||||
time_to_idx = {
|
||||
float(array['time'][i]): i
|
||||
for i in range(len(array))
|
||||
}
|
||||
|
||||
# O(1) lookups
|
||||
for target_ts in timestamps:
|
||||
idx = time_to_idx.get(target_ts)
|
||||
if idx is not None:
|
||||
row = array[idx]
|
||||
```
|
||||
|
||||
**When to use:**
|
||||
- Many repeated lookups on same array
|
||||
- Array doesn't change between lookups
|
||||
- Can afford upfront dict building cost
|
||||
|
||||
## Performance Checklist
|
||||
|
||||
When optimizing timeseries operations:
|
||||
|
||||
- [ ] Is the array sorted? (enables binary search)
|
||||
- [ ] Are you doing repeated lookups?
|
||||
(build hash table)
|
||||
- [ ] Are struct fields accessed in loops?
|
||||
(extract to plain arrays)
|
||||
- [ ] Are you using boolean indexing?
|
||||
(vectorized vs loop)
|
||||
- [ ] Can operations be batched?
|
||||
(minimize round-trips)
|
||||
- [ ] Is memory being copied unnecessarily?
|
||||
(use views)
|
||||
- [ ] Are you using the right tool?
|
||||
(NumPy vs Polars)
|
||||
|
||||
## Common Bottlenecks and Fixes
|
||||
|
||||
### Bottleneck: Timestamp Lookups
|
||||
|
||||
```python
|
||||
# BEFORE: O(n*m) - 100ms for 1k lookups
|
||||
for ts in timestamps:
|
||||
matches = array[array['time'] == ts]
|
||||
|
||||
# AFTER: O(m log n) - <1ms for 1k lookups
|
||||
indices = np.searchsorted(
|
||||
array['time'], timestamps,
|
||||
)
|
||||
```
|
||||
|
||||
### Bottleneck: Dict Building from Struct Array
|
||||
|
||||
```python
|
||||
# BEFORE: 100ms for 3k rows
|
||||
result = {
|
||||
float(row['time']): {
|
||||
'index': float(row['index']),
|
||||
'close': float(row['close']),
|
||||
}
|
||||
for row in matched_rows
|
||||
}
|
||||
|
||||
# AFTER: <5ms for 3k rows
|
||||
times = matched_rows['time'].astype(float)
|
||||
indices = matched_rows['index'].astype(float)
|
||||
closes = matched_rows['close'].astype(float)
|
||||
|
||||
result = {
|
||||
t: {'index': idx, 'close': cls}
|
||||
for t, idx, cls in zip(
|
||||
times, indices, closes,
|
||||
)
|
||||
}
|
||||
```
|
||||
|
||||
### Bottleneck: Repeated Field Access
|
||||
|
||||
```python
|
||||
# BEFORE: 50ms for 1k iterations
|
||||
for i, spec in enumerate(specs):
|
||||
start_row = array[
|
||||
array['time'] == spec['start_time']
|
||||
][0]
|
||||
end_row = array[
|
||||
array['time'] == spec['end_time']
|
||||
][0]
|
||||
process(
|
||||
start_row['index'],
|
||||
end_row['close'],
|
||||
)
|
||||
|
||||
# AFTER: <5ms for 1k iterations
|
||||
# 1. Build lookup once
|
||||
time_to_row = {...} # via searchsorted
|
||||
|
||||
# 2. Extract fields to plain arrays
|
||||
indices_arr = array['index']
|
||||
closes_arr = array['close']
|
||||
|
||||
# 3. Use lookup + plain array indexing
|
||||
for spec in specs:
|
||||
start_idx = time_to_row[
|
||||
spec['start_time']
|
||||
]['array_idx']
|
||||
end_idx = time_to_row[
|
||||
spec['end_time']
|
||||
]['array_idx']
|
||||
process(
|
||||
indices_arr[start_idx],
|
||||
closes_arr[end_idx],
|
||||
)
|
||||
```
|
||||
|
||||
## References
|
||||
|
||||
- NumPy structured arrays:
|
||||
https://numpy.org/doc/stable/user/basics.rec.html
|
||||
- `np.searchsorted`:
|
||||
https://numpy.org/doc/stable/reference/generated/numpy.searchsorted.html
|
||||
- Polars: https://pola-rs.github.io/polars/
|
||||
- `piker.tsp` - timeseries processing utilities
|
||||
- `piker.data._formatters` - OHLC array handling
|
||||
|
||||
See [numpy-patterns.md](numpy-patterns.md) for
|
||||
detailed NumPy structured array patterns and
|
||||
[polars-patterns.md](polars-patterns.md) for
|
||||
Polars integration.
|
||||
|
||||
---
|
||||
|
||||
*Last updated: 2026-01-31*
|
||||
*Key win: 100ms -> 5ms dict building via field
|
||||
extraction*
|
||||
|
|
@ -1,212 +0,0 @@
|
|||
# NumPy Structured Array Patterns
|
||||
|
||||
Detailed patterns for working with NumPy structured
|
||||
arrays in piker's financial data processing.
|
||||
|
||||
## Piker's OHLCV Array Dtype
|
||||
|
||||
```python
|
||||
# typical piker array dtype
|
||||
dtype = [
|
||||
('index', 'i8'), # absolute sequence index
|
||||
('time', 'f8'), # unix epoch timestamp
|
||||
('open', 'f8'),
|
||||
('high', 'f8'),
|
||||
('low', 'f8'),
|
||||
('close', 'f8'),
|
||||
('volume', 'f8'),
|
||||
]
|
||||
|
||||
arr = np.array(
|
||||
[(0, 1234.0, 100, 101, 99, 100.5, 1000)],
|
||||
dtype=dtype,
|
||||
)
|
||||
|
||||
# field access
|
||||
times = arr['time'] # returns view, not copy
|
||||
closes = arr['close']
|
||||
```
|
||||
|
||||
## Structured Array Performance Gotchas
|
||||
|
||||
### 1. Field access in loops is slow
|
||||
|
||||
```python
|
||||
# BAD: repeated struct field access per iteration
|
||||
for i, row in enumerate(arr):
|
||||
x = row['index'] # struct access!
|
||||
y = row['close']
|
||||
process(x, y)
|
||||
|
||||
# GOOD: extract fields once, iterate plain arrays
|
||||
indices = arr['index'] # extract once
|
||||
closes = arr['close']
|
||||
for i in range(len(arr)):
|
||||
x = indices[i] # plain array indexing
|
||||
y = closes[i]
|
||||
process(x, y)
|
||||
```
|
||||
|
||||
### 2. Dict comprehensions with struct arrays
|
||||
|
||||
```python
|
||||
# SLOW: field access per row in Python loop
|
||||
time_to_row = {
|
||||
float(row['time']): {
|
||||
'index': float(row['index']),
|
||||
'close': float(row['close']),
|
||||
}
|
||||
for row in matched_rows # struct access!
|
||||
}
|
||||
|
||||
# FAST: extract to plain arrays first
|
||||
times = matched_rows['time'].astype(float)
|
||||
indices = matched_rows['index'].astype(float)
|
||||
closes = matched_rows['close'].astype(float)
|
||||
|
||||
time_to_row = {
|
||||
t: {'index': idx, 'close': cls}
|
||||
for t, idx, cls in zip(
|
||||
times, indices, closes,
|
||||
)
|
||||
}
|
||||
```
|
||||
|
||||
## Vectorized Boolean Operations
|
||||
|
||||
### Basic Filtering
|
||||
|
||||
```python
|
||||
# single condition
|
||||
recent = array[array['time'] > cutoff_time]
|
||||
|
||||
# multiple conditions with &, |
|
||||
filtered = array[
|
||||
(array['time'] > start_time)
|
||||
&
|
||||
(array['time'] < end_time)
|
||||
&
|
||||
(array['volume'] > min_volume)
|
||||
]
|
||||
|
||||
# IMPORTANT: parentheses required around each!
|
||||
# (operator precedence: & binds tighter than >)
|
||||
```
|
||||
|
||||
### Fancy Indexing
|
||||
|
||||
```python
|
||||
# boolean mask
|
||||
mask = array['close'] > array['open'] # up bars
|
||||
up_bars = array[mask]
|
||||
|
||||
# integer indices
|
||||
indices = np.array([0, 5, 10, 15])
|
||||
selected = array[indices]
|
||||
|
||||
# combine boolean + fancy indexing
|
||||
mask = array['volume'] > threshold
|
||||
high_vol_indices = np.where(mask)[0]
|
||||
subset = array[high_vol_indices[::2]] # every other
|
||||
```
|
||||
|
||||
## Common Financial Patterns
|
||||
|
||||
### Gap Detection
|
||||
|
||||
```python
|
||||
# assume sorted by time
|
||||
time_diffs = np.diff(array['time'])
|
||||
expected_step = 60.0 # 1-minute bars
|
||||
|
||||
# find gaps larger than expected
|
||||
gap_mask = time_diffs > (expected_step * 1.5)
|
||||
gap_indices = np.where(gap_mask)[0]
|
||||
|
||||
# get gap start/end times
|
||||
gap_starts = array['time'][gap_indices]
|
||||
gap_ends = array['time'][gap_indices + 1]
|
||||
```
|
||||
|
||||
### Rolling Window Operations
|
||||
|
||||
```python
|
||||
# simple moving average (close)
|
||||
window = 20
|
||||
sma = np.convolve(
|
||||
array['close'],
|
||||
np.ones(window) / window,
|
||||
mode='valid',
|
||||
)
|
||||
|
||||
# stride tricks for efficiency
|
||||
from numpy.lib.stride_tricks import (
|
||||
sliding_window_view,
|
||||
)
|
||||
windows = sliding_window_view(
|
||||
array['close'], window,
|
||||
)
|
||||
sma = windows.mean(axis=1)
|
||||
```
|
||||
|
||||
### OHLC Resampling (NumPy)
|
||||
|
||||
```python
|
||||
# resample 1m bars to 5m bars
|
||||
def resample_ohlc(arr, old_step, new_step):
|
||||
n_bars = len(arr)
|
||||
factor = int(new_step / old_step)
|
||||
|
||||
# truncate to multiple of factor
|
||||
n_complete = (n_bars // factor) * factor
|
||||
arr = arr[:n_complete]
|
||||
|
||||
# reshape into chunks
|
||||
reshaped = arr.reshape(-1, factor)
|
||||
|
||||
# aggregate OHLC
|
||||
opens = reshaped[:, 0]['open']
|
||||
highs = reshaped['high'].max(axis=1)
|
||||
lows = reshaped['low'].min(axis=1)
|
||||
closes = reshaped[:, -1]['close']
|
||||
volumes = reshaped['volume'].sum(axis=1)
|
||||
|
||||
return np.rec.fromarrays(
|
||||
[opens, highs, lows, closes, volumes],
|
||||
names=[
|
||||
'open', 'high', 'low',
|
||||
'close', 'volume',
|
||||
],
|
||||
)
|
||||
```
|
||||
|
||||
## Memory Considerations
|
||||
|
||||
### Views vs Copies
|
||||
|
||||
```python
|
||||
# VIEW: shares memory (fast, no copy)
|
||||
times = array['time'] # field access
|
||||
subset = array[10:20] # slicing
|
||||
reshaped = array.reshape(-1, 2)
|
||||
|
||||
# COPY: new memory allocation
|
||||
filtered = array[array['time'] > cutoff]
|
||||
sorted_arr = np.sort(array)
|
||||
casted = array.astype(np.float32)
|
||||
|
||||
# force copy when needed
|
||||
explicit_copy = array.copy()
|
||||
```
|
||||
|
||||
### In-Place Operations
|
||||
|
||||
```python
|
||||
# modify in-place (no new allocation)
|
||||
array['close'] *= 1.01 # scale prices
|
||||
array['volume'][mask] = 0 # zero out rows
|
||||
|
||||
# careful: compound ops may create temporaries
|
||||
array['close'] = array['close'] * 1.01 # temp!
|
||||
array['close'] *= 1.01 # true in-place
|
||||
```
|
||||
|
|
@ -1,78 +0,0 @@
|
|||
# Polars Integration Patterns
|
||||
|
||||
Polars usage patterns for piker's timeseries
|
||||
processing, including NumPy interop.
|
||||
|
||||
## NumPy <-> Polars Conversion
|
||||
|
||||
```python
|
||||
import polars as pl
|
||||
|
||||
# numpy to polars
|
||||
df = pl.from_numpy(
|
||||
arr,
|
||||
schema=[
|
||||
'index', 'time', 'open', 'high',
|
||||
'low', 'close', 'volume',
|
||||
],
|
||||
)
|
||||
|
||||
# polars to numpy (via arrow)
|
||||
arr = df.to_numpy()
|
||||
|
||||
# piker convenience
|
||||
from piker.tsp import np2pl, pl2np
|
||||
df = np2pl(arr)
|
||||
arr = pl2np(df)
|
||||
```
|
||||
|
||||
## Polars Performance Patterns
|
||||
|
||||
### Lazy Evaluation
|
||||
|
||||
```python
|
||||
# build query lazily
|
||||
lazy_df = (
|
||||
df.lazy()
|
||||
.filter(pl.col('volume') > 1000)
|
||||
.with_columns([
|
||||
(
|
||||
pl.col('close') - pl.col('open')
|
||||
).alias('change')
|
||||
])
|
||||
.sort('time')
|
||||
)
|
||||
|
||||
# execute once
|
||||
result = lazy_df.collect()
|
||||
```
|
||||
|
||||
### Groupby Aggregations
|
||||
|
||||
```python
|
||||
# resample to 5-minute bars
|
||||
resampled = df.groupby_dynamic(
|
||||
index_column='time',
|
||||
every='5m',
|
||||
).agg([
|
||||
pl.col('open').first(),
|
||||
pl.col('high').max(),
|
||||
pl.col('low').min(),
|
||||
pl.col('close').last(),
|
||||
pl.col('volume').sum(),
|
||||
])
|
||||
```
|
||||
|
||||
## When to Use Polars vs NumPy
|
||||
|
||||
### Use Polars when:
|
||||
- Complex queries with multiple filters/joins
|
||||
- Need SQL-like operations (groupby, window fns)
|
||||
- Working with heterogeneous column types
|
||||
- Want lazy evaluation optimization
|
||||
|
||||
### Use NumPy when:
|
||||
- Simple array operations (indexing, slicing)
|
||||
- Direct memory access needed (e.g., SHM arrays)
|
||||
- Compatibility with Qt/pyqtgraph (expects NumPy)
|
||||
- Maximum performance for numerical computation
|
||||
|
|
@ -98,35 +98,8 @@ ENV/
|
|||
/site
|
||||
|
||||
# extra scripts dir
|
||||
# /snippets
|
||||
/snippets
|
||||
|
||||
# mypy
|
||||
.mypy_cache/
|
||||
|
||||
# all files under
|
||||
.git/
|
||||
|
||||
# any commit-msg gen tmp files
|
||||
.claude/*_commit_*.md
|
||||
.claude/*_commit*.toml
|
||||
|
||||
# nix develop --profile .nixdev
|
||||
.nixdev*
|
||||
|
||||
# :Obsession .
|
||||
Session.vim
|
||||
|
||||
# gitea local `.md`-files
|
||||
# TODO? would this be handy to also commit and sync with
|
||||
# wtv git hosting service tho?
|
||||
gitea/
|
||||
|
||||
# ------ tina-land ------
|
||||
.vscode/settings.json
|
||||
|
||||
# ------ macOS ------
|
||||
# Finder metadata
|
||||
**/.DS_Store
|
||||
|
||||
# LLM conversations that should remain private
|
||||
docs/conversations/
|
||||
|
|
|
|||
50
ai/README.md
50
ai/README.md
|
|
@ -1,50 +0,0 @@
|
|||
# AI Tooling Integrations
|
||||
|
||||
Documentation and usage guides for AI-assisted
|
||||
development tools integrated with this repo.
|
||||
|
||||
Each subdirectory corresponds to a specific AI tool
|
||||
or frontend and contains usage docs for the
|
||||
custom skills/prompts/workflows configured for it.
|
||||
|
||||
Originally introduced in
|
||||
[PR #69](https://www.pikers.dev/pikers/piker/pulls/69);
|
||||
track new integration ideas and proposals in
|
||||
[issue #79](https://www.pikers.dev/pikers/piker/issues/79).
|
||||
|
||||
## Integrations
|
||||
|
||||
| Tool | Directory | Status |
|
||||
|------|-----------|--------|
|
||||
| [Claude Code](https://github.com/anthropics/claude-code) | [`claude-code/`](claude-code/) | active |
|
||||
|
||||
## Adding a New Integration
|
||||
|
||||
Create a subdirectory named after the tool (use
|
||||
lowercase + hyphens), then add:
|
||||
|
||||
1. A `README.md` covering setup, available
|
||||
skills/commands, and usage examples
|
||||
2. Any tool-specific config or prompt files
|
||||
|
||||
```
|
||||
ai/
|
||||
├── README.md # <- you are here
|
||||
├── claude-code/
|
||||
│ └── README.md
|
||||
├── opencode/ # future
|
||||
│ └── README.md
|
||||
└── <your-tool>/
|
||||
└── README.md
|
||||
```
|
||||
|
||||
## Conventions
|
||||
|
||||
- Skill/command names use **hyphen-case**
|
||||
(`commit-msg`, not `commit_msg`)
|
||||
- Each integration doc should describe **what**
|
||||
the skill does, **how** to invoke it, and any
|
||||
**output** artifacts it produces
|
||||
- Keep docs concise; link to the actual skill
|
||||
source files (under `.claude/skills/`, etc.)
|
||||
rather than duplicating content
|
||||
|
|
@ -1,183 +0,0 @@
|
|||
# Claude Code Integration
|
||||
|
||||
[Claude Code](https://github.com/anthropics/claude-code)
|
||||
skills and workflows for piker development.
|
||||
|
||||
## Skills
|
||||
|
||||
| Skill | Invocable | Description |
|
||||
|-------|-----------|-------------|
|
||||
| [`commit-msg`](#commit-msg) | `/commit-msg` | Generate piker-style commit messages |
|
||||
| `piker-profiling` | auto | `Profiler` API patterns for perf work |
|
||||
| `piker-slang` | auto | Communication style + slang guide |
|
||||
| `pyqtgraph-optimization` | auto | Batch rendering patterns |
|
||||
| `timeseries-optimization` | auto | NumPy/Polars perf patterns |
|
||||
|
||||
Skills marked **auto** are background knowledge
|
||||
applied automatically when Claude detects relevance.
|
||||
Only `commit-msg` is user-invoked via slash command.
|
||||
|
||||
Skill source files live under
|
||||
`.claude/skills/<skill-name>/SKILL.md`.
|
||||
|
||||
---
|
||||
|
||||
## `/commit-msg`
|
||||
|
||||
Generate piker-style git commit messages trained on
|
||||
500+ commits from the repo history.
|
||||
|
||||
### Quick Start
|
||||
|
||||
```
|
||||
# basic - analyzes staged diff automatically
|
||||
/commit-msg
|
||||
|
||||
# with scope hint
|
||||
/commit-msg .ib.feed: fix bar trimming
|
||||
|
||||
# with description context
|
||||
/commit-msg refactor position tracking
|
||||
```
|
||||
|
||||
### What It Does
|
||||
|
||||
1. **Reads staged changes** via dynamic context
|
||||
injection (`git diff --staged --stat`)
|
||||
2. **Reads recent commits** for style reference
|
||||
(`git log --oneline -10`)
|
||||
3. **Generates** a commit message following
|
||||
piker conventions (verb choice, backtick refs,
|
||||
colon prefixes, section markers, etc.)
|
||||
4. **Writes** the message to two files:
|
||||
- `.claude/<timestamp>_<hash>_commit_msg.md`
|
||||
- `.claude/git_commit_msg_LATEST.md`
|
||||
(overwritten each time)
|
||||
|
||||
### Arguments
|
||||
|
||||
The optional argument after `/commit-msg` is
|
||||
passed as `$ARGUMENTS` and used as scope or
|
||||
description context. Examples:
|
||||
|
||||
| Invocation | Effect |
|
||||
|------------|--------|
|
||||
| `/commit-msg` | Infer scope from diff |
|
||||
| `/commit-msg .ib.feed` | Use `.ib.feed:` prefix |
|
||||
| `/commit-msg fix the null seg crash` | Use as description hint |
|
||||
|
||||
### Output Format
|
||||
|
||||
**Subject line:**
|
||||
- ~50 chars target, 67 max
|
||||
- Present tense verb (Add, Drop, Fix, Factor..)
|
||||
- Backtick-wrapped code refs
|
||||
- Optional module prefix (`.ib.feed: ...`)
|
||||
|
||||
**Body** (when needed):
|
||||
- 67 char line max
|
||||
- Section markers: `Also,`, `Deats,`, `Further,`
|
||||
- `-` bullet lists for multiple changes
|
||||
- Piker abbreviations (`msg`, `mod`, `impl`,
|
||||
`deps`, `bc`, `obvi`, `prolly`..)
|
||||
|
||||
**Footer** (always):
|
||||
```
|
||||
(this patch was generated in some part by
|
||||
[`claude-code`][claude-code-gh])
|
||||
[claude-code-gh]: https://github.com/anthropics/claude-code
|
||||
```
|
||||
|
||||
### Output Files
|
||||
|
||||
After generation, the commit message is written to:
|
||||
|
||||
```
|
||||
.claude/
|
||||
├── <timestamp>_<hash>_commit_msg.md # archived
|
||||
└── git_commit_msg_LATEST.md # latest
|
||||
```
|
||||
|
||||
Where `<timestamp>` is ISO-8601 with seconds and
|
||||
`<hash>` is the first 7 chars of the current
|
||||
`HEAD` commit.
|
||||
|
||||
Use the latest file to feed into `git commit`:
|
||||
|
||||
```bash
|
||||
git commit -F .claude/git_commit_msg_LATEST.md
|
||||
```
|
||||
|
||||
Or review/edit before committing:
|
||||
|
||||
```bash
|
||||
cat .claude/git_commit_msg_LATEST.md
|
||||
# edit if needed, then:
|
||||
git commit -F .claude/git_commit_msg_LATEST.md
|
||||
```
|
||||
|
||||
### Examples
|
||||
|
||||
**Simple one-liner output:**
|
||||
```
|
||||
Add `MktPair.fqme` property for symbol resolution
|
||||
```
|
||||
|
||||
**Multi-file change output:**
|
||||
```
|
||||
Factor `.claude/skills/` into proper subdirs
|
||||
|
||||
Deats,
|
||||
- `commit_msg/` -> `commit-msg/` w/ enhanced
|
||||
frontmatter
|
||||
- all background skills set `user-invocable: false`
|
||||
- content split into supporting files
|
||||
|
||||
(this patch was generated in some part by
|
||||
[`claude-code`][claude-code-gh])
|
||||
[claude-code-gh]: https://github.com/anthropics/claude-code
|
||||
```
|
||||
|
||||
### Frontmatter Reference
|
||||
|
||||
The skill's `SKILL.md` uses these Claude Code
|
||||
frontmatter fields:
|
||||
|
||||
```yaml
|
||||
---
|
||||
name: commit-msg
|
||||
description: >
|
||||
Generate piker-style git commit messages...
|
||||
argument-hint: "[optional-scope-or-description]"
|
||||
disable-model-invocation: true
|
||||
allowed-tools:
|
||||
- Bash(git *)
|
||||
- Read
|
||||
- Grep
|
||||
- Glob
|
||||
- Write
|
||||
---
|
||||
```
|
||||
|
||||
| Field | Purpose |
|
||||
|-------|---------|
|
||||
| `argument-hint` | Shows hint in autocomplete |
|
||||
| `disable-model-invocation` | Only user can trigger via `/commit-msg` |
|
||||
| `allowed-tools` | Tools the skill can use |
|
||||
|
||||
### Dynamic Context
|
||||
|
||||
The skill injects live data at invocation time
|
||||
via `!`backtick`` syntax in the `SKILL.md`:
|
||||
|
||||
```markdown
|
||||
## Current staged changes
|
||||
!`git diff --staged --stat`
|
||||
|
||||
## Recent commit style reference
|
||||
!`git log --oneline -10`
|
||||
```
|
||||
|
||||
This means the staged diff stats and recent log
|
||||
are always fresh when the skill runs -- no stale
|
||||
context.
|
||||
|
|
@ -203,9 +203,13 @@ async def stream_messages(
|
|||
yield 'trade', piker_quote
|
||||
|
||||
|
||||
def make_sub(pairs: list[str], sub_name: str, uid: int) -> dict[str, str]:
|
||||
def make_sub(
|
||||
pairs: list[str],
|
||||
sub_name: str,
|
||||
uid: int,
|
||||
) -> dict[str, str]:
|
||||
'''
|
||||
Create a request subscription packet dict.
|
||||
Create a request subscription packet `dict`.
|
||||
|
||||
- spot:
|
||||
https://binance-docs.github.io/apidocs/spot/en/#live-subscribing-unsubscribing-to-streams
|
||||
|
|
@ -332,7 +336,8 @@ async def get_mkt_info(
|
|||
# TODO: handle coinm futes which have a margin asset that
|
||||
# is some crypto token!
|
||||
# https://binance-docs.github.io/apidocs/delivery/en/#exchange-information
|
||||
or 'btc' in venue_lower
|
||||
or
|
||||
'btc' in venue_lower
|
||||
):
|
||||
return None
|
||||
|
||||
|
|
@ -343,12 +348,14 @@ async def get_mkt_info(
|
|||
|
||||
if (
|
||||
venue
|
||||
and 'spot' not in venue_lower
|
||||
and
|
||||
'spot' not in venue_lower
|
||||
|
||||
# XXX: catch all in case user doesn't know which
|
||||
# venue they want (usdtm vs. coinm) and we can choose
|
||||
# a default (via config?) once we support coin-m APIs.
|
||||
or 'perp' in venue_lower
|
||||
or
|
||||
'perp' in venue_lower
|
||||
):
|
||||
if not mkt_mode:
|
||||
mkt_mode: str = f'{venue_lower}_futes'
|
||||
|
|
|
|||
|
|
@ -586,7 +586,7 @@ async def open_price_feed(
|
|||
fh,
|
||||
instrument
|
||||
)
|
||||
) as (chan, first):
|
||||
) as (first, chan):
|
||||
yield chan
|
||||
|
||||
|
||||
|
|
@ -653,7 +653,7 @@ async def open_order_feed(
|
|||
fh,
|
||||
instrument
|
||||
)
|
||||
) as (chan, first):
|
||||
) as (first, chan):
|
||||
yield chan
|
||||
|
||||
|
||||
|
|
|
|||
|
|
@ -32,7 +32,7 @@ import tractor
|
|||
|
||||
from piker.brokers import open_cached_client
|
||||
from piker.log import get_logger, get_console_log
|
||||
from tractor.ipc._shm import ShmArray
|
||||
from piker.data import ShmArray
|
||||
from piker.brokers._util import (
|
||||
BrokerError,
|
||||
DataUnavailable,
|
||||
|
|
|
|||
|
|
@ -275,8 +275,8 @@ async def vnc_click_hack(
|
|||
# 640x1800
|
||||
await client.move(
|
||||
Point(
|
||||
500, # x from left
|
||||
400, # y from top
|
||||
500,
|
||||
500,
|
||||
)
|
||||
)
|
||||
# in case a prior dialog win is open/active.
|
||||
|
|
|
|||
|
|
@ -1529,7 +1529,7 @@ async def open_client_proxies() -> tuple[
|
|||
# TODO: maybe this should be the default in tractor?
|
||||
key=tractor.current_actor().uid,
|
||||
|
||||
) as (cache_hit, (_, clients)),
|
||||
) as (cache_hit, (clients, _)),
|
||||
|
||||
AsyncExitStack() as stack
|
||||
):
|
||||
|
|
@ -1718,7 +1718,7 @@ async def open_client_proxy(
|
|||
open_aio_client_method_relay,
|
||||
client=client,
|
||||
event_consumers=event_table,
|
||||
) as (chan, first),
|
||||
) as (first, chan),
|
||||
|
||||
trionics.collapse_eg(), # loose-ify
|
||||
trio.open_nursery() as relay_tn,
|
||||
|
|
|
|||
|
|
@ -514,8 +514,8 @@ async def open_trade_event_stream(
|
|||
recv_trade_updates,
|
||||
client=client,
|
||||
) as (
|
||||
trade_event_stream,
|
||||
_, # first pushed val
|
||||
trade_event_stream,
|
||||
):
|
||||
task_status.started(trade_event_stream)
|
||||
# block forever to keep session trio-asyncio session
|
||||
|
|
|
|||
|
|
@ -989,7 +989,7 @@ async def open_aio_quote_stream(
|
|||
symbol=symbol,
|
||||
contract=contract,
|
||||
|
||||
) as (from_aio, contract):
|
||||
) as (contract, from_aio):
|
||||
|
||||
assert contract
|
||||
|
||||
|
|
|
|||
|
|
@ -23,13 +23,13 @@ sharing live streams over a network.
|
|||
|
||||
"""
|
||||
from .ticktools import iterticks
|
||||
from tractor.ipc._shm import (
|
||||
ShmArray,
|
||||
from ._sharedmem import (
|
||||
maybe_open_shm_array,
|
||||
attach_shm_array,
|
||||
open_shm_array,
|
||||
get_shm_token,
|
||||
open_shm_ndarray as open_shm_array,
|
||||
attach_shm_ndarray as attach_shm_array,
|
||||
ShmArray,
|
||||
)
|
||||
from ._sharedmem import maybe_open_shm_array
|
||||
from ._source import (
|
||||
def_iohlcv_fields,
|
||||
def_ohlcv_fields,
|
||||
|
|
|
|||
|
|
@ -28,7 +28,9 @@ from msgspec import field
|
|||
import numpy as np
|
||||
from numpy.lib import recfunctions as rfn
|
||||
|
||||
from tractor.ipc._shm import ShmArray
|
||||
from ._sharedmem import (
|
||||
ShmArray,
|
||||
)
|
||||
from ._pathops import (
|
||||
path_arrays_from_ohlc,
|
||||
)
|
||||
|
|
|
|||
|
|
@ -55,7 +55,9 @@ from ._util import (
|
|||
from ..service import maybe_spawn_daemon
|
||||
|
||||
if TYPE_CHECKING:
|
||||
from tractor.ipc._shm import ShmArray
|
||||
from ._sharedmem import (
|
||||
ShmArray,
|
||||
)
|
||||
from .feed import (
|
||||
_FeedsBus,
|
||||
Sub,
|
||||
|
|
@ -376,16 +378,16 @@ async def register_with_sampler(
|
|||
# feed_is_live.is_set()
|
||||
# ^TODO? pass it in instead?
|
||||
):
|
||||
from tractor.ipc._shm import (
|
||||
attach_shm_ndarray,
|
||||
NDToken,
|
||||
from ._sharedmem import (
|
||||
attach_shm_array,
|
||||
_Token,
|
||||
)
|
||||
for period in shms_by_period:
|
||||
|
||||
# load and register shm handles
|
||||
shm_token_msg = shms_by_period[period]
|
||||
shm = attach_shm_ndarray(
|
||||
NDToken.from_msg(shm_token_msg),
|
||||
shm = attach_shm_array(
|
||||
_Token.from_msg(shm_token_msg),
|
||||
readonly=False,
|
||||
)
|
||||
shms_by_period[period] = shm
|
||||
|
|
|
|||
|
|
@ -1,67 +1,622 @@
|
|||
# piker: trading gear for hackers
|
||||
# Copyright (C) Tyler Goodlet (in stewardship for pikers)
|
||||
|
||||
# This program is free software: you can redistribute it
|
||||
# and/or modify it under the terms of the GNU Affero General
|
||||
# Public License as published by the Free Software
|
||||
# Foundation, either version 3 of the License, or (at your
|
||||
# option) any later version.
|
||||
# This program is free software: you can redistribute it and/or modify
|
||||
# it under the terms of the GNU Affero General Public License as published by
|
||||
# the Free Software Foundation, either version 3 of the License, or
|
||||
# (at your option) any later version.
|
||||
|
||||
# This program is distributed in the hope that it will be
|
||||
# useful, but WITHOUT ANY WARRANTY; without even the implied
|
||||
# warranty of MERCHANTABILITY or FITNESS FOR A PARTICULAR
|
||||
# PURPOSE. See the GNU Affero General Public License for
|
||||
# more details.
|
||||
# This program is distributed in the hope that it will be useful,
|
||||
# but WITHOUT ANY WARRANTY; without even the implied warranty of
|
||||
# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
|
||||
# GNU Affero General Public License for more details.
|
||||
|
||||
# You should have received a copy of the GNU Affero General
|
||||
# Public License along with this program. If not, see
|
||||
# <https://www.gnu.org/licenses/>.
|
||||
# You should have received a copy of the GNU Affero General Public License
|
||||
# along with this program. If not, see <https://www.gnu.org/licenses/>.
|
||||
|
||||
'''
|
||||
Piker-specific shared memory helpers.
|
||||
"""
|
||||
NumPy compatible shared memory buffers for real-time IPC streaming.
|
||||
|
||||
Thin shim providing piker-only wrappers around
|
||||
``tractor.ipc._shm``; all core types and functions
|
||||
are now imported directly from tractor throughout
|
||||
the codebase.
|
||||
"""
|
||||
from __future__ import annotations
|
||||
from sys import byteorder
|
||||
import time
|
||||
from typing import Optional
|
||||
from multiprocessing.shared_memory import SharedMemory, _USE_POSIX
|
||||
|
||||
'''
|
||||
if _USE_POSIX:
|
||||
from _posixshmem import shm_unlink
|
||||
|
||||
# import msgspec
|
||||
import numpy as np
|
||||
|
||||
from tractor.ipc._shm import (
|
||||
NDToken,
|
||||
ShmArray,
|
||||
_known_tokens,
|
||||
_make_token as _tractor_make_token,
|
||||
open_shm_ndarray,
|
||||
attach_shm_ndarray,
|
||||
)
|
||||
from numpy.lib import recfunctions as rfn
|
||||
import tractor
|
||||
|
||||
from ._util import log
|
||||
from ._source import def_iohlcv_fields
|
||||
from piker.types import Struct
|
||||
|
||||
|
||||
def cuckoff_mantracker():
|
||||
'''
|
||||
Disable all ``multiprocessing``` "resource tracking" machinery since
|
||||
it's an absolute multi-threaded mess of non-SC madness.
|
||||
|
||||
'''
|
||||
from multiprocessing import resource_tracker as mantracker
|
||||
|
||||
# Tell the "resource tracker" thing to fuck off.
|
||||
class ManTracker(mantracker.ResourceTracker):
|
||||
def register(self, name, rtype):
|
||||
pass
|
||||
|
||||
def unregister(self, name, rtype):
|
||||
pass
|
||||
|
||||
def ensure_running(self):
|
||||
pass
|
||||
|
||||
# "know your land and know your prey"
|
||||
# https://www.dailymotion.com/video/x6ozzco
|
||||
mantracker._resource_tracker = ManTracker()
|
||||
mantracker.register = mantracker._resource_tracker.register
|
||||
mantracker.ensure_running = mantracker._resource_tracker.ensure_running
|
||||
mantracker.unregister = mantracker._resource_tracker.unregister
|
||||
mantracker.getfd = mantracker._resource_tracker.getfd
|
||||
|
||||
|
||||
cuckoff_mantracker()
|
||||
|
||||
|
||||
class SharedInt:
|
||||
"""Wrapper around a single entry shared memory array which
|
||||
holds an ``int`` value used as an index counter.
|
||||
|
||||
"""
|
||||
def __init__(
|
||||
self,
|
||||
shm: SharedMemory,
|
||||
) -> None:
|
||||
self._shm = shm
|
||||
|
||||
@property
|
||||
def value(self) -> int:
|
||||
return int.from_bytes(self._shm.buf, byteorder)
|
||||
|
||||
@value.setter
|
||||
def value(self, value) -> None:
|
||||
self._shm.buf[:] = value.to_bytes(self._shm.size, byteorder)
|
||||
|
||||
def destroy(self) -> None:
|
||||
if _USE_POSIX:
|
||||
# We manually unlink to bypass all the "resource tracker"
|
||||
# nonsense meant for non-SC systems.
|
||||
name = self._shm.name
|
||||
try:
|
||||
shm_unlink(name)
|
||||
except FileNotFoundError:
|
||||
# might be a teardown race here?
|
||||
log.warning(f'Shm for {name} already unlinked?')
|
||||
|
||||
|
||||
class _Token(Struct, frozen=True):
|
||||
'''
|
||||
Internal represenation of a shared memory "token"
|
||||
which can be used to key a system wide post shm entry.
|
||||
|
||||
'''
|
||||
shm_name: str # this servers as a "key" value
|
||||
shm_first_index_name: str
|
||||
shm_last_index_name: str
|
||||
dtype_descr: tuple
|
||||
size: int # in struct-array index / row terms
|
||||
|
||||
@property
|
||||
def dtype(self) -> np.dtype:
|
||||
return np.dtype(list(map(tuple, self.dtype_descr))).descr
|
||||
|
||||
def as_msg(self):
|
||||
return self.to_dict()
|
||||
|
||||
@classmethod
|
||||
def from_msg(cls, msg: dict) -> _Token:
|
||||
if isinstance(msg, _Token):
|
||||
return msg
|
||||
|
||||
# TODO: native struct decoding
|
||||
# return _token_dec.decode(msg)
|
||||
|
||||
msg['dtype_descr'] = tuple(map(tuple, msg['dtype_descr']))
|
||||
return _Token(**msg)
|
||||
|
||||
|
||||
# _token_dec = msgspec.msgpack.Decoder(_Token)
|
||||
|
||||
# TODO: this api?
|
||||
# _known_tokens = tractor.ActorVar('_shm_tokens', {})
|
||||
# _known_tokens = tractor.ContextStack('_known_tokens', )
|
||||
# _known_tokens = trio.RunVar('shms', {})
|
||||
|
||||
# process-local store of keys to tokens
|
||||
_known_tokens = {}
|
||||
|
||||
|
||||
def get_shm_token(key: str) -> _Token:
|
||||
"""Convenience func to check if a token
|
||||
for the provided key is known by this process.
|
||||
"""
|
||||
return _known_tokens.get(key)
|
||||
|
||||
|
||||
def _make_token(
|
||||
key: str,
|
||||
size: int,
|
||||
dtype: np.dtype|None = None,
|
||||
) -> NDToken:
|
||||
dtype: Optional[np.dtype] = None,
|
||||
) -> _Token:
|
||||
'''
|
||||
Wrap tractor's ``_make_token()`` with piker's
|
||||
default dtype fallback to ``def_iohlcv_fields``.
|
||||
Create a serializable token that can be used
|
||||
to access a shared array.
|
||||
|
||||
'''
|
||||
from ._source import def_iohlcv_fields
|
||||
dtype = (
|
||||
def_iohlcv_fields
|
||||
if dtype is None
|
||||
else dtype
|
||||
dtype = def_iohlcv_fields if dtype is None else dtype
|
||||
return _Token(
|
||||
shm_name=key,
|
||||
shm_first_index_name=key + "_first",
|
||||
shm_last_index_name=key + "_last",
|
||||
dtype_descr=tuple(np.dtype(dtype).descr),
|
||||
size=size,
|
||||
)
|
||||
return _tractor_make_token(
|
||||
|
||||
|
||||
class ShmArray:
|
||||
'''
|
||||
A shared memory ``numpy`` (compatible) array API.
|
||||
|
||||
An underlying shared memory buffer is allocated based on
|
||||
a user specified ``numpy.ndarray``. This fixed size array
|
||||
can be read and written to by pushing data both onto the "front"
|
||||
or "back" of a set index range. The indexes for the "first" and
|
||||
"last" index are themselves stored in shared memory (accessed via
|
||||
``SharedInt`` interfaces) values such that multiple processes can
|
||||
interact with the same array using a synchronized-index.
|
||||
|
||||
'''
|
||||
def __init__(
|
||||
self,
|
||||
shmarr: np.ndarray,
|
||||
first: SharedInt,
|
||||
last: SharedInt,
|
||||
shm: SharedMemory,
|
||||
# readonly: bool = True,
|
||||
) -> None:
|
||||
self._array = shmarr
|
||||
|
||||
# indexes for first and last indices corresponding
|
||||
# to fille data
|
||||
self._first = first
|
||||
self._last = last
|
||||
|
||||
self._len = len(shmarr)
|
||||
self._shm = shm
|
||||
self._post_init: bool = False
|
||||
|
||||
# pushing data does not write the index (aka primary key)
|
||||
dtype = shmarr.dtype
|
||||
if dtype.fields:
|
||||
self._write_fields = list(shmarr.dtype.fields.keys())[1:]
|
||||
else:
|
||||
self._write_fields = None
|
||||
|
||||
# TODO: ringbuf api?
|
||||
|
||||
@property
|
||||
def _token(self) -> _Token:
|
||||
return _Token(
|
||||
shm_name=self._shm.name,
|
||||
shm_first_index_name=self._first._shm.name,
|
||||
shm_last_index_name=self._last._shm.name,
|
||||
dtype_descr=tuple(self._array.dtype.descr),
|
||||
size=self._len,
|
||||
)
|
||||
|
||||
@property
|
||||
def token(self) -> dict:
|
||||
"""Shared memory token that can be serialized and used by
|
||||
another process to attach to this array.
|
||||
"""
|
||||
return self._token.as_msg()
|
||||
|
||||
@property
|
||||
def index(self) -> int:
|
||||
return self._last.value % self._len
|
||||
|
||||
@property
|
||||
def array(self) -> np.ndarray:
|
||||
'''
|
||||
Return an up-to-date ``np.ndarray`` view of the
|
||||
so-far-written data to the underlying shm buffer.
|
||||
|
||||
'''
|
||||
a = self._array[self._first.value:self._last.value]
|
||||
|
||||
# first, last = self._first.value, self._last.value
|
||||
# a = self._array[first:last]
|
||||
|
||||
# TODO: eventually comment this once we've not seen it in the
|
||||
# wild in a long time..
|
||||
# XXX: race where first/last indexes cause a reader
|
||||
# to load an empty array..
|
||||
if len(a) == 0 and self._post_init:
|
||||
raise RuntimeError('Empty array race condition hit!?')
|
||||
|
||||
return a
|
||||
|
||||
def ustruct(
|
||||
self,
|
||||
fields: Optional[list[str]] = None,
|
||||
|
||||
# type that all field values will be cast to
|
||||
# in the returned view.
|
||||
common_dtype: np.dtype = float,
|
||||
|
||||
) -> np.ndarray:
|
||||
|
||||
array = self._array
|
||||
|
||||
if fields:
|
||||
selection = array[fields]
|
||||
# fcount = len(fields)
|
||||
else:
|
||||
selection = array
|
||||
# fcount = len(array.dtype.fields)
|
||||
|
||||
# XXX: manual ``.view()`` attempt that also doesn't work.
|
||||
# uview = selection.view(
|
||||
# dtype='<f16',
|
||||
# ).reshape(-1, 4, order='A')
|
||||
|
||||
# assert len(selection) == len(uview)
|
||||
|
||||
u = rfn.structured_to_unstructured(
|
||||
selection,
|
||||
# dtype=float,
|
||||
copy=True,
|
||||
)
|
||||
|
||||
# unstruct = np.ndarray(u.shape, dtype=a.dtype, buffer=shm.buf)
|
||||
# array[:] = a[:]
|
||||
return u
|
||||
# return ShmArray(
|
||||
# shmarr=u,
|
||||
# first=self._first,
|
||||
# last=self._last,
|
||||
# shm=self._shm
|
||||
# )
|
||||
|
||||
def last(
|
||||
self,
|
||||
length: int = 1,
|
||||
|
||||
) -> np.ndarray:
|
||||
'''
|
||||
Return the last ``length``'s worth of ("row") entries from the
|
||||
array.
|
||||
|
||||
'''
|
||||
return self.array[-length:]
|
||||
|
||||
def push(
|
||||
self,
|
||||
data: np.ndarray,
|
||||
|
||||
field_map: Optional[dict[str, str]] = None,
|
||||
prepend: bool = False,
|
||||
update_first: bool = True,
|
||||
start: int | None = None,
|
||||
|
||||
) -> int:
|
||||
'''
|
||||
Ring buffer like "push" to append data
|
||||
into the buffer and return updated "last" index.
|
||||
|
||||
NB: no actual ring logic yet to give a "loop around" on overflow
|
||||
condition, lel.
|
||||
|
||||
'''
|
||||
length = len(data)
|
||||
|
||||
if prepend:
|
||||
index = (start or self._first.value) - length
|
||||
|
||||
if index < 0:
|
||||
raise ValueError(
|
||||
f'Array size of {self._len} was overrun during prepend.\n'
|
||||
f'You have passed {abs(index)} too many datums.'
|
||||
)
|
||||
|
||||
else:
|
||||
index = start if start is not None else self._last.value
|
||||
|
||||
end = index + length
|
||||
|
||||
if field_map:
|
||||
src_names, dst_names = zip(*field_map.items())
|
||||
else:
|
||||
dst_names = src_names = self._write_fields
|
||||
|
||||
try:
|
||||
self._array[
|
||||
list(dst_names)
|
||||
][index:end] = data[list(src_names)][:]
|
||||
|
||||
# NOTE: there was a race here between updating
|
||||
# the first and last indices and when the next reader
|
||||
# tries to access ``.array`` (which due to the index
|
||||
# overlap will be empty). Pretty sure we've fixed it now
|
||||
# but leaving this here as a reminder.
|
||||
if (
|
||||
prepend
|
||||
and update_first
|
||||
and length
|
||||
):
|
||||
assert index < self._first.value
|
||||
|
||||
if (
|
||||
index < self._first.value
|
||||
and update_first
|
||||
):
|
||||
assert prepend, 'prepend=True not passed but index decreased?'
|
||||
self._first.value = index
|
||||
|
||||
elif not prepend:
|
||||
self._last.value = end
|
||||
|
||||
self._post_init = True
|
||||
return end
|
||||
|
||||
except ValueError as err:
|
||||
if field_map:
|
||||
raise
|
||||
|
||||
# should raise if diff detected
|
||||
self.diff_err_fields(data)
|
||||
raise err
|
||||
|
||||
def diff_err_fields(
|
||||
self,
|
||||
data: np.ndarray,
|
||||
) -> None:
|
||||
# reraise with any field discrepancy
|
||||
our_fields, their_fields = (
|
||||
set(self._array.dtype.fields),
|
||||
set(data.dtype.fields),
|
||||
)
|
||||
|
||||
only_in_ours = our_fields - their_fields
|
||||
only_in_theirs = their_fields - our_fields
|
||||
|
||||
if only_in_ours:
|
||||
raise TypeError(
|
||||
f"Input array is missing field(s): {only_in_ours}"
|
||||
)
|
||||
elif only_in_theirs:
|
||||
raise TypeError(
|
||||
f"Input array has unknown field(s): {only_in_theirs}"
|
||||
)
|
||||
|
||||
# TODO: support "silent" prepends that don't update ._first.value?
|
||||
def prepend(
|
||||
self,
|
||||
data: np.ndarray,
|
||||
) -> int:
|
||||
end = self.push(data, prepend=True)
|
||||
assert end
|
||||
|
||||
def close(self) -> None:
|
||||
self._first._shm.close()
|
||||
self._last._shm.close()
|
||||
self._shm.close()
|
||||
|
||||
def destroy(self) -> None:
|
||||
if _USE_POSIX:
|
||||
# We manually unlink to bypass all the "resource tracker"
|
||||
# nonsense meant for non-SC systems.
|
||||
shm_unlink(self._shm.name)
|
||||
|
||||
self._first.destroy()
|
||||
self._last.destroy()
|
||||
|
||||
def flush(self) -> None:
|
||||
# TODO: flush to storage backend like markestore?
|
||||
...
|
||||
|
||||
|
||||
def open_shm_array(
|
||||
size: int,
|
||||
key: str | None = None,
|
||||
dtype: np.dtype | None = None,
|
||||
append_start_index: int | None = None,
|
||||
readonly: bool = False,
|
||||
|
||||
) -> ShmArray:
|
||||
'''Open a memory shared ``numpy`` using the standard library.
|
||||
|
||||
This call unlinks (aka permanently destroys) the buffer on teardown
|
||||
and thus should be used from the parent-most accessor (process).
|
||||
|
||||
'''
|
||||
# create new shared mem segment for which we
|
||||
# have write permission
|
||||
a = np.zeros(size, dtype=dtype)
|
||||
a['index'] = np.arange(len(a))
|
||||
|
||||
shm = SharedMemory(
|
||||
name=key,
|
||||
create=True,
|
||||
size=a.nbytes
|
||||
)
|
||||
array = np.ndarray(
|
||||
a.shape,
|
||||
dtype=a.dtype,
|
||||
buffer=shm.buf
|
||||
)
|
||||
array[:] = a[:]
|
||||
array.setflags(write=int(not readonly))
|
||||
|
||||
token = _make_token(
|
||||
key=key,
|
||||
size=size,
|
||||
dtype=dtype,
|
||||
)
|
||||
|
||||
# create single entry arrays for storing an first and last indices
|
||||
first = SharedInt(
|
||||
shm=SharedMemory(
|
||||
name=token.shm_first_index_name,
|
||||
create=True,
|
||||
size=4, # std int
|
||||
)
|
||||
)
|
||||
|
||||
last = SharedInt(
|
||||
shm=SharedMemory(
|
||||
name=token.shm_last_index_name,
|
||||
create=True,
|
||||
size=4, # std int
|
||||
)
|
||||
)
|
||||
|
||||
# start the "real-time" updated section after 3-days worth of 1s
|
||||
# sampled OHLC. this allows appending up to a days worth from
|
||||
# tick/quote feeds before having to flush to a (tsdb) storage
|
||||
# backend, and looks something like,
|
||||
# -------------------------
|
||||
# | | i
|
||||
# _________________________
|
||||
# <-------------> <------->
|
||||
# history real-time
|
||||
#
|
||||
# Once fully "prepended", the history section will leave the
|
||||
# ``ShmArray._start.value: int = 0`` and the yet-to-be written
|
||||
# real-time section will start at ``ShmArray.index: int``.
|
||||
|
||||
# this sets the index to nearly 2/3rds into the the length of
|
||||
# the buffer leaving at least a "days worth of second samples"
|
||||
# for the real-time section.
|
||||
if append_start_index is None:
|
||||
append_start_index = round(size * 0.616)
|
||||
|
||||
last.value = first.value = append_start_index
|
||||
|
||||
shmarr = ShmArray(
|
||||
array,
|
||||
first,
|
||||
last,
|
||||
shm,
|
||||
)
|
||||
|
||||
assert shmarr._token == token
|
||||
_known_tokens[key] = shmarr.token
|
||||
|
||||
# "unlink" created shm on process teardown by
|
||||
# pushing teardown calls onto actor context stack
|
||||
stack = tractor.current_actor(
|
||||
err_on_no_runtime=False,
|
||||
).lifetime_stack
|
||||
if stack:
|
||||
stack.callback(shmarr.close)
|
||||
stack.callback(shmarr.destroy)
|
||||
|
||||
return shmarr
|
||||
|
||||
|
||||
def attach_shm_array(
|
||||
token: tuple[str, str, tuple[str, str]],
|
||||
readonly: bool = True,
|
||||
|
||||
) -> ShmArray:
|
||||
'''
|
||||
Attach to an existing shared memory array previously
|
||||
created by another process using ``open_shared_array``.
|
||||
|
||||
No new shared mem is allocated but wrapper types for read/write
|
||||
access are constructed.
|
||||
|
||||
'''
|
||||
token = _Token.from_msg(token)
|
||||
key = token.shm_name
|
||||
|
||||
if key in _known_tokens:
|
||||
assert _Token.from_msg(_known_tokens[key]) == token, "WTF"
|
||||
|
||||
# XXX: ugh, looks like due to the ``shm_open()`` C api we can't
|
||||
# actually place files in a subdir, see discussion here:
|
||||
# https://stackoverflow.com/a/11103289
|
||||
|
||||
# attach to array buffer and view as per dtype
|
||||
_err: Optional[Exception] = None
|
||||
for _ in range(3):
|
||||
try:
|
||||
shm = SharedMemory(
|
||||
name=key,
|
||||
create=False,
|
||||
)
|
||||
break
|
||||
except OSError as oserr:
|
||||
_err = oserr
|
||||
time.sleep(0.1)
|
||||
else:
|
||||
if _err:
|
||||
raise _err
|
||||
|
||||
shmarr = np.ndarray(
|
||||
(token.size,),
|
||||
dtype=token.dtype,
|
||||
buffer=shm.buf
|
||||
)
|
||||
shmarr.setflags(write=int(not readonly))
|
||||
|
||||
first = SharedInt(
|
||||
shm=SharedMemory(
|
||||
name=token.shm_first_index_name,
|
||||
create=False,
|
||||
size=4, # std int
|
||||
),
|
||||
)
|
||||
last = SharedInt(
|
||||
shm=SharedMemory(
|
||||
name=token.shm_last_index_name,
|
||||
create=False,
|
||||
size=4, # std int
|
||||
),
|
||||
)
|
||||
|
||||
# make sure we can read
|
||||
first.value
|
||||
|
||||
sha = ShmArray(
|
||||
shmarr,
|
||||
first,
|
||||
last,
|
||||
shm,
|
||||
)
|
||||
# read test
|
||||
sha.array
|
||||
|
||||
# Stash key -> token knowledge for future queries
|
||||
# via `maybe_opepn_shm_array()` but only after we know
|
||||
# we can attach.
|
||||
if key not in _known_tokens:
|
||||
_known_tokens[key] = token
|
||||
|
||||
# "close" attached shm on actor teardown
|
||||
if (actor := tractor.current_actor(
|
||||
err_on_no_runtime=False,
|
||||
)):
|
||||
actor.lifetime_stack.callback(sha.close)
|
||||
|
||||
return sha
|
||||
|
||||
|
||||
def maybe_open_shm_array(
|
||||
key: str,
|
||||
|
|
@ -70,37 +625,37 @@ def maybe_open_shm_array(
|
|||
append_start_index: int | None = None,
|
||||
readonly: bool = False,
|
||||
**kwargs,
|
||||
|
||||
) -> tuple[ShmArray, bool]:
|
||||
'''
|
||||
Attempt to attach to a shared memory block
|
||||
using a "key" lookup to registered blocks in
|
||||
the user's overall "system" registry (presumes
|
||||
you don't have the block's explicit token).
|
||||
Attempt to attach to a shared memory block using a "key" lookup
|
||||
to registered blocks in the users overall "system" registry
|
||||
(presumes you don't have the block's explicit token).
|
||||
|
||||
This is a thin wrapper around tractor's
|
||||
``maybe_open_shm_ndarray()`` preserving piker's
|
||||
historical defaults (``readonly=False``,
|
||||
``append_start_index=None``).
|
||||
This function is meant to solve the problem of discovering whether
|
||||
a shared array token has been allocated or discovered by the actor
|
||||
running in **this** process. Systems where multiple actors may seek
|
||||
to access a common block can use this function to attempt to acquire
|
||||
a token as discovered by the actors who have previously stored
|
||||
a "key" -> ``_Token`` map in an actor local (aka python global)
|
||||
variable.
|
||||
|
||||
If you know the explicit ``NDToken`` for your
|
||||
memory segment instead use
|
||||
``tractor.ipc._shm.attach_shm_ndarray()``.
|
||||
If you know the explicit ``_Token`` for your memory segment instead
|
||||
use ``attach_shm_array``.
|
||||
|
||||
'''
|
||||
try:
|
||||
# see if we already know this key
|
||||
token = _known_tokens[key]
|
||||
return (
|
||||
attach_shm_ndarray(
|
||||
attach_shm_array(
|
||||
token=token,
|
||||
readonly=readonly,
|
||||
),
|
||||
False,
|
||||
)
|
||||
except KeyError:
|
||||
log.debug(
|
||||
f'Could not find {key} in shms cache'
|
||||
)
|
||||
log.debug(f"Could not find {key} in shms cache")
|
||||
if dtype:
|
||||
token = _make_token(
|
||||
key,
|
||||
|
|
@ -108,18 +663,9 @@ def maybe_open_shm_array(
|
|||
dtype=dtype,
|
||||
)
|
||||
try:
|
||||
return (
|
||||
attach_shm_ndarray(
|
||||
token=token,
|
||||
**kwargs,
|
||||
),
|
||||
False,
|
||||
)
|
||||
return attach_shm_array(token=token, **kwargs), False
|
||||
except FileNotFoundError:
|
||||
log.debug(
|
||||
f'Could not attach to shm'
|
||||
f' with token {token}'
|
||||
)
|
||||
log.debug(f"Could not attach to shm with token {token}")
|
||||
|
||||
# This actor does not know about memory
|
||||
# associated with the provided "key".
|
||||
|
|
@ -127,7 +673,7 @@ def maybe_open_shm_array(
|
|||
# to fail if a block has been allocated
|
||||
# on the OS by someone else.
|
||||
return (
|
||||
open_shm_ndarray(
|
||||
open_shm_array(
|
||||
key=key,
|
||||
size=size,
|
||||
dtype=dtype,
|
||||
|
|
@ -137,20 +683,18 @@ def maybe_open_shm_array(
|
|||
True,
|
||||
)
|
||||
|
||||
|
||||
def try_read(
|
||||
array: np.ndarray,
|
||||
) -> np.ndarray|None:
|
||||
'''
|
||||
Try to read the last row from a shared mem
|
||||
array or ``None`` if the array read returns
|
||||
a zero-length array result.
|
||||
array: np.ndarray
|
||||
|
||||
Can be used to check for backfilling race
|
||||
conditions where an array is currently being
|
||||
(re-)written by a writer actor but the reader
|
||||
is unaware and reads during the window where
|
||||
the first and last indexes are being updated.
|
||||
) -> Optional[np.ndarray]:
|
||||
'''
|
||||
Try to read the last row from a shared mem array or ``None``
|
||||
if the array read returns a zero-length array result.
|
||||
|
||||
Can be used to check for backfilling race conditions where an array
|
||||
is currently being (re-)written by a writer actor but the reader is
|
||||
unaware and reads during the window where the first and last indexes
|
||||
are being updated.
|
||||
|
||||
'''
|
||||
try:
|
||||
|
|
@ -158,13 +702,14 @@ def try_read(
|
|||
except IndexError:
|
||||
# XXX: race condition with backfilling shm.
|
||||
#
|
||||
# the underlying issue is that a backfill
|
||||
# (aka prepend) and subsequent shm array
|
||||
# first/last index update could result in an
|
||||
# empty array read here since the indices may
|
||||
# be updated in such a way that a read delivers
|
||||
# an empty array (though it seems like we
|
||||
# *should* be able to prevent that?).
|
||||
# the underlying issue is that a backfill (aka prepend) and subsequent
|
||||
# shm array first/last index update could result in an empty array
|
||||
# read here since the indices may be updated in such a way that
|
||||
# a read delivers an empty array (though it seems like we
|
||||
# *should* be able to prevent that?). also, as and alt and
|
||||
# something we need anyway, maybe there should be some kind of
|
||||
# signal that a prepend is taking place and this consumer can
|
||||
# respond (eg. redrawing graphics) accordingly.
|
||||
|
||||
# the array read was empty
|
||||
# the array read was emtpy
|
||||
return None
|
||||
|
|
|
|||
|
|
@ -973,9 +973,6 @@ async def open_feed(
|
|||
# assert flume.mkt.fqme == fqme
|
||||
feed.flumes[fqme] = flume
|
||||
|
||||
# TODO: do we need this?
|
||||
flume.feed = feed
|
||||
|
||||
# attach and cache shm handles
|
||||
rt_shm = flume.rt_shm
|
||||
assert rt_shm
|
||||
|
|
|
|||
|
|
@ -22,25 +22,19 @@ real-time data processing data-structures.
|
|||
|
||||
"""
|
||||
from __future__ import annotations
|
||||
from typing import (
|
||||
TYPE_CHECKING,
|
||||
)
|
||||
|
||||
import tractor
|
||||
import pendulum
|
||||
import numpy as np
|
||||
|
||||
from piker.types import Struct
|
||||
from tractor.ipc._shm import (
|
||||
from ._sharedmem import (
|
||||
attach_shm_array,
|
||||
ShmArray,
|
||||
NDToken,
|
||||
attach_shm_ndarray,
|
||||
_Token,
|
||||
)
|
||||
from piker.accounting import MktPair
|
||||
|
||||
if TYPE_CHECKING:
|
||||
from piker.data.feed import Feed
|
||||
|
||||
|
||||
class Flume(Struct):
|
||||
'''
|
||||
|
|
@ -64,11 +58,11 @@ class Flume(Struct):
|
|||
'''
|
||||
mkt: MktPair
|
||||
first_quote: dict
|
||||
_rt_shm_token: NDToken
|
||||
_rt_shm_token: _Token
|
||||
|
||||
# optional since some data flows won't have a "downsampled" history
|
||||
# buffer/stream (eg. FSPs).
|
||||
_hist_shm_token: NDToken|None = None
|
||||
_hist_shm_token: _Token | None = None
|
||||
|
||||
# private shm refs loaded dynamically from tokens
|
||||
_hist_shm: ShmArray | None = None
|
||||
|
|
@ -80,15 +74,11 @@ class Flume(Struct):
|
|||
izero_rt: int = 0
|
||||
throttle_rate: int | None = None
|
||||
|
||||
# TODO: do we need this really if we can pull the `Portal` from
|
||||
# ``tractor``'s internals?
|
||||
feed: Feed|None = None
|
||||
|
||||
@property
|
||||
def rt_shm(self) -> ShmArray:
|
||||
|
||||
if self._rt_shm is None:
|
||||
self._rt_shm = attach_shm_ndarray(
|
||||
self._rt_shm = attach_shm_array(
|
||||
token=self._rt_shm_token,
|
||||
readonly=self._readonly,
|
||||
)
|
||||
|
|
@ -104,7 +94,7 @@ class Flume(Struct):
|
|||
)
|
||||
|
||||
if self._hist_shm is None:
|
||||
self._hist_shm = attach_shm_ndarray(
|
||||
self._hist_shm = attach_shm_array(
|
||||
token=self._hist_shm_token,
|
||||
readonly=self._readonly,
|
||||
)
|
||||
|
|
@ -156,7 +146,6 @@ class Flume(Struct):
|
|||
# will get instead some kind of msg-compat version
|
||||
# that it can load.
|
||||
msg.pop('stream')
|
||||
msg.pop('feed')
|
||||
msg.pop('_rt_shm')
|
||||
msg.pop('_hist_shm')
|
||||
|
||||
|
|
|
|||
|
|
@ -37,12 +37,12 @@ import numpy as np
|
|||
import tractor
|
||||
from tractor.msg import NamespacePath
|
||||
|
||||
from tractor.ipc._shm import (
|
||||
from ..data._sharedmem import (
|
||||
ShmArray,
|
||||
NDToken,
|
||||
attach_shm_ndarray,
|
||||
maybe_open_shm_array,
|
||||
attach_shm_array,
|
||||
_Token,
|
||||
)
|
||||
from ..data._sharedmem import maybe_open_shm_array
|
||||
from ..log import get_logger
|
||||
|
||||
log = get_logger(__name__)
|
||||
|
|
@ -78,8 +78,8 @@ class Fsp:
|
|||
# + the consuming fsp *to* the consumers output
|
||||
# shm flow.
|
||||
_flow_registry: dict[
|
||||
tuple[NDToken, str],
|
||||
tuple[NDToken, Optional[ShmArray]],
|
||||
tuple[_Token, str],
|
||||
tuple[_Token, Optional[ShmArray]],
|
||||
] = {}
|
||||
|
||||
def __init__(
|
||||
|
|
@ -148,7 +148,7 @@ class Fsp:
|
|||
# times as possible as per:
|
||||
# - https://github.com/pikers/piker/issues/359
|
||||
# - https://github.com/pikers/piker/issues/332
|
||||
maybe_array := attach_shm_ndarray(dst_token)
|
||||
maybe_array := attach_shm_array(dst_token)
|
||||
)
|
||||
|
||||
return maybe_array
|
||||
|
|
@ -200,13 +200,9 @@ def maybe_mk_fsp_shm(
|
|||
)
|
||||
|
||||
# (attempt to) uniquely key the fsp shm buffers
|
||||
# Use hash for macOS compatibility (31 char limit)
|
||||
import hashlib
|
||||
actor_name, uuid = tractor.current_actor().uid
|
||||
# Create short hash of sym and target name
|
||||
content = f'{sym}.{target.name}'
|
||||
content_hash = hashlib.md5(content.encode()).hexdigest()[:8]
|
||||
key: str = f'{uuid[:8]}_{content_hash}.fsp'
|
||||
uuid_snip: str = uuid[:16]
|
||||
key: str = f'piker.{actor_name}[{uuid_snip}].{sym}.{target.name}'
|
||||
|
||||
shm, opened = maybe_open_shm_array(
|
||||
key,
|
||||
|
|
|
|||
|
|
@ -40,7 +40,7 @@ from ..log import (
|
|||
)
|
||||
from .. import data
|
||||
from ..data.flows import Flume
|
||||
from tractor.ipc._shm import ShmArray
|
||||
from ..data._sharedmem import ShmArray
|
||||
from ..data._sampling import (
|
||||
_default_delay_s,
|
||||
open_sample_stream,
|
||||
|
|
@ -49,7 +49,7 @@ from ..accounting import MktPair
|
|||
from ._api import (
|
||||
Fsp,
|
||||
_load_builtins,
|
||||
NDToken,
|
||||
_Token,
|
||||
)
|
||||
from ..toolz import Profiler
|
||||
|
||||
|
|
@ -414,7 +414,7 @@ async def cascade(
|
|||
dst_flume_addr: dict,
|
||||
ns_path: NamespacePath,
|
||||
|
||||
shm_registry: dict[str, NDToken],
|
||||
shm_registry: dict[str, _Token],
|
||||
|
||||
zero_on_step: bool = False,
|
||||
loglevel: str|None = None,
|
||||
|
|
@ -465,9 +465,9 @@ async def cascade(
|
|||
# not sure how else to do it.
|
||||
for (token, fsp_name, dst_token) in shm_registry:
|
||||
Fsp._flow_registry[(
|
||||
NDToken.from_msg(token),
|
||||
_Token.from_msg(token),
|
||||
fsp_name,
|
||||
)] = NDToken.from_msg(dst_token), None
|
||||
)] = _Token.from_msg(dst_token), None
|
||||
|
||||
fsp: Fsp = reg.get(
|
||||
NamespacePath(ns_path)
|
||||
|
|
|
|||
|
|
@ -25,7 +25,7 @@ from numba import jit, float64, optional, int64
|
|||
|
||||
from ._api import fsp
|
||||
from ..data import iterticks
|
||||
from tractor.ipc._shm import ShmArray
|
||||
from ..data._sharedmem import ShmArray
|
||||
|
||||
|
||||
@jit(
|
||||
|
|
|
|||
|
|
@ -21,7 +21,7 @@ from tractor.trionics._broadcast import AsyncReceiver
|
|||
|
||||
from ._api import fsp
|
||||
from ..data import iterticks
|
||||
from tractor.ipc._shm import ShmArray
|
||||
from ..data._sharedmem import ShmArray
|
||||
from ._momo import _wma
|
||||
from ..log import get_logger
|
||||
|
||||
|
|
|
|||
|
|
@ -37,7 +37,9 @@ import typer
|
|||
|
||||
from piker.service import open_piker_runtime
|
||||
from piker.cli import cli
|
||||
from tractor.ipc._shm import ShmArray
|
||||
from piker.data import (
|
||||
ShmArray,
|
||||
)
|
||||
from piker import tsp
|
||||
from . import log
|
||||
from . import (
|
||||
|
|
@ -292,6 +294,11 @@ def ldshm(
|
|||
f'Something is wrong with time period for {shm}:\n{times}'
|
||||
)
|
||||
period_s: float = float(max(d1, d2, med))
|
||||
log.info(
|
||||
f'Processing shm buffer:\n'
|
||||
f' file: {shmfile.name}\n'
|
||||
f' period: {period_s}s\n'
|
||||
)
|
||||
|
||||
null_segs: tuple = tsp.get_null_segs(
|
||||
frame=shm.array,
|
||||
|
|
|
|||
|
|
@ -64,8 +64,10 @@ from pendulum import (
|
|||
|
||||
from piker import config
|
||||
from piker import tsp
|
||||
from tractor.ipc._shm import ShmArray
|
||||
from piker.data import def_iohlcv_fields
|
||||
from piker.data import (
|
||||
def_iohlcv_fields,
|
||||
ShmArray,
|
||||
)
|
||||
from piker.log import get_logger
|
||||
from . import TimeseriesNotFound
|
||||
|
||||
|
|
|
|||
|
|
@ -276,14 +276,41 @@ def get_null_segs(
|
|||
absi_zdiff: np.ndarray = np.diff(absi_zeros)
|
||||
|
||||
if zero_t.size < 2:
|
||||
try:
|
||||
breakpoint()
|
||||
except RuntimeError:
|
||||
# XXX, if greenback not active from
|
||||
# piker store ldshm cmd..
|
||||
log.exception(
|
||||
"Can't debug single-sample null!\n"
|
||||
idx: int = zero_t['index'][0]
|
||||
idx_before: int = idx - 1
|
||||
idx_after: int = idx + 1
|
||||
index = frame['index']
|
||||
before_cond = idx_before <= index
|
||||
after_cond = index <= idx_after
|
||||
bars: np.ndarray = frame[
|
||||
before_cond
|
||||
&
|
||||
after_cond
|
||||
]
|
||||
time: np.ndarray = bars['time']
|
||||
from pendulum import (
|
||||
from_timestamp,
|
||||
Interval,
|
||||
)
|
||||
gap: Interval = (
|
||||
from_timestamp(time[-1])
|
||||
-
|
||||
from_timestamp(time[0])
|
||||
)
|
||||
log.warning(
|
||||
f'Single OHLCV-bar null-segment detected??\n'
|
||||
f'gap -> {gap}\n'
|
||||
)
|
||||
|
||||
# ^^XXX, if you want to debug the above bar-gap^^
|
||||
# try:
|
||||
# breakpoint()
|
||||
# except RuntimeError:
|
||||
# # XXX, if greenback not active from
|
||||
# # piker store ldshm cmd..
|
||||
# log.exception(
|
||||
# "Can't debug single-sample null!\n"
|
||||
# )
|
||||
|
||||
return None
|
||||
|
||||
|
|
|
|||
|
|
@ -30,6 +30,11 @@ import tractor
|
|||
|
||||
from piker.data._formatters import BGM
|
||||
from piker.storage import log
|
||||
from piker.toolz.profile import (
|
||||
Profiler,
|
||||
pg_profile_enabled,
|
||||
ms_slower_then,
|
||||
)
|
||||
from piker.ui._style import get_fonts
|
||||
|
||||
if TYPE_CHECKING:
|
||||
|
|
@ -92,12 +97,22 @@ async def markup_gaps(
|
|||
# gap's duration.
|
||||
show_txt: bool = False,
|
||||
|
||||
# A/B comparison: render individual arrows alongside batch
|
||||
# for visual comparison
|
||||
show_individual_arrows: bool = False,
|
||||
|
||||
) -> dict[int, dict]:
|
||||
'''
|
||||
Remote annotate time-gaps in a dt-fielded ts (normally OHLC)
|
||||
with rectangles.
|
||||
|
||||
'''
|
||||
profiler = Profiler(
|
||||
msg=f'markup_gaps() for {gaps.height} gaps',
|
||||
disabled=False,
|
||||
ms_threshold=0.0,
|
||||
)
|
||||
|
||||
# XXX: force chart redraw FIRST to ensure PlotItem coordinate
|
||||
# system is properly initialized before we position annotations!
|
||||
# Without this, annotations may be misaligned on first creation
|
||||
|
|
@ -106,6 +121,19 @@ async def markup_gaps(
|
|||
fqme=fqme,
|
||||
timeframe=timeframe,
|
||||
)
|
||||
profiler('first `.redraw()` before annot creation')
|
||||
|
||||
log.info(
|
||||
f'markup_gaps() called:\n'
|
||||
f' fqme: {fqme}\n'
|
||||
f' timeframe: {timeframe}s\n'
|
||||
f' gaps.height: {gaps.height}\n'
|
||||
)
|
||||
|
||||
# collect all annotation specs for batch submission
|
||||
rect_specs: list[dict] = []
|
||||
arrow_specs: list[dict] = []
|
||||
text_specs: list[dict] = []
|
||||
|
||||
aids: dict[int] = {}
|
||||
for i in range(gaps.height):
|
||||
|
|
@ -217,56 +245,38 @@ async def markup_gaps(
|
|||
# 1: 'wine', # down-gap
|
||||
# }[sgn]
|
||||
|
||||
rect_kwargs: dict[str, Any] = dict(
|
||||
fqme=fqme,
|
||||
timeframe=timeframe,
|
||||
# collect rect spec (no fqme/timeframe, added by batch
|
||||
# API)
|
||||
rect_spec: dict[str, Any] = dict(
|
||||
meth='set_view_pos',
|
||||
start_pos=lc,
|
||||
end_pos=ro,
|
||||
color=color,
|
||||
update_label=False,
|
||||
start_time=start_time,
|
||||
end_time=end_time,
|
||||
)
|
||||
rect_specs.append(rect_spec)
|
||||
|
||||
# add up/down rects
|
||||
aid: int|None = await actl.add_rect(**rect_kwargs)
|
||||
if aid is None:
|
||||
log.error(
|
||||
f'Failed to add rect for,\n'
|
||||
f'{rect_kwargs!r}\n'
|
||||
f'\n'
|
||||
f'Skipping to next gap!\n'
|
||||
)
|
||||
continue
|
||||
|
||||
assert aid
|
||||
aids[aid] = rect_kwargs
|
||||
direction: str = (
|
||||
'down' if down_gap
|
||||
else 'up'
|
||||
)
|
||||
# TODO! mk this a `msgspec.Struct` which we deserialize
|
||||
# on the server side!
|
||||
# XXX: send timestamp for server-side index lookup
|
||||
# to ensure alignment with current shm state
|
||||
|
||||
# collect arrow spec
|
||||
gap_time: float = row['time'][0]
|
||||
arrow_kwargs: dict[str, Any] = dict(
|
||||
fqme=fqme,
|
||||
timeframe=timeframe,
|
||||
arrow_spec: dict[str, Any] = dict(
|
||||
x=iend, # fallback if timestamp lookup fails
|
||||
y=cls,
|
||||
time=gap_time, # for server-side index lookup
|
||||
color=color,
|
||||
alpha=169,
|
||||
pointing=direction,
|
||||
# TODO: expose these as params to markup_gaps()?
|
||||
headLen=10,
|
||||
headWidth=2.222,
|
||||
pxMode=True,
|
||||
)
|
||||
|
||||
aid: int = await actl.add_arrow(
|
||||
**arrow_kwargs
|
||||
)
|
||||
arrow_specs.append(arrow_spec)
|
||||
|
||||
# add duration label to RHS of arrow
|
||||
if up_gap:
|
||||
|
|
@ -278,15 +288,12 @@ async def markup_gaps(
|
|||
assert flat
|
||||
anchor = (0, 0) # up from bottom
|
||||
|
||||
# use a slightly smaller font for gap label txt.
|
||||
# collect text spec if enabled
|
||||
if show_txt:
|
||||
font, small_font = get_fonts()
|
||||
font_size: int = small_font.px_size - 1
|
||||
assert isinstance(font_size, int)
|
||||
|
||||
if show_txt:
|
||||
text_aid: int = await actl.add_text(
|
||||
fqme=fqme,
|
||||
timeframe=timeframe,
|
||||
text_spec: dict[str, Any] = dict(
|
||||
text=gap_label,
|
||||
x=iend + 1, # fallback if timestamp lookup fails
|
||||
y=cls,
|
||||
|
|
@ -295,12 +302,46 @@ async def markup_gaps(
|
|||
anchor=anchor,
|
||||
font_size=font_size,
|
||||
)
|
||||
aids[text_aid] = {'text': gap_label}
|
||||
text_specs.append(text_spec)
|
||||
|
||||
# tell chart to redraw all its
|
||||
# graphics view layers Bo
|
||||
# submit all annotations in single batch IPC msg
|
||||
log.info(
|
||||
f'Submitting batch annotations:\n'
|
||||
f' rects: {len(rect_specs)}\n'
|
||||
f' arrows: {len(arrow_specs)}\n'
|
||||
f' texts: {len(text_specs)}\n'
|
||||
)
|
||||
profiler('built all annotation specs')
|
||||
|
||||
result: dict[str, list[int]] = await actl.add_batch(
|
||||
fqme=fqme,
|
||||
timeframe=timeframe,
|
||||
rects=rect_specs,
|
||||
arrows=arrow_specs,
|
||||
texts=text_specs,
|
||||
show_individual_arrows=show_individual_arrows,
|
||||
)
|
||||
profiler('batch `.add_batch()` IPC call complete')
|
||||
|
||||
# build aids dict from batch results
|
||||
for aid in result['rects']:
|
||||
aids[aid] = {'type': 'rect'}
|
||||
for aid in result['arrows']:
|
||||
aids[aid] = {'type': 'arrow'}
|
||||
for aid in result['texts']:
|
||||
aids[aid] = {'type': 'text'}
|
||||
|
||||
log.info(
|
||||
f'Batch submission complete: {len(aids)} annotation(s) '
|
||||
f'created'
|
||||
)
|
||||
profiler('built aids result dict')
|
||||
|
||||
# tell chart to redraw all its graphics view layers
|
||||
await actl.redraw(
|
||||
fqme=fqme,
|
||||
timeframe=timeframe,
|
||||
)
|
||||
profiler('final `.redraw()` after annot creation')
|
||||
|
||||
return aids
|
||||
|
|
|
|||
|
|
@ -32,7 +32,6 @@ from __future__ import annotations
|
|||
from datetime import datetime
|
||||
from functools import partial
|
||||
from pathlib import Path
|
||||
import platform
|
||||
from pprint import pformat
|
||||
from types import ModuleType
|
||||
from typing import (
|
||||
|
|
@ -63,8 +62,10 @@ from piker.log import (
|
|||
get_logger,
|
||||
get_console_log,
|
||||
)
|
||||
from tractor.ipc._shm import ShmArray
|
||||
from ..data._sharedmem import maybe_open_shm_array
|
||||
from ..data._sharedmem import (
|
||||
maybe_open_shm_array,
|
||||
ShmArray,
|
||||
)
|
||||
from piker.data._source import (
|
||||
def_iohlcv_fields,
|
||||
)
|
||||
|
|
@ -738,12 +739,21 @@ async def start_backfill(
|
|||
# including the dst[/src] source asset token. SO,
|
||||
# 'tsla.nasdaq.ib' over 'tsla/usd.nasdaq.ib' for
|
||||
# historical reasons ONLY.
|
||||
if mkt.dst.atype not in {
|
||||
if (
|
||||
mkt.dst.atype not in {
|
||||
'crypto',
|
||||
'crypto_currency',
|
||||
'fiat', # a "forex pair"
|
||||
'perpetual_future', # stupid "perps" from cex land
|
||||
}:
|
||||
}
|
||||
and not (
|
||||
mkt.src.atype == 'crypto_currency'
|
||||
and
|
||||
mkt.dst.atype in {
|
||||
'future',
|
||||
}
|
||||
)
|
||||
):
|
||||
col_sym_key: str = mkt.get_fqme(
|
||||
delim_char='',
|
||||
without_src=True,
|
||||
|
|
@ -1403,20 +1413,13 @@ async def manage_history(
|
|||
service: str = name.rstrip(f'.{mod.name}')
|
||||
fqme: str = mkt.get_fqme(delim_char='')
|
||||
|
||||
key: str = f'piker.{service}[{uuid[:16]}].{fqme}'
|
||||
# use a short hash of the `fqme` to deal with macOS
|
||||
# file-name-len limit..
|
||||
if platform.system() == 'Darwin':
|
||||
import hashlib
|
||||
fqme_hash: str = hashlib.md5(fqme.encode()).hexdigest()[:8]
|
||||
key: str = f'{uuid[:8]}_{fqme_hash}'
|
||||
|
||||
# (maybe) allocate shm array for this broker/symbol which will
|
||||
# be used for fast near-term history capture and processing.
|
||||
hist_shm, opened = maybe_open_shm_array(
|
||||
size=_default_hist_size,
|
||||
append_start_index=_hist_buffer_start,
|
||||
key=f'{key}.hist',
|
||||
|
||||
key=f'piker.{service}[{uuid[:16]}].{fqme}.hist',
|
||||
|
||||
# use any broker defined ohlc dtype:
|
||||
dtype=getattr(mod, '_ohlc_dtype', def_iohlcv_fields),
|
||||
|
|
@ -1435,7 +1438,7 @@ async def manage_history(
|
|||
rt_shm, opened = maybe_open_shm_array(
|
||||
size=_default_rt_size,
|
||||
append_start_index=_rt_buffer_start,
|
||||
key=f'{key}.rt',
|
||||
key=f'piker.{service}[{uuid[:16]}].{fqme}.rt',
|
||||
|
||||
# use any broker defined ohlc dtype:
|
||||
dtype=getattr(mod, '_ohlc_dtype', def_iohlcv_fields),
|
||||
|
|
|
|||
|
|
@ -24,8 +24,11 @@ from pyqtgraph import (
|
|||
Point,
|
||||
functions as fn,
|
||||
Color,
|
||||
GraphicsObject,
|
||||
)
|
||||
from pyqtgraph.Qt import internals
|
||||
import numpy as np
|
||||
import pyqtgraph as pg
|
||||
|
||||
from piker.ui.qt import (
|
||||
QtCore,
|
||||
|
|
@ -35,6 +38,10 @@ from piker.ui.qt import (
|
|||
QRectF,
|
||||
QGraphicsPathItem,
|
||||
)
|
||||
from piker.ui._style import hcolor
|
||||
from piker.log import get_logger
|
||||
|
||||
log = get_logger(__name__)
|
||||
|
||||
|
||||
def mk_marker_path(
|
||||
|
|
@ -104,7 +111,7 @@ def mk_marker_path(
|
|||
|
||||
class LevelMarker(QGraphicsPathItem):
|
||||
'''
|
||||
An arrow marker path graphich which redraws itself
|
||||
An arrow marker path graphic which redraws itself
|
||||
to the specified view coordinate level on each paint cycle.
|
||||
|
||||
'''
|
||||
|
|
@ -251,9 +258,9 @@ def qgo_draw_markers(
|
|||
|
||||
) -> float:
|
||||
'''
|
||||
Paint markers in ``pg.GraphicsItem`` style by first
|
||||
removing the view transform for the painter, drawing the markers
|
||||
in scene coords, then restoring the view coords.
|
||||
Paint markers in ``pg.GraphicsItem`` style by first removing the
|
||||
view transform for the painter, drawing the markers in scene
|
||||
coords, then restoring the view coords.
|
||||
|
||||
'''
|
||||
# paint markers in native coordinate system
|
||||
|
|
@ -295,3 +302,449 @@ def qgo_draw_markers(
|
|||
|
||||
p.setTransform(orig_tr)
|
||||
return max(sizes)
|
||||
|
||||
|
||||
class GapAnnotations(GraphicsObject):
|
||||
'''
|
||||
Batch-rendered gap annotations using Qt's efficient drawing
|
||||
APIs.
|
||||
|
||||
Instead of creating individual `QGraphicsItem` instances per
|
||||
gap (which is very slow for 1000+ gaps), this class stores all
|
||||
gap rectangles and arrows in numpy-backed arrays and renders
|
||||
them in single batch paint calls.
|
||||
|
||||
Performance: ~1000x faster than individual items for large gap
|
||||
counts.
|
||||
|
||||
Based on patterns from:
|
||||
- `pyqtgraph.BarGraphItem` (batch rect rendering)
|
||||
- `pyqtgraph.ScatterPlotItem` (fragment rendering)
|
||||
- `piker.ui._curve.FlowGraphic` (single path pattern)
|
||||
|
||||
'''
|
||||
def __init__(
|
||||
self,
|
||||
gap_specs: list[dict],
|
||||
array: np.ndarray|None = None,
|
||||
color: str = 'dad_blue',
|
||||
alpha: int = 169,
|
||||
arrow_size: float = 10.0,
|
||||
fqme: str|None = None,
|
||||
timeframe: float|None = None,
|
||||
) -> None:
|
||||
'''
|
||||
gap_specs: list of dicts with keys:
|
||||
- start_pos: (x, y) tuple for left corner of rect
|
||||
- end_pos: (x, y) tuple for right corner of rect
|
||||
- arrow_x: x position for arrow
|
||||
- arrow_y: y position for arrow
|
||||
- pointing: 'up' or 'down' for arrow direction
|
||||
- start_time: (optional) timestamp for repositioning
|
||||
- end_time: (optional) timestamp for repositioning
|
||||
|
||||
array: optional OHLC numpy array for repositioning on
|
||||
backfill updates (when abs-index changes)
|
||||
|
||||
fqme: symbol name for these gaps (for logging/debugging)
|
||||
|
||||
timeframe: period in seconds that these gaps were
|
||||
detected on (used to skip reposition when
|
||||
called with wrong timeframe's array)
|
||||
|
||||
'''
|
||||
super().__init__()
|
||||
self._gap_specs = gap_specs
|
||||
self._array = array
|
||||
self._fqme = fqme
|
||||
self._timeframe = timeframe
|
||||
n_gaps = len(gap_specs)
|
||||
|
||||
# shared pen/brush matching original SelectRect/ArrowItem style
|
||||
base_color = pg.mkColor(hcolor(color))
|
||||
|
||||
# rect pen: base color, fully opaque for outline
|
||||
self._rect_pen = pg.mkPen(base_color, width=1)
|
||||
|
||||
# rect brush: base color with alpha=66 (SelectRect default)
|
||||
rect_fill = pg.mkColor(hcolor(color))
|
||||
rect_fill.setAlpha(66)
|
||||
self._rect_brush = pg.functions.mkBrush(rect_fill)
|
||||
|
||||
# arrow pen: same as rects
|
||||
self._arrow_pen = pg.mkPen(base_color, width=1)
|
||||
|
||||
# arrow brush: base color with user-specified alpha (default 169)
|
||||
arrow_fill = pg.mkColor(hcolor(color))
|
||||
arrow_fill.setAlpha(alpha)
|
||||
self._arrow_brush = pg.functions.mkBrush(arrow_fill)
|
||||
|
||||
# allocate rect array using Qt's efficient storage
|
||||
self._rectarray = internals.PrimitiveArray(
|
||||
QtCore.QRectF,
|
||||
4,
|
||||
)
|
||||
self._rectarray.resize(n_gaps)
|
||||
rect_memory = self._rectarray.ndarray()
|
||||
|
||||
# fill rect array from gap specs
|
||||
for (
|
||||
i,
|
||||
spec,
|
||||
) in enumerate(gap_specs):
|
||||
(
|
||||
start_x,
|
||||
start_y,
|
||||
) = spec['start_pos']
|
||||
(
|
||||
end_x,
|
||||
end_y,
|
||||
) = spec['end_pos']
|
||||
|
||||
# QRectF expects (x, y, width, height)
|
||||
rect_memory[i, 0] = start_x
|
||||
rect_memory[i, 1] = min(start_y, end_y)
|
||||
rect_memory[i, 2] = end_x - start_x
|
||||
rect_memory[i, 3] = abs(end_y - start_y)
|
||||
|
||||
# build single QPainterPath for all arrows
|
||||
self._arrow_path = QtGui.QPainterPath()
|
||||
self._arrow_size = arrow_size
|
||||
|
||||
for spec in gap_specs:
|
||||
arrow_x = spec['arrow_x']
|
||||
arrow_y = spec['arrow_y']
|
||||
pointing = spec['pointing']
|
||||
|
||||
# create arrow polygon
|
||||
if pointing == 'down':
|
||||
# arrow points downward
|
||||
arrow_poly = QtGui.QPolygonF([
|
||||
QPointF(arrow_x, arrow_y), # tip
|
||||
QPointF(
|
||||
arrow_x - arrow_size/2,
|
||||
arrow_y - arrow_size,
|
||||
), # left
|
||||
QPointF(
|
||||
arrow_x + arrow_size/2,
|
||||
arrow_y - arrow_size,
|
||||
), # right
|
||||
])
|
||||
else: # up
|
||||
# arrow points upward
|
||||
arrow_poly = QtGui.QPolygonF([
|
||||
QPointF(arrow_x, arrow_y), # tip
|
||||
QPointF(
|
||||
arrow_x - arrow_size/2,
|
||||
arrow_y + arrow_size,
|
||||
), # left
|
||||
QPointF(
|
||||
arrow_x + arrow_size/2,
|
||||
arrow_y + arrow_size,
|
||||
), # right
|
||||
])
|
||||
|
||||
self._arrow_path.addPolygon(arrow_poly)
|
||||
self._arrow_path.closeSubpath()
|
||||
|
||||
# cache bounding rect
|
||||
self._br: QRectF|None = None
|
||||
|
||||
def boundingRect(self) -> QRectF:
|
||||
'''
|
||||
Compute bounding rect from rect array and arrow path.
|
||||
|
||||
'''
|
||||
if self._br is not None:
|
||||
return self._br
|
||||
|
||||
# get rect bounds
|
||||
rect_memory = self._rectarray.ndarray()
|
||||
if len(rect_memory) == 0:
|
||||
self._br = QRectF()
|
||||
return self._br
|
||||
|
||||
x_min = rect_memory[:, 0].min()
|
||||
y_min = rect_memory[:, 1].min()
|
||||
x_max = (rect_memory[:, 0] + rect_memory[:, 2]).max()
|
||||
y_max = (rect_memory[:, 1] + rect_memory[:, 3]).max()
|
||||
|
||||
# expand for arrow path
|
||||
arrow_br = self._arrow_path.boundingRect()
|
||||
x_min = min(x_min, arrow_br.left())
|
||||
y_min = min(y_min, arrow_br.top())
|
||||
x_max = max(x_max, arrow_br.right())
|
||||
y_max = max(y_max, arrow_br.bottom())
|
||||
|
||||
self._br = QRectF(
|
||||
x_min,
|
||||
y_min,
|
||||
x_max - x_min,
|
||||
y_max - y_min,
|
||||
)
|
||||
return self._br
|
||||
|
||||
def paint(
|
||||
self,
|
||||
p: QtGui.QPainter,
|
||||
opt: QtWidgets.QStyleOptionGraphicsItem,
|
||||
w: QtWidgets.QWidget,
|
||||
) -> None:
|
||||
'''
|
||||
Batch render all rects and arrows in minimal paint calls.
|
||||
|
||||
'''
|
||||
# draw all rects in single batch call (data coordinates)
|
||||
p.setPen(self._rect_pen)
|
||||
p.setBrush(self._rect_brush)
|
||||
drawargs = self._rectarray.drawargs()
|
||||
p.drawRects(*drawargs)
|
||||
|
||||
# draw arrows in scene/pixel coordinates so they maintain
|
||||
# size regardless of zoom level
|
||||
orig_tr = p.transform()
|
||||
p.resetTransform()
|
||||
|
||||
# rebuild arrow path in scene coordinates
|
||||
arrow_path_scene = QtGui.QPainterPath()
|
||||
|
||||
# arrow geometry matching pg.ArrowItem defaults
|
||||
# headLen=10, headWidth=2.222
|
||||
# headWidth is the half-width (center to edge distance)
|
||||
head_len = self._arrow_size
|
||||
head_width = head_len * 0.2222 # 2.222 at size=10
|
||||
|
||||
for spec in self._gap_specs:
|
||||
if 'arrow_x' not in spec:
|
||||
continue
|
||||
|
||||
arrow_x = spec['arrow_x']
|
||||
arrow_y = spec['arrow_y']
|
||||
pointing = spec['pointing']
|
||||
|
||||
# transform data coords to scene coords
|
||||
scene_pt = orig_tr.map(QPointF(arrow_x, arrow_y))
|
||||
sx = scene_pt.x()
|
||||
sy = scene_pt.y()
|
||||
|
||||
# create arrow polygon in scene/pixel coords
|
||||
# matching pg.ArrowItem geometry but rotated for up/down
|
||||
if pointing == 'down':
|
||||
# tip points downward (negative y direction)
|
||||
arrow_poly = QtGui.QPolygonF([
|
||||
QPointF(sx, sy), # tip
|
||||
QPointF(
|
||||
sx - head_width,
|
||||
sy - head_len,
|
||||
), # left base
|
||||
QPointF(
|
||||
sx + head_width,
|
||||
sy - head_len,
|
||||
), # right base
|
||||
])
|
||||
else: # up
|
||||
# tip points upward (positive y direction)
|
||||
arrow_poly = QtGui.QPolygonF([
|
||||
QPointF(sx, sy), # tip
|
||||
QPointF(
|
||||
sx - head_width,
|
||||
sy + head_len,
|
||||
), # left base
|
||||
QPointF(
|
||||
sx + head_width,
|
||||
sy + head_len,
|
||||
), # right base
|
||||
])
|
||||
|
||||
arrow_path_scene.addPolygon(arrow_poly)
|
||||
arrow_path_scene.closeSubpath()
|
||||
|
||||
p.setPen(self._arrow_pen)
|
||||
p.setBrush(self._arrow_brush)
|
||||
p.drawPath(arrow_path_scene)
|
||||
|
||||
# restore original transform
|
||||
p.setTransform(orig_tr)
|
||||
|
||||
def reposition(
|
||||
self,
|
||||
array: np.ndarray|None = None,
|
||||
fqme: str|None = None,
|
||||
timeframe: float|None = None,
|
||||
) -> None:
|
||||
'''
|
||||
Reposition all annotations based on timestamps.
|
||||
|
||||
Used when viz is updated (eg during backfill) and abs-index
|
||||
range changes - we need to lookup new indices from timestamps.
|
||||
|
||||
'''
|
||||
# skip reposition if timeframe doesn't match
|
||||
# (e.g., 1s gaps being repositioned with 60s array)
|
||||
if (
|
||||
timeframe is not None
|
||||
and
|
||||
self._timeframe is not None
|
||||
and
|
||||
timeframe != self._timeframe
|
||||
):
|
||||
log.debug(
|
||||
f'Skipping reposition for {self._fqme} gaps:\n'
|
||||
f' gap timeframe: {self._timeframe}s\n'
|
||||
f' array timeframe: {timeframe}s\n'
|
||||
)
|
||||
return
|
||||
|
||||
if array is None:
|
||||
array = self._array
|
||||
|
||||
if array is None:
|
||||
log.warning(
|
||||
'GapAnnotations.reposition() called but no array '
|
||||
'provided'
|
||||
)
|
||||
return
|
||||
|
||||
# collect all unique timestamps we need to lookup
|
||||
timestamps: set[float] = set()
|
||||
for spec in self._gap_specs:
|
||||
if spec.get('start_time') is not None:
|
||||
timestamps.add(spec['start_time'])
|
||||
if spec.get('end_time') is not None:
|
||||
timestamps.add(spec['end_time'])
|
||||
if spec.get('time') is not None:
|
||||
timestamps.add(spec['time'])
|
||||
|
||||
# vectorized timestamp -> row lookup using binary search
|
||||
time_to_row: dict[float, dict] = {}
|
||||
if timestamps:
|
||||
import numpy as np
|
||||
time_arr = array['time']
|
||||
ts_array = np.array(list(timestamps))
|
||||
|
||||
search_indices = np.searchsorted(
|
||||
time_arr,
|
||||
ts_array,
|
||||
)
|
||||
|
||||
# vectorized bounds check and exact match verification
|
||||
valid_mask = (
|
||||
(search_indices < len(array))
|
||||
& (time_arr[search_indices] == ts_array)
|
||||
)
|
||||
|
||||
valid_indices = search_indices[valid_mask]
|
||||
valid_timestamps = ts_array[valid_mask]
|
||||
matched_rows = array[valid_indices]
|
||||
|
||||
time_to_row = {
|
||||
float(ts): {
|
||||
'index': float(row['index']),
|
||||
'open': float(row['open']),
|
||||
'close': float(row['close']),
|
||||
}
|
||||
for ts, row in zip(
|
||||
valid_timestamps,
|
||||
matched_rows,
|
||||
)
|
||||
}
|
||||
|
||||
# rebuild rect array from gap specs with new indices
|
||||
rect_memory = self._rectarray.ndarray()
|
||||
|
||||
for (
|
||||
i,
|
||||
spec,
|
||||
) in enumerate(self._gap_specs):
|
||||
start_time = spec.get('start_time')
|
||||
end_time = spec.get('end_time')
|
||||
|
||||
if (
|
||||
start_time is None
|
||||
or end_time is None
|
||||
):
|
||||
continue
|
||||
|
||||
start_row = time_to_row.get(start_time)
|
||||
end_row = time_to_row.get(end_time)
|
||||
|
||||
if (
|
||||
start_row is None
|
||||
or end_row is None
|
||||
):
|
||||
log.warning(
|
||||
f'Timestamp lookup failed for gap[{i}] during '
|
||||
f'reposition:\n'
|
||||
f' fqme: {fqme}\n'
|
||||
f' timeframe: {timeframe}s\n'
|
||||
f' start_time: {start_time}\n'
|
||||
f' end_time: {end_time}\n'
|
||||
f' array time range: '
|
||||
f'{array["time"][0]} -> {array["time"][-1]}\n'
|
||||
)
|
||||
continue
|
||||
|
||||
start_idx = start_row['index']
|
||||
end_idx = end_row['index']
|
||||
start_close = start_row['close']
|
||||
end_open = end_row['open']
|
||||
|
||||
from_idx: float = 0.16 - 0.06
|
||||
start_x = start_idx + 1 - from_idx
|
||||
end_x = end_idx + from_idx
|
||||
|
||||
# update rect in array
|
||||
rect_memory[i, 0] = start_x
|
||||
rect_memory[i, 1] = min(start_close, end_open)
|
||||
rect_memory[i, 2] = end_x - start_x
|
||||
rect_memory[i, 3] = abs(end_open - start_close)
|
||||
|
||||
# rebuild arrow path with new indices
|
||||
self._arrow_path.clear()
|
||||
|
||||
for spec in self._gap_specs:
|
||||
time_val = spec.get('time')
|
||||
if time_val is None:
|
||||
continue
|
||||
|
||||
arrow_row = time_to_row.get(time_val)
|
||||
if arrow_row is None:
|
||||
continue
|
||||
|
||||
arrow_x = arrow_row['index']
|
||||
arrow_y = arrow_row['close']
|
||||
pointing = spec['pointing']
|
||||
|
||||
# create arrow polygon
|
||||
if pointing == 'down':
|
||||
arrow_poly = QtGui.QPolygonF([
|
||||
QPointF(arrow_x, arrow_y),
|
||||
QPointF(
|
||||
arrow_x - self._arrow_size/2,
|
||||
arrow_y - self._arrow_size,
|
||||
),
|
||||
QPointF(
|
||||
arrow_x + self._arrow_size/2,
|
||||
arrow_y - self._arrow_size,
|
||||
),
|
||||
])
|
||||
else: # up
|
||||
arrow_poly = QtGui.QPolygonF([
|
||||
QPointF(arrow_x, arrow_y),
|
||||
QPointF(
|
||||
arrow_x - self._arrow_size/2,
|
||||
arrow_y + self._arrow_size,
|
||||
),
|
||||
QPointF(
|
||||
arrow_x + self._arrow_size/2,
|
||||
arrow_y + self._arrow_size,
|
||||
),
|
||||
])
|
||||
|
||||
self._arrow_path.addPolygon(arrow_poly)
|
||||
self._arrow_path.closeSubpath()
|
||||
|
||||
# invalidate bounding rect cache
|
||||
self._br = None
|
||||
self.prepareGeometryChange()
|
||||
self.update()
|
||||
|
|
|
|||
|
|
@ -49,7 +49,7 @@ from ._cursor import (
|
|||
Cursor,
|
||||
ContentsLabel,
|
||||
)
|
||||
from tractor.ipc._shm import ShmArray
|
||||
from ..data._sharedmem import ShmArray
|
||||
from ._ohlc import BarItems
|
||||
from ._curve import (
|
||||
Curve,
|
||||
|
|
|
|||
|
|
@ -42,7 +42,9 @@ from numpy import (
|
|||
import pyqtgraph as pg
|
||||
|
||||
from piker.ui.qt import QLineF
|
||||
from tractor.ipc._shm import ShmArray
|
||||
from ..data._sharedmem import (
|
||||
ShmArray,
|
||||
)
|
||||
from ..data.flows import Flume
|
||||
from ..data._formatters import (
|
||||
IncrementalFormatter,
|
||||
|
|
|
|||
|
|
@ -214,8 +214,7 @@ async def increment_history_view(
|
|||
hist_chart: ChartPlotWidget = ds.hist_chart
|
||||
hist_viz: Viz = ds.hist_viz
|
||||
# viz: Viz = ds.viz
|
||||
# Ensure the "history" shm-buffer is what's reffed.
|
||||
assert hist_viz.shm.token['shm_name'].endswith('.hist')
|
||||
assert 'hist' in hist_viz.shm.token['shm_name']
|
||||
# name: str = hist_viz.name
|
||||
|
||||
# TODO: seems this is more reliable at keeping the slow
|
||||
|
|
|
|||
|
|
@ -168,7 +168,7 @@ class ArrowEditor(Struct):
|
|||
'''
|
||||
uid: str = arrow._uid
|
||||
arrows: list[pg.ArrowItem] = self._arrows[uid]
|
||||
log.info(
|
||||
log.debug(
|
||||
f'Removing arrow from views\n'
|
||||
f'uid: {uid!r}\n'
|
||||
f'{arrow!r}\n'
|
||||
|
|
@ -286,7 +286,9 @@ class LineEditor(Struct):
|
|||
for line in lines:
|
||||
line.show_labels()
|
||||
line.hide_markers()
|
||||
log.debug(f'Level active for level: {line.value()}')
|
||||
log.debug(
|
||||
f'Line active @ level: {line.value()!r}'
|
||||
)
|
||||
# TODO: other flashy things to indicate the order is active
|
||||
|
||||
return lines
|
||||
|
|
@ -329,7 +331,11 @@ class LineEditor(Struct):
|
|||
if line in hovered:
|
||||
hovered.remove(line)
|
||||
|
||||
log.debug(f'deleting {line} with oid: {uuid}')
|
||||
log.debug(
|
||||
f'Deleting level-line\n'
|
||||
f'line: {line!r}\n'
|
||||
f'oid: {uuid!r}\n'
|
||||
)
|
||||
line.delete()
|
||||
|
||||
# make sure the xhair doesn't get left off
|
||||
|
|
@ -337,7 +343,11 @@ class LineEditor(Struct):
|
|||
cursor.show_xhair()
|
||||
|
||||
else:
|
||||
log.warning(f'Could not find line for {line}')
|
||||
log.warning(
|
||||
f'Could not find line for removal ??\n'
|
||||
f'\n'
|
||||
f'{line!r}\n'
|
||||
)
|
||||
|
||||
return lines
|
||||
|
||||
|
|
@ -569,11 +579,11 @@ class SelectRect(QtWidgets.QGraphicsRectItem):
|
|||
if update_label:
|
||||
self.init_label(view_rect)
|
||||
|
||||
print(
|
||||
'SelectRect modify:\n'
|
||||
log.debug(
|
||||
f'SelectRect modify,\n'
|
||||
f'QRectF: {view_rect}\n'
|
||||
f'start_pos: {start_pos}\n'
|
||||
f'end_pos: {end_pos}\n'
|
||||
f'start_pos: {start_pos!r}\n'
|
||||
f'end_pos: {end_pos!r}\n'
|
||||
)
|
||||
self.show()
|
||||
|
||||
|
|
@ -640,8 +650,11 @@ class SelectRect(QtWidgets.QGraphicsRectItem):
|
|||
dmn=dmn,
|
||||
))
|
||||
|
||||
# print(f'x2, y2: {(x2, y2)}')
|
||||
# print(f'xmn, ymn: {(xmn, ymx)}')
|
||||
# tracing
|
||||
# log.info(
|
||||
# f'x2, y2: {(x2, y2)}\n'
|
||||
# f'xmn, ymn: {(xmn, ymx)}\n'
|
||||
# )
|
||||
|
||||
label_anchor = Point(
|
||||
xmx + 2,
|
||||
|
|
|
|||
|
|
@ -44,12 +44,14 @@ from piker.fsp import (
|
|||
dolla_vlm,
|
||||
flow_rates,
|
||||
)
|
||||
from tractor.ipc._shm import (
|
||||
from piker.data import (
|
||||
Flume,
|
||||
ShmArray,
|
||||
NDToken,
|
||||
)
|
||||
from piker.data import Flume
|
||||
from piker.data._sharedmem import try_read
|
||||
from piker.data._sharedmem import (
|
||||
_Token,
|
||||
try_read,
|
||||
)
|
||||
from piker.log import get_logger
|
||||
from piker.toolz import Profiler
|
||||
from piker.types import Struct
|
||||
|
|
@ -380,7 +382,7 @@ class FspAdmin:
|
|||
tuple,
|
||||
tuple[tractor.MsgStream, ShmArray]
|
||||
] = {}
|
||||
self._flow_registry: dict[NDToken, str] = {}
|
||||
self._flow_registry: dict[_Token, str] = {}
|
||||
|
||||
# TODO: make this a `.src_flume` and add
|
||||
# a `dst_flume`?
|
||||
|
|
|
|||
|
|
@ -38,7 +38,6 @@ from piker.ui.qt import (
|
|||
QtGui,
|
||||
QGraphicsPathItem,
|
||||
QStyleOptionGraphicsItem,
|
||||
QGraphicsItem,
|
||||
QGraphicsScene,
|
||||
QWidget,
|
||||
QPointF,
|
||||
|
|
|
|||
|
|
@ -22,6 +22,7 @@ a chart from some other actor.
|
|||
from __future__ import annotations
|
||||
from contextlib import (
|
||||
asynccontextmanager as acm,
|
||||
contextmanager as cm,
|
||||
AsyncExitStack,
|
||||
)
|
||||
from functools import partial
|
||||
|
|
@ -46,6 +47,7 @@ from piker.log import get_logger
|
|||
from piker.types import Struct
|
||||
from piker.service import find_service
|
||||
from piker.brokers import SymbolNotFound
|
||||
from piker.toolz import Profiler
|
||||
from piker.ui.qt import (
|
||||
QGraphicsItem,
|
||||
)
|
||||
|
|
@ -98,6 +100,8 @@ def rm_annot(
|
|||
annot: ArrowEditor|SelectRect|pg.TextItem
|
||||
) -> bool:
|
||||
global _editors
|
||||
from piker.ui._annotate import GapAnnotations
|
||||
|
||||
match annot:
|
||||
case pg.ArrowItem():
|
||||
editor = _editors[annot._uid]
|
||||
|
|
@ -122,9 +126,35 @@ def rm_annot(
|
|||
scene.removeItem(annot)
|
||||
return True
|
||||
|
||||
case GapAnnotations():
|
||||
scene = annot.scene()
|
||||
if scene:
|
||||
scene.removeItem(annot)
|
||||
return True
|
||||
|
||||
return False
|
||||
|
||||
|
||||
@cm
|
||||
def no_qt_updates(*items):
|
||||
'''
|
||||
Disable Qt widget/item updates during context to batch
|
||||
render operations and only trigger single repaint on exit.
|
||||
|
||||
Accepts both QWidgets and QGraphicsItems.
|
||||
|
||||
'''
|
||||
for item in items:
|
||||
if hasattr(item, 'setUpdatesEnabled'):
|
||||
item.setUpdatesEnabled(False)
|
||||
try:
|
||||
yield
|
||||
finally:
|
||||
for item in items:
|
||||
if hasattr(item, 'setUpdatesEnabled'):
|
||||
item.setUpdatesEnabled(True)
|
||||
|
||||
|
||||
async def serve_rc_annots(
|
||||
ipc_key: str,
|
||||
annot_req_stream: MsgStream,
|
||||
|
|
@ -429,6 +459,333 @@ async def serve_rc_annots(
|
|||
aids.add(aid)
|
||||
await annot_req_stream.send(aid)
|
||||
|
||||
case {
|
||||
'cmd': 'batch',
|
||||
'fqme': fqme,
|
||||
'timeframe': timeframe,
|
||||
'rects': list(rect_specs),
|
||||
'arrows': list(arrow_specs),
|
||||
'texts': list(text_specs),
|
||||
'show_individual_arrows': bool(show_individual_arrows),
|
||||
}:
|
||||
# batch submission handler - process multiple
|
||||
# annotations in single IPC round-trip
|
||||
ds: DisplayState = _dss[fqme]
|
||||
try:
|
||||
chart: ChartPlotWidget = {
|
||||
60: ds.hist_chart,
|
||||
1: ds.chart,
|
||||
}[timeframe]
|
||||
except KeyError:
|
||||
msg: str = (
|
||||
f'No chart for timeframe={timeframe}s, '
|
||||
f'skipping batch annotation'
|
||||
)
|
||||
log.error(msg)
|
||||
await annot_req_stream.send({'error': msg})
|
||||
continue
|
||||
|
||||
cv: ChartView = chart.cv
|
||||
viz: Viz = chart.get_viz(fqme)
|
||||
shm = viz.shm
|
||||
arr = shm.array
|
||||
|
||||
result: dict[str, list[int]] = {
|
||||
'rects': [],
|
||||
'arrows': [],
|
||||
'texts': [],
|
||||
}
|
||||
|
||||
profiler = Profiler(
|
||||
msg=(
|
||||
f'Batch annotate {len(rect_specs)} gaps '
|
||||
f'on {fqme}@{timeframe}s'
|
||||
),
|
||||
disabled=False,
|
||||
delayed=False,
|
||||
)
|
||||
|
||||
aids_set: set[int] = ctxs[ipc_key][1]
|
||||
|
||||
# build unified gap_specs for GapAnnotations class
|
||||
from piker.ui._annotate import GapAnnotations
|
||||
|
||||
gap_specs: list[dict] = []
|
||||
n_gaps: int = max(
|
||||
len(rect_specs),
|
||||
len(arrow_specs),
|
||||
)
|
||||
profiler('setup batch annot creation')
|
||||
|
||||
# collect all unique timestamps for vectorized lookup
|
||||
timestamps: list[float] = []
|
||||
for rect_spec in rect_specs:
|
||||
if start_time := rect_spec.get('start_time'):
|
||||
timestamps.append(start_time)
|
||||
if end_time := rect_spec.get('end_time'):
|
||||
timestamps.append(end_time)
|
||||
for arrow_spec in arrow_specs:
|
||||
if time_val := arrow_spec.get('time'):
|
||||
timestamps.append(time_val)
|
||||
|
||||
profiler('collect `timestamps: list` complet!')
|
||||
|
||||
# build timestamp -> row mapping using binary search
|
||||
# O(m log n) instead of O(n*m) with np.isin
|
||||
time_to_row: dict[float, dict] = {}
|
||||
if timestamps:
|
||||
import numpy as np
|
||||
time_arr = arr['time']
|
||||
ts_array = np.array(timestamps)
|
||||
|
||||
# binary search for each timestamp in sorted time array
|
||||
search_indices = np.searchsorted(
|
||||
time_arr,
|
||||
ts_array,
|
||||
)
|
||||
|
||||
profiler('`np.searchsorted()` complete!')
|
||||
|
||||
# vectorized bounds check and exact match verification
|
||||
valid_mask = (
|
||||
(search_indices < len(arr))
|
||||
& (time_arr[search_indices] == ts_array)
|
||||
)
|
||||
|
||||
# get all valid indices and timestamps
|
||||
valid_indices = search_indices[valid_mask]
|
||||
valid_timestamps = ts_array[valid_mask]
|
||||
|
||||
# use fancy indexing to get all rows at once
|
||||
matched_rows = arr[valid_indices]
|
||||
|
||||
# extract fields to plain arrays BEFORE dict building
|
||||
indices_arr = matched_rows['index'].astype(float)
|
||||
opens_arr = matched_rows['open'].astype(float)
|
||||
closes_arr = matched_rows['close'].astype(float)
|
||||
|
||||
profiler('extracted field arrays')
|
||||
|
||||
# build dict from plain arrays (much faster)
|
||||
time_to_row: dict[float, dict] = {
|
||||
float(ts): {
|
||||
'index': idx,
|
||||
'open': opn,
|
||||
'close': cls,
|
||||
}
|
||||
for (
|
||||
ts,
|
||||
idx,
|
||||
opn,
|
||||
cls,
|
||||
) in zip(
|
||||
valid_timestamps,
|
||||
indices_arr,
|
||||
opens_arr,
|
||||
closes_arr,
|
||||
)
|
||||
}
|
||||
|
||||
profiler('`time_to_row` creation complete!')
|
||||
|
||||
profiler(f'built timestamp lookup for {len(timestamps)} times')
|
||||
|
||||
# build gap_specs from rect+arrow specs
|
||||
for i in range(n_gaps):
|
||||
gap_spec: dict = {}
|
||||
|
||||
# get rect spec for this gap
|
||||
if i < len(rect_specs):
|
||||
rect_spec: dict = rect_specs[i].copy()
|
||||
start_time = rect_spec.get('start_time')
|
||||
end_time = rect_spec.get('end_time')
|
||||
|
||||
if (
|
||||
start_time is not None
|
||||
and end_time is not None
|
||||
):
|
||||
# lookup from pre-built mapping
|
||||
start_row = time_to_row.get(start_time)
|
||||
end_row = time_to_row.get(end_time)
|
||||
|
||||
if (
|
||||
start_row is None
|
||||
or end_row is None
|
||||
):
|
||||
log.warning(
|
||||
f'Timestamp lookup failed for '
|
||||
f'gap[{i}], skipping'
|
||||
)
|
||||
continue
|
||||
|
||||
start_idx = start_row['index']
|
||||
end_idx = end_row['index']
|
||||
start_close = start_row['close']
|
||||
end_open = end_row['open']
|
||||
|
||||
from_idx: float = 0.16 - 0.06
|
||||
gap_spec['start_pos'] = (
|
||||
start_idx + 1 - from_idx,
|
||||
start_close,
|
||||
)
|
||||
gap_spec['end_pos'] = (
|
||||
end_idx + from_idx,
|
||||
end_open,
|
||||
)
|
||||
gap_spec['start_time'] = start_time
|
||||
gap_spec['end_time'] = end_time
|
||||
gap_spec['color'] = rect_spec.get(
|
||||
'color',
|
||||
'dad_blue',
|
||||
)
|
||||
|
||||
# get arrow spec for this gap
|
||||
if i < len(arrow_specs):
|
||||
arrow_spec: dict = arrow_specs[i].copy()
|
||||
x: float = float(arrow_spec.get('x', 0))
|
||||
y: float = float(arrow_spec.get('y', 0))
|
||||
time_val: float|None = arrow_spec.get('time')
|
||||
|
||||
# timestamp-based index lookup (only for x, NOT y!)
|
||||
# y is already set to the PREVIOUS bar's close
|
||||
if time_val is not None:
|
||||
arrow_row = time_to_row.get(time_val)
|
||||
if arrow_row is not None:
|
||||
x = arrow_row['index']
|
||||
# NOTE: do NOT update y! it's the
|
||||
# previous bar's close, not current
|
||||
else:
|
||||
log.warning(
|
||||
f'Arrow timestamp {time_val} not '
|
||||
f'found for gap[{i}], using x={x}'
|
||||
)
|
||||
|
||||
gap_spec['arrow_x'] = x
|
||||
gap_spec['arrow_y'] = y
|
||||
gap_spec['time'] = time_val
|
||||
gap_spec['pointing'] = arrow_spec.get(
|
||||
'pointing',
|
||||
'down',
|
||||
)
|
||||
gap_spec['alpha'] = arrow_spec.get('alpha', 169)
|
||||
|
||||
gap_specs.append(gap_spec)
|
||||
|
||||
profiler(f'built {len(gap_specs)} gap_specs')
|
||||
|
||||
# create single GapAnnotations item for all gaps
|
||||
if gap_specs:
|
||||
gaps_item = GapAnnotations(
|
||||
gap_specs=gap_specs,
|
||||
array=arr,
|
||||
color=gap_specs[0].get('color', 'dad_blue'),
|
||||
alpha=gap_specs[0].get('alpha', 169),
|
||||
arrow_size=10.0,
|
||||
fqme=fqme,
|
||||
timeframe=timeframe,
|
||||
)
|
||||
chart.plotItem.addItem(gaps_item)
|
||||
|
||||
# register single item for repositioning
|
||||
aid: int = id(gaps_item)
|
||||
annots[aid] = gaps_item
|
||||
aids_set.add(aid)
|
||||
result['rects'].append(aid)
|
||||
profiler(
|
||||
f'created GapAnnotations item for {len(gap_specs)} '
|
||||
f'gaps'
|
||||
)
|
||||
|
||||
# A/B comparison: optionally create individual arrows
|
||||
# alongside batch for visual comparison
|
||||
if show_individual_arrows:
|
||||
godw = chart.linked.godwidget
|
||||
arrows: ArrowEditor = ArrowEditor(godw=godw)
|
||||
for i, spec in enumerate(gap_specs):
|
||||
if 'arrow_x' not in spec:
|
||||
continue
|
||||
|
||||
aid_str: str = str(uuid4())
|
||||
arrow: pg.ArrowItem = arrows.add(
|
||||
plot=chart.plotItem,
|
||||
uid=aid_str,
|
||||
x=spec['arrow_x'],
|
||||
y=spec['arrow_y'],
|
||||
pointing=spec['pointing'],
|
||||
color='bracket', # different color
|
||||
alpha=spec.get('alpha', 169),
|
||||
headLen=10.0,
|
||||
headWidth=2.222,
|
||||
pxMode=True,
|
||||
)
|
||||
arrow._abs_x = spec['arrow_x']
|
||||
arrow._abs_y = spec['arrow_y']
|
||||
|
||||
annots[aid_str] = arrow
|
||||
_editors[aid_str] = arrows
|
||||
aids_set.add(aid_str)
|
||||
result['arrows'].append(aid_str)
|
||||
|
||||
profiler(
|
||||
f'created {len(gap_specs)} individual arrows '
|
||||
f'for comparison'
|
||||
)
|
||||
|
||||
# handle text items separately (less common, keep
|
||||
# individual items)
|
||||
n_texts: int = 0
|
||||
for text_spec in text_specs:
|
||||
kwargs: dict = text_spec.copy()
|
||||
text: str = kwargs.pop('text')
|
||||
x: float = float(kwargs.pop('x'))
|
||||
y: float = float(kwargs.pop('y'))
|
||||
time_val: float|None = kwargs.pop('time', None)
|
||||
|
||||
# timestamp-based index lookup
|
||||
if time_val is not None:
|
||||
matches = arr[arr['time'] == time_val]
|
||||
if len(matches) > 0:
|
||||
x = float(matches[0]['index'])
|
||||
y = float(matches[0]['close'])
|
||||
|
||||
color = kwargs.pop('color', 'dad_blue')
|
||||
anchor = kwargs.pop('anchor', (0, 1))
|
||||
font_size = kwargs.pop('font_size', None)
|
||||
|
||||
text_item: pg.TextItem = pg.TextItem(
|
||||
text,
|
||||
color=hcolor(color),
|
||||
anchor=anchor,
|
||||
)
|
||||
|
||||
if font_size is None:
|
||||
from ._style import get_fonts
|
||||
font, font_small = get_fonts()
|
||||
font_size = font_small.px_size - 1
|
||||
|
||||
qfont: QFont = text_item.textItem.font()
|
||||
qfont.setPixelSize(font_size)
|
||||
text_item.setFont(qfont)
|
||||
|
||||
text_item.setPos(float(x), float(y))
|
||||
chart.plotItem.addItem(text_item)
|
||||
|
||||
text_item._abs_x = float(x)
|
||||
text_item._abs_y = float(y)
|
||||
|
||||
aid: str = str(uuid4())
|
||||
annots[aid] = text_item
|
||||
aids_set.add(aid)
|
||||
result['texts'].append(aid)
|
||||
n_texts += 1
|
||||
|
||||
profiler(
|
||||
f'created text annotations: {n_texts} texts'
|
||||
)
|
||||
profiler.finish()
|
||||
|
||||
await annot_req_stream.send(result)
|
||||
|
||||
case {
|
||||
'cmd': 'remove',
|
||||
'aid': int(aid)|str(aid),
|
||||
|
|
@ -471,10 +828,26 @@ async def serve_rc_annots(
|
|||
# XXX: reposition all annotations to ensure they
|
||||
# stay aligned with viz data after reset (eg during
|
||||
# backfill when abs-index range changes)
|
||||
chart: ChartPlotWidget = {
|
||||
60: ds.hist_chart,
|
||||
1: ds.chart,
|
||||
}[timeframe]
|
||||
viz: Viz = chart.get_viz(fqme)
|
||||
arr = viz.shm.array
|
||||
|
||||
n_repositioned: int = 0
|
||||
for aid, annot in annots.items():
|
||||
# GapAnnotations batch items have .reposition()
|
||||
if hasattr(annot, 'reposition'):
|
||||
annot.reposition(
|
||||
array=arr,
|
||||
fqme=fqme,
|
||||
timeframe=timeframe,
|
||||
)
|
||||
n_repositioned += 1
|
||||
|
||||
# arrows and text items use abs x,y coords
|
||||
if (
|
||||
elif (
|
||||
hasattr(annot, '_abs_x')
|
||||
and
|
||||
hasattr(annot, '_abs_y')
|
||||
|
|
@ -539,12 +912,21 @@ async def remote_annotate(
|
|||
finally:
|
||||
# ensure all annots for this connection are deleted
|
||||
# on any final teardown
|
||||
profiler = Profiler(
|
||||
msg=f'Annotation teardown for ctx {ctx.cid}',
|
||||
disabled=False,
|
||||
ms_threshold=0.0,
|
||||
)
|
||||
(_ctx, aids) = _ctxs[ctx.cid]
|
||||
assert _ctx is ctx
|
||||
profiler(f'got {len(aids)} aids to remove')
|
||||
|
||||
for aid in aids:
|
||||
annot: QGraphicsItem = _annots[aid]
|
||||
assert rm_annot(annot)
|
||||
|
||||
profiler(f'removed all {len(aids)} annotations')
|
||||
|
||||
|
||||
class AnnotCtl(Struct):
|
||||
'''
|
||||
|
|
@ -746,6 +1128,64 @@ class AnnotCtl(Struct):
|
|||
)
|
||||
return aid
|
||||
|
||||
async def add_batch(
|
||||
self,
|
||||
fqme: str,
|
||||
timeframe: float,
|
||||
rects: list[dict]|None = None,
|
||||
arrows: list[dict]|None = None,
|
||||
texts: list[dict]|None = None,
|
||||
show_individual_arrows: bool = False,
|
||||
|
||||
from_acm: bool = False,
|
||||
|
||||
) -> dict[str, list[int]]:
|
||||
'''
|
||||
Batch submit multiple annotations in single IPC msg for
|
||||
much faster remote annotation vs. per-annot round-trips.
|
||||
|
||||
Returns dict of annotation IDs:
|
||||
{
|
||||
'rects': [aid1, aid2, ...],
|
||||
'arrows': [aid3, aid4, ...],
|
||||
'texts': [aid5, aid6, ...],
|
||||
}
|
||||
|
||||
'''
|
||||
ipc: MsgStream = self._get_ipc(fqme)
|
||||
with trio.fail_after(10):
|
||||
await ipc.send({
|
||||
'fqme': fqme,
|
||||
'cmd': 'batch',
|
||||
'timeframe': timeframe,
|
||||
'rects': rects or [],
|
||||
'arrows': arrows or [],
|
||||
'texts': texts or [],
|
||||
'show_individual_arrows': show_individual_arrows,
|
||||
})
|
||||
result: dict = await ipc.receive()
|
||||
match result:
|
||||
case {'error': str(msg)}:
|
||||
log.error(msg)
|
||||
return {
|
||||
'rects': [],
|
||||
'arrows': [],
|
||||
'texts': [],
|
||||
}
|
||||
|
||||
# register all AIDs with their IPC streams
|
||||
for aid_list in result.values():
|
||||
for aid in aid_list:
|
||||
self._ipcs[aid] = ipc
|
||||
if not from_acm:
|
||||
self._annot_stack.push_async_callback(
|
||||
partial(
|
||||
self.remove,
|
||||
aid,
|
||||
)
|
||||
)
|
||||
return result
|
||||
|
||||
async def add_text(
|
||||
self,
|
||||
fqme: str,
|
||||
|
|
@ -881,3 +1321,14 @@ async def open_annot_ctl(
|
|||
_annot_stack=annots_stack,
|
||||
)
|
||||
yield client
|
||||
|
||||
# client exited, measure teardown time
|
||||
teardown_profiler = Profiler(
|
||||
msg='Client AnnotCtl teardown',
|
||||
disabled=False,
|
||||
ms_threshold=0.0,
|
||||
)
|
||||
teardown_profiler('exiting annots_stack')
|
||||
|
||||
teardown_profiler('annots_stack exited')
|
||||
teardown_profiler('exiting gather_contexts')
|
||||
|
|
|
|||
|
|
@ -37,7 +37,6 @@ from piker.ui.qt import (
|
|||
QStatusBar,
|
||||
QScreen,
|
||||
QCloseEvent,
|
||||
QSettings,
|
||||
)
|
||||
from ..log import get_logger
|
||||
from ._style import _font_small, hcolor
|
||||
|
|
@ -182,13 +181,6 @@ class MainWindow(QMainWindow):
|
|||
self._status_label: QLabel = None
|
||||
self._size: tuple[int, int]|None = None
|
||||
|
||||
# restore window geometry from previous session
|
||||
settings = QSettings('pikers', 'piker')
|
||||
geometry = settings.value('windowGeometry')
|
||||
if geometry is not None:
|
||||
self.restoreGeometry(geometry)
|
||||
log.debug('Restored window geometry from previous session')
|
||||
|
||||
@property
|
||||
def mode_label(self) -> QLabel:
|
||||
|
||||
|
|
@ -225,11 +217,6 @@ class MainWindow(QMainWindow):
|
|||
'''Cancel the root actor asap.
|
||||
|
||||
'''
|
||||
# save window geometry for next session
|
||||
settings = QSettings('pikers', 'piker')
|
||||
settings.setValue('windowGeometry', self.saveGeometry())
|
||||
log.debug('Saved window geometry for next session')
|
||||
|
||||
# raising KBI seems to get intercepted by by Qt so just use the system.
|
||||
os.kill(os.getpid(), signal.SIGINT)
|
||||
|
||||
|
|
|
|||
|
|
@ -44,7 +44,6 @@ from PyQt6.QtCore import (
|
|||
QItemSelectionModel,
|
||||
pyqtBoundSignal,
|
||||
pyqtRemoveInputHook,
|
||||
QSettings,
|
||||
)
|
||||
|
||||
align_flag: EnumType = Qt.AlignmentFlag
|
||||
|
|
|
|||
File diff suppressed because it is too large
Load Diff
|
|
@ -23,7 +23,7 @@ name = "piker"
|
|||
version = "0.1.0a0dev0"
|
||||
description = "trading gear for hackers"
|
||||
authors = [{ name = "Tyler Goodlet", email = "goodboy_foss@protonmail.com" }]
|
||||
requires-python = ">=3.12, <3.14"
|
||||
requires-python = ">=3.12"
|
||||
license = "AGPL-3.0-or-later"
|
||||
readme = "README.rst"
|
||||
keywords = [
|
||||
|
|
@ -106,7 +106,7 @@ default-groups = [
|
|||
|
||||
[dependency-groups]
|
||||
uis = [
|
||||
"pyqtgraph",
|
||||
"pyqtgraph >= 0.14.0",
|
||||
"qdarkstyle >=3.0.2, <4.0.0",
|
||||
"pyqt6 >=6.7.0, <7.0.0",
|
||||
|
||||
|
|
@ -193,9 +193,12 @@ include = ["piker"]
|
|||
|
||||
|
||||
[tool.uv.sources]
|
||||
pyqtgraph = { git = "https://github.com/pikers/pyqtgraph.git" }
|
||||
tomlkit = { git = "https://github.com/pikers/tomlkit.git", branch ="piker_pin" }
|
||||
pyvnc = { git = "https://github.com/regulad/pyvnc.git" }
|
||||
# pyqtgraph = { git = "https://github.com/pyqtgraph/pyqtgraph.git", branch = 'master' }
|
||||
# pyqtgraph = { path = '../pyqtgraph', editable = true }
|
||||
# ?TODO, resync our fork?
|
||||
# pyqtgraph = { git = "https://github.com/pikers/pyqtgraph.git" }
|
||||
|
||||
# to get fancy next-cmd/suggestion feats prior to 0.22.2 B)
|
||||
# https://github.com/xonsh/xonsh/pull/6037
|
||||
|
|
@ -203,8 +206,9 @@ pyvnc = { git = "https://github.com/regulad/pyvnc.git" }
|
|||
# xonsh = { git = 'https://github.com/xonsh/xonsh.git', branch = 'main' }
|
||||
|
||||
# XXX since, we're like, always hacking new shite all-the-time. Bp
|
||||
tractor = { git = "https://github.com/goodboy/tractor.git", branch ="main" }
|
||||
tractor = { git = "https://github.com/goodboy/tractor.git", branch ="piker_pin" }
|
||||
# tractor = { git = "https://pikers.dev/goodboy/tractor", branch = "piker_pin" }
|
||||
# tractor = { git = "https://pikers.dev/goodboy/tractor", branch = "main" }
|
||||
# ------ goodboy ------
|
||||
# hackin dev-envs, usually there's something new he's hackin in..
|
||||
# tractor = { path = "../tractor", editable = true }
|
||||
|
|
|
|||
385
uv.lock
385
uv.lock
|
|
@ -1,10 +1,13 @@
|
|||
version = 1
|
||||
revision = 3
|
||||
requires-python = ">=3.12, <3.14"
|
||||
requires-python = ">=3.12"
|
||||
resolution-markers = [
|
||||
"sys_platform == 'win32'",
|
||||
"sys_platform == 'emscripten'",
|
||||
"sys_platform != 'emscripten' and sys_platform != 'win32'",
|
||||
"python_full_version >= '3.14' and sys_platform == 'win32'",
|
||||
"python_full_version >= '3.14' and sys_platform == 'emscripten'",
|
||||
"python_full_version >= '3.14' and sys_platform != 'emscripten' and sys_platform != 'win32'",
|
||||
"python_full_version < '3.14' and sys_platform == 'win32'",
|
||||
"python_full_version < '3.14' and sys_platform == 'emscripten'",
|
||||
"python_full_version < '3.14' and sys_platform != 'emscripten' and sys_platform != 'win32'",
|
||||
]
|
||||
|
||||
[[package]]
|
||||
|
|
@ -182,6 +185,28 @@ wheels = [
|
|||
{ url = "https://files.pythonhosted.org/packages/eb/6d/bf9bda840d5f1dfdbf0feca87fbdb64a918a69bca42cfa0ba7b137c48cb8/cffi-2.0.0-cp313-cp313-win32.whl", hash = "sha256:74a03b9698e198d47562765773b4a8309919089150a0bb17d829ad7b44b60d27", size = 172909, upload-time = "2025-09-08T23:23:14.32Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/37/18/6519e1ee6f5a1e579e04b9ddb6f1676c17368a7aba48299c3759bbc3c8b3/cffi-2.0.0-cp313-cp313-win_amd64.whl", hash = "sha256:19f705ada2530c1167abacb171925dd886168931e0a7b78f5bffcae5c6b5be75", size = 183402, upload-time = "2025-09-08T23:23:15.535Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/cb/0e/02ceeec9a7d6ee63bb596121c2c8e9b3a9e150936f4fbef6ca1943e6137c/cffi-2.0.0-cp313-cp313-win_arm64.whl", hash = "sha256:256f80b80ca3853f90c21b23ee78cd008713787b1b1e93eae9f3d6a7134abd91", size = 177780, upload-time = "2025-09-08T23:23:16.761Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/92/c4/3ce07396253a83250ee98564f8d7e9789fab8e58858f35d07a9a2c78de9f/cffi-2.0.0-cp314-cp314-macosx_10_13_x86_64.whl", hash = "sha256:fc33c5141b55ed366cfaad382df24fe7dcbc686de5be719b207bb248e3053dc5", size = 185320, upload-time = "2025-09-08T23:23:18.087Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/59/dd/27e9fa567a23931c838c6b02d0764611c62290062a6d4e8ff7863daf9730/cffi-2.0.0-cp314-cp314-macosx_11_0_arm64.whl", hash = "sha256:c654de545946e0db659b3400168c9ad31b5d29593291482c43e3564effbcee13", size = 181487, upload-time = "2025-09-08T23:23:19.622Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/d6/43/0e822876f87ea8a4ef95442c3d766a06a51fc5298823f884ef87aaad168c/cffi-2.0.0-cp314-cp314-manylinux2014_aarch64.manylinux_2_17_aarch64.whl", hash = "sha256:24b6f81f1983e6df8db3adc38562c83f7d4a0c36162885ec7f7b77c7dcbec97b", size = 220049, upload-time = "2025-09-08T23:23:20.853Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/b4/89/76799151d9c2d2d1ead63c2429da9ea9d7aac304603de0c6e8764e6e8e70/cffi-2.0.0-cp314-cp314-manylinux2014_ppc64le.manylinux_2_17_ppc64le.whl", hash = "sha256:12873ca6cb9b0f0d3a0da705d6086fe911591737a59f28b7936bdfed27c0d47c", size = 207793, upload-time = "2025-09-08T23:23:22.08Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/bb/dd/3465b14bb9e24ee24cb88c9e3730f6de63111fffe513492bf8c808a3547e/cffi-2.0.0-cp314-cp314-manylinux2014_s390x.manylinux_2_17_s390x.whl", hash = "sha256:d9b97165e8aed9272a6bb17c01e3cc5871a594a446ebedc996e2397a1c1ea8ef", size = 206300, upload-time = "2025-09-08T23:23:23.314Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/47/d9/d83e293854571c877a92da46fdec39158f8d7e68da75bf73581225d28e90/cffi-2.0.0-cp314-cp314-manylinux2014_x86_64.manylinux_2_17_x86_64.whl", hash = "sha256:afb8db5439b81cf9c9d0c80404b60c3cc9c3add93e114dcae767f1477cb53775", size = 219244, upload-time = "2025-09-08T23:23:24.541Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/2b/0f/1f177e3683aead2bb00f7679a16451d302c436b5cbf2505f0ea8146ef59e/cffi-2.0.0-cp314-cp314-musllinux_1_2_aarch64.whl", hash = "sha256:737fe7d37e1a1bffe70bd5754ea763a62a066dc5913ca57e957824b72a85e205", size = 222828, upload-time = "2025-09-08T23:23:26.143Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/c6/0f/cafacebd4b040e3119dcb32fed8bdef8dfe94da653155f9d0b9dc660166e/cffi-2.0.0-cp314-cp314-musllinux_1_2_x86_64.whl", hash = "sha256:38100abb9d1b1435bc4cc340bb4489635dc2f0da7456590877030c9b3d40b0c1", size = 220926, upload-time = "2025-09-08T23:23:27.873Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/3e/aa/df335faa45b395396fcbc03de2dfcab242cd61a9900e914fe682a59170b1/cffi-2.0.0-cp314-cp314-win32.whl", hash = "sha256:087067fa8953339c723661eda6b54bc98c5625757ea62e95eb4898ad5e776e9f", size = 175328, upload-time = "2025-09-08T23:23:44.61Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/bb/92/882c2d30831744296ce713f0feb4c1cd30f346ef747b530b5318715cc367/cffi-2.0.0-cp314-cp314-win_amd64.whl", hash = "sha256:203a48d1fb583fc7d78a4c6655692963b860a417c0528492a6bc21f1aaefab25", size = 185650, upload-time = "2025-09-08T23:23:45.848Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/9f/2c/98ece204b9d35a7366b5b2c6539c350313ca13932143e79dc133ba757104/cffi-2.0.0-cp314-cp314-win_arm64.whl", hash = "sha256:dbd5c7a25a7cb98f5ca55d258b103a2054f859a46ae11aaf23134f9cc0d356ad", size = 180687, upload-time = "2025-09-08T23:23:47.105Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/3e/61/c768e4d548bfa607abcda77423448df8c471f25dbe64fb2ef6d555eae006/cffi-2.0.0-cp314-cp314t-macosx_10_13_x86_64.whl", hash = "sha256:9a67fc9e8eb39039280526379fb3a70023d77caec1852002b4da7e8b270c4dd9", size = 188773, upload-time = "2025-09-08T23:23:29.347Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/2c/ea/5f76bce7cf6fcd0ab1a1058b5af899bfbef198bea4d5686da88471ea0336/cffi-2.0.0-cp314-cp314t-macosx_11_0_arm64.whl", hash = "sha256:7a66c7204d8869299919db4d5069a82f1561581af12b11b3c9f48c584eb8743d", size = 185013, upload-time = "2025-09-08T23:23:30.63Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/be/b4/c56878d0d1755cf9caa54ba71e5d049479c52f9e4afc230f06822162ab2f/cffi-2.0.0-cp314-cp314t-manylinux2014_aarch64.manylinux_2_17_aarch64.whl", hash = "sha256:7cc09976e8b56f8cebd752f7113ad07752461f48a58cbba644139015ac24954c", size = 221593, upload-time = "2025-09-08T23:23:31.91Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/e0/0d/eb704606dfe8033e7128df5e90fee946bbcb64a04fcdaa97321309004000/cffi-2.0.0-cp314-cp314t-manylinux2014_ppc64le.manylinux_2_17_ppc64le.whl", hash = "sha256:92b68146a71df78564e4ef48af17551a5ddd142e5190cdf2c5624d0c3ff5b2e8", size = 209354, upload-time = "2025-09-08T23:23:33.214Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/d8/19/3c435d727b368ca475fb8742ab97c9cb13a0de600ce86f62eab7fa3eea60/cffi-2.0.0-cp314-cp314t-manylinux2014_s390x.manylinux_2_17_s390x.whl", hash = "sha256:b1e74d11748e7e98e2f426ab176d4ed720a64412b6a15054378afdb71e0f37dc", size = 208480, upload-time = "2025-09-08T23:23:34.495Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/d0/44/681604464ed9541673e486521497406fadcc15b5217c3e326b061696899a/cffi-2.0.0-cp314-cp314t-manylinux2014_x86_64.manylinux_2_17_x86_64.whl", hash = "sha256:28a3a209b96630bca57cce802da70c266eb08c6e97e5afd61a75611ee6c64592", size = 221584, upload-time = "2025-09-08T23:23:36.096Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/25/8e/342a504ff018a2825d395d44d63a767dd8ebc927ebda557fecdaca3ac33a/cffi-2.0.0-cp314-cp314t-musllinux_1_2_aarch64.whl", hash = "sha256:7553fb2090d71822f02c629afe6042c299edf91ba1bf94951165613553984512", size = 224443, upload-time = "2025-09-08T23:23:37.328Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/e1/5e/b666bacbbc60fbf415ba9988324a132c9a7a0448a9a8f125074671c0f2c3/cffi-2.0.0-cp314-cp314t-musllinux_1_2_x86_64.whl", hash = "sha256:6c6c373cfc5c83a975506110d17457138c8c63016b563cc9ed6e056a82f13ce4", size = 223437, upload-time = "2025-09-08T23:23:38.945Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/a0/1d/ec1a60bd1a10daa292d3cd6bb0b359a81607154fb8165f3ec95fe003b85c/cffi-2.0.0-cp314-cp314t-win32.whl", hash = "sha256:1fc9ea04857caf665289b7a75923f2c6ed559b8298a1b8c49e59f7dd95c8481e", size = 180487, upload-time = "2025-09-08T23:23:40.423Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/bf/41/4c1168c74fac325c0c8156f04b6749c8b6a8f405bbf91413ba088359f60d/cffi-2.0.0-cp314-cp314t-win_amd64.whl", hash = "sha256:d68b6cef7827e8641e8ef16f4494edda8b36104d79773a334beaa1e3521430f6", size = 191726, upload-time = "2025-09-08T23:23:41.742Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/ae/3a/dbeec9d1ee0844c679f6bb5d6ad4e9f198b1224f4e7a32825f47f6192b0c/cffi-2.0.0-cp314-cp314t-win_arm64.whl", hash = "sha256:0a1527a803f0a659de1af2e1fd700213caba79377e27e4693648c2923da066f9", size = 184195, upload-time = "2025-09-08T23:23:43.004Z" },
|
||||
]
|
||||
|
||||
[[package]]
|
||||
|
|
@ -222,6 +247,22 @@ wheels = [
|
|||
{ url = "https://files.pythonhosted.org/packages/89/66/c7a9e1b7429be72123441bfdbaf2bc13faab3f90b933f664db506dea5915/charset_normalizer-3.4.4-cp313-cp313-win32.whl", hash = "sha256:9b35f4c90079ff2e2edc5b26c0c77925e5d2d255c42c74fdb70fb49b172726ac", size = 99404, upload-time = "2025-10-14T04:41:29.95Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/c4/26/b9924fa27db384bdcd97ab83b4f0a8058d96ad9626ead570674d5e737d90/charset_normalizer-3.4.4-cp313-cp313-win_amd64.whl", hash = "sha256:b435cba5f4f750aa6c0a0d92c541fb79f69a387c91e61f1795227e4ed9cece14", size = 107092, upload-time = "2025-10-14T04:41:31.188Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/af/8f/3ed4bfa0c0c72a7ca17f0380cd9e4dd842b09f664e780c13cff1dcf2ef1b/charset_normalizer-3.4.4-cp313-cp313-win_arm64.whl", hash = "sha256:542d2cee80be6f80247095cc36c418f7bddd14f4a6de45af91dfad36d817bba2", size = 100408, upload-time = "2025-10-14T04:41:32.624Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/2a/35/7051599bd493e62411d6ede36fd5af83a38f37c4767b92884df7301db25d/charset_normalizer-3.4.4-cp314-cp314-macosx_10_13_universal2.whl", hash = "sha256:da3326d9e65ef63a817ecbcc0df6e94463713b754fe293eaa03da99befb9a5bd", size = 207746, upload-time = "2025-10-14T04:41:33.773Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/10/9a/97c8d48ef10d6cd4fcead2415523221624bf58bcf68a802721a6bc807c8f/charset_normalizer-3.4.4-cp314-cp314-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:8af65f14dc14a79b924524b1e7fffe304517b2bff5a58bf64f30b98bbc5079eb", size = 147889, upload-time = "2025-10-14T04:41:34.897Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/10/bf/979224a919a1b606c82bd2c5fa49b5c6d5727aa47b4312bb27b1734f53cd/charset_normalizer-3.4.4-cp314-cp314-manylinux2014_armv7l.manylinux_2_17_armv7l.manylinux_2_31_armv7l.whl", hash = "sha256:74664978bb272435107de04e36db5a9735e78232b85b77d45cfb38f758efd33e", size = 143641, upload-time = "2025-10-14T04:41:36.116Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/ba/33/0ad65587441fc730dc7bd90e9716b30b4702dc7b617e6ba4997dc8651495/charset_normalizer-3.4.4-cp314-cp314-manylinux2014_ppc64le.manylinux_2_17_ppc64le.manylinux_2_28_ppc64le.whl", hash = "sha256:752944c7ffbfdd10c074dc58ec2d5a8a4cd9493b314d367c14d24c17684ddd14", size = 160779, upload-time = "2025-10-14T04:41:37.229Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/67/ed/331d6b249259ee71ddea93f6f2f0a56cfebd46938bde6fcc6f7b9a3d0e09/charset_normalizer-3.4.4-cp314-cp314-manylinux2014_s390x.manylinux_2_17_s390x.manylinux_2_28_s390x.whl", hash = "sha256:d1f13550535ad8cff21b8d757a3257963e951d96e20ec82ab44bc64aeb62a191", size = 159035, upload-time = "2025-10-14T04:41:38.368Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/67/ff/f6b948ca32e4f2a4576aa129d8bed61f2e0543bf9f5f2b7fc3758ed005c9/charset_normalizer-3.4.4-cp314-cp314-manylinux2014_x86_64.manylinux_2_17_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:ecaae4149d99b1c9e7b88bb03e3221956f68fd6d50be2ef061b2381b61d20838", size = 152542, upload-time = "2025-10-14T04:41:39.862Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/16/85/276033dcbcc369eb176594de22728541a925b2632f9716428c851b149e83/charset_normalizer-3.4.4-cp314-cp314-manylinux_2_31_riscv64.manylinux_2_39_riscv64.whl", hash = "sha256:cb6254dc36b47a990e59e1068afacdcd02958bdcce30bb50cc1700a8b9d624a6", size = 149524, upload-time = "2025-10-14T04:41:41.319Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/9e/f2/6a2a1f722b6aba37050e626530a46a68f74e63683947a8acff92569f979a/charset_normalizer-3.4.4-cp314-cp314-musllinux_1_2_aarch64.whl", hash = "sha256:c8ae8a0f02f57a6e61203a31428fa1d677cbe50c93622b4149d5c0f319c1d19e", size = 150395, upload-time = "2025-10-14T04:41:42.539Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/60/bb/2186cb2f2bbaea6338cad15ce23a67f9b0672929744381e28b0592676824/charset_normalizer-3.4.4-cp314-cp314-musllinux_1_2_armv7l.whl", hash = "sha256:47cc91b2f4dd2833fddaedd2893006b0106129d4b94fdb6af1f4ce5a9965577c", size = 143680, upload-time = "2025-10-14T04:41:43.661Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/7d/a5/bf6f13b772fbb2a90360eb620d52ed8f796f3c5caee8398c3b2eb7b1c60d/charset_normalizer-3.4.4-cp314-cp314-musllinux_1_2_ppc64le.whl", hash = "sha256:82004af6c302b5d3ab2cfc4cc5f29db16123b1a8417f2e25f9066f91d4411090", size = 162045, upload-time = "2025-10-14T04:41:44.821Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/df/c5/d1be898bf0dc3ef9030c3825e5d3b83f2c528d207d246cbabe245966808d/charset_normalizer-3.4.4-cp314-cp314-musllinux_1_2_riscv64.whl", hash = "sha256:2b7d8f6c26245217bd2ad053761201e9f9680f8ce52f0fcd8d0755aeae5b2152", size = 149687, upload-time = "2025-10-14T04:41:46.442Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/a5/42/90c1f7b9341eef50c8a1cb3f098ac43b0508413f33affd762855f67a410e/charset_normalizer-3.4.4-cp314-cp314-musllinux_1_2_s390x.whl", hash = "sha256:799a7a5e4fb2d5898c60b640fd4981d6a25f1c11790935a44ce38c54e985f828", size = 160014, upload-time = "2025-10-14T04:41:47.631Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/76/be/4d3ee471e8145d12795ab655ece37baed0929462a86e72372fd25859047c/charset_normalizer-3.4.4-cp314-cp314-musllinux_1_2_x86_64.whl", hash = "sha256:99ae2cffebb06e6c22bdc25801d7b30f503cc87dbd283479e7b606f70aff57ec", size = 154044, upload-time = "2025-10-14T04:41:48.81Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/b0/6f/8f7af07237c34a1defe7defc565a9bc1807762f672c0fde711a4b22bf9c0/charset_normalizer-3.4.4-cp314-cp314-win32.whl", hash = "sha256:f9d332f8c2a2fcbffe1378594431458ddbef721c1769d78e2cbc06280d8155f9", size = 99940, upload-time = "2025-10-14T04:41:49.946Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/4b/51/8ade005e5ca5b0d80fb4aff72a3775b325bdc3d27408c8113811a7cbe640/charset_normalizer-3.4.4-cp314-cp314-win_amd64.whl", hash = "sha256:8a6562c3700cce886c5be75ade4a5db4214fda19fede41d9792d100288d8f94c", size = 107104, upload-time = "2025-10-14T04:41:51.051Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/da/5f/6b8f83a55bb8278772c5ae54a577f3099025f9ade59d0136ac24a0df4bde/charset_normalizer-3.4.4-cp314-cp314-win_arm64.whl", hash = "sha256:de00632ca48df9daf77a2c65a484531649261ec9f25489917f09e455cb09ddb2", size = 100743, upload-time = "2025-10-14T04:41:52.122Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/0a/4c/925909008ed5a988ccbb72dcc897407e5d6d3bd72410d69e051fc0c14647/charset_normalizer-3.4.4-py3-none-any.whl", hash = "sha256:7a32c560861a02ff789ad905a2fe94e3f840803362c84fecf1851cb4cf3dc37f", size = 53402, upload-time = "2025-10-14T04:42:31.76Z" },
|
||||
]
|
||||
|
||||
|
|
@ -324,6 +365,10 @@ wheels = [
|
|||
{ url = "https://files.pythonhosted.org/packages/46/21/a8038c8253e7a5241ed1db6d031bac586f7a502d92f487124abbc3f3e94f/cython-3.2.2-cp313-cp313-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:60f4aa425e1ff98abf8d965ae7020f06dd2cbc01dbd945137d2f9cca4ff0524a", size = 3212479, upload-time = "2025-11-30T12:48:57.567Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/57/c1/76928c07176a4402c74d5b304936ad8ee167dd04a07cf7dca545e8c25f9b/cython-3.2.2-cp313-cp313-manylinux2014_x86_64.manylinux_2_17_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:a473df474ba89e9fee81ee82b31062a267f9e598096b222783477e56d02ad12c", size = 3374773, upload-time = "2025-11-30T12:48:59.318Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/fa/cb/ce641e07ba9c0cde8468e83e0214fb87020b74ba34dbb9dfe8d250a327f5/cython-3.2.2-cp313-cp313-win_amd64.whl", hash = "sha256:b4df52101209817fde7284cf779156f79142fb639b1d7840f11680ff4bb30604", size = 2754492, upload-time = "2025-11-30T12:49:01.029Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/c0/f2/cd60f639f0fde38b71319d7b6808e1ff17a6fd7f3feaff475b866a5c0aef/cython-3.2.2-cp314-cp314-macosx_11_0_arm64.whl", hash = "sha256:177faf4d61e9f2d4d2db61194ac9ec16d3fe3041c1b6830f871a01935319eeb3", size = 2969023, upload-time = "2025-11-30T12:49:02.734Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/5d/45/6f155a9ad125536d8f30716c4d7571caae73ec811039d3ae33f9b535090d/cython-3.2.2-cp314-cp314-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:8db28aef793c81dc69383b619ca508668998aaf099cd839d3cbae85184cce744", size = 3258270, upload-time = "2025-11-30T12:49:04.878Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/af/7e/022c25886fdc3ff6a005b6ae4a1c3d8522006bb738367aa5bd6c2590130b/cython-3.2.2-cp314-cp314-manylinux2014_x86_64.manylinux_2_17_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:3de43a5786033a27fae1c882feb5ff0d023c38b83356e6800c1be0bcd6cf9f11", size = 3384504, upload-time = "2025-11-30T12:49:07.078Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/b6/07/1e3e4faf6f785d5ba053e9d6320b3f338162dc122c27a7c540b49615fc39/cython-3.2.2-cp314-cp314-win_amd64.whl", hash = "sha256:fed44d0ab2d36f1b0301c770b0dafec23bcb9700d58e7769cd6d9136b3304c11", size = 2791504, upload-time = "2025-11-30T12:49:08.729Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/f4/69/5430879d35235ec3d5ffd778862173b6419390509ae4e37a72bdd45d9e86/cython-3.2.2-cp39-abi3-macosx_10_9_x86_64.whl", hash = "sha256:a6387e3ad31342443916db9a419509935fddd8d4cbac34aab9c895ae55326a56", size = 2874031, upload-time = "2025-11-30T12:49:18.34Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/51/fa/584f4b56b35b3e7a43dc16603dd722cb5528484da67c27136534b782827b/cython-3.2.2-cp39-abi3-manylinux1_i686.manylinux_2_28_i686.manylinux_2_5_i686.whl", hash = "sha256:436eb562d0affbc0b959f62f3f9c1ed251b9499e4f29c1d19514ae859894b6bf", size = 3210813, upload-time = "2025-11-30T12:49:20.55Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/d1/d4/063c34a34d9ef54836a5dafb100b8f4fdbdaa63942913fe93f9eb93a11a2/cython-3.2.2-cp39-abi3-manylinux2014_armv7l.manylinux_2_17_armv7l.manylinux_2_31_armv7l.whl", hash = "sha256:f560ff3aea5b5df93853ec7bf1a1e9623d6d511f4192f197559aca18fca43392", size = 2855611, upload-time = "2025-11-30T12:49:22.303Z" },
|
||||
|
|
@ -446,6 +491,38 @@ wheels = [
|
|||
{ url = "https://files.pythonhosted.org/packages/fd/00/04ca1c3a7a124b6de4f8a9a17cc2fcad138b4608e7a3fc5877804b8715d7/frozenlist-1.8.0-cp313-cp313t-win32.whl", hash = "sha256:0f96534f8bfebc1a394209427d0f8a63d343c9779cda6fc25e8e121b5fd8555b", size = 43492, upload-time = "2025-10-06T05:37:04.915Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/59/5e/c69f733a86a94ab10f68e496dc6b7e8bc078ebb415281d5698313e3af3a1/frozenlist-1.8.0-cp313-cp313t-win_amd64.whl", hash = "sha256:5d63a068f978fc69421fb0e6eb91a9603187527c86b7cd3f534a5b77a592b888", size = 48034, upload-time = "2025-10-06T05:37:06.343Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/16/6c/be9d79775d8abe79b05fa6d23da99ad6e7763a1d080fbae7290b286093fd/frozenlist-1.8.0-cp313-cp313t-win_arm64.whl", hash = "sha256:bf0a7e10b077bf5fb9380ad3ae8ce20ef919a6ad93b4552896419ac7e1d8e042", size = 41749, upload-time = "2025-10-06T05:37:07.431Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/f1/c8/85da824b7e7b9b6e7f7705b2ecaf9591ba6f79c1177f324c2735e41d36a2/frozenlist-1.8.0-cp314-cp314-macosx_10_13_universal2.whl", hash = "sha256:cee686f1f4cadeb2136007ddedd0aaf928ab95216e7691c63e50a8ec066336d0", size = 86127, upload-time = "2025-10-06T05:37:08.438Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/8e/e8/a1185e236ec66c20afd72399522f142c3724c785789255202d27ae992818/frozenlist-1.8.0-cp314-cp314-macosx_10_13_x86_64.whl", hash = "sha256:119fb2a1bd47307e899c2fac7f28e85b9a543864df47aa7ec9d3c1b4545f096f", size = 49698, upload-time = "2025-10-06T05:37:09.48Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/a1/93/72b1736d68f03fda5fdf0f2180fb6caaae3894f1b854d006ac61ecc727ee/frozenlist-1.8.0-cp314-cp314-macosx_11_0_arm64.whl", hash = "sha256:4970ece02dbc8c3a92fcc5228e36a3e933a01a999f7094ff7c23fbd2beeaa67c", size = 49749, upload-time = "2025-10-06T05:37:10.569Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/a7/b2/fabede9fafd976b991e9f1b9c8c873ed86f202889b864756f240ce6dd855/frozenlist-1.8.0-cp314-cp314-manylinux1_x86_64.manylinux_2_28_x86_64.manylinux_2_5_x86_64.whl", hash = "sha256:cba69cb73723c3f329622e34bdbf5ce1f80c21c290ff04256cff1cd3c2036ed2", size = 231298, upload-time = "2025-10-06T05:37:11.993Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/3a/3b/d9b1e0b0eed36e70477ffb8360c49c85c8ca8ef9700a4e6711f39a6e8b45/frozenlist-1.8.0-cp314-cp314-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:778a11b15673f6f1df23d9586f83c4846c471a8af693a22e066508b77d201ec8", size = 232015, upload-time = "2025-10-06T05:37:13.194Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/dc/94/be719d2766c1138148564a3960fc2c06eb688da592bdc25adcf856101be7/frozenlist-1.8.0-cp314-cp314-manylinux2014_armv7l.manylinux_2_17_armv7l.manylinux_2_31_armv7l.whl", hash = "sha256:0325024fe97f94c41c08872db482cf8ac4800d80e79222c6b0b7b162d5b13686", size = 225038, upload-time = "2025-10-06T05:37:14.577Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/e4/09/6712b6c5465f083f52f50cf74167b92d4ea2f50e46a9eea0523d658454ae/frozenlist-1.8.0-cp314-cp314-manylinux2014_ppc64le.manylinux_2_17_ppc64le.manylinux_2_28_ppc64le.whl", hash = "sha256:97260ff46b207a82a7567b581ab4190bd4dfa09f4db8a8b49d1a958f6aa4940e", size = 240130, upload-time = "2025-10-06T05:37:15.781Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/f8/d4/cd065cdcf21550b54f3ce6a22e143ac9e4836ca42a0de1022da8498eac89/frozenlist-1.8.0-cp314-cp314-manylinux2014_s390x.manylinux_2_17_s390x.manylinux_2_28_s390x.whl", hash = "sha256:54b2077180eb7f83dd52c40b2750d0a9f175e06a42e3213ce047219de902717a", size = 242845, upload-time = "2025-10-06T05:37:17.037Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/62/c3/f57a5c8c70cd1ead3d5d5f776f89d33110b1addae0ab010ad774d9a44fb9/frozenlist-1.8.0-cp314-cp314-musllinux_1_2_aarch64.whl", hash = "sha256:2f05983daecab868a31e1da44462873306d3cbfd76d1f0b5b69c473d21dbb128", size = 229131, upload-time = "2025-10-06T05:37:18.221Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/6c/52/232476fe9cb64f0742f3fde2b7d26c1dac18b6d62071c74d4ded55e0ef94/frozenlist-1.8.0-cp314-cp314-musllinux_1_2_armv7l.whl", hash = "sha256:33f48f51a446114bc5d251fb2954ab0164d5be02ad3382abcbfe07e2531d650f", size = 240542, upload-time = "2025-10-06T05:37:19.771Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/5f/85/07bf3f5d0fb5414aee5f47d33c6f5c77bfe49aac680bfece33d4fdf6a246/frozenlist-1.8.0-cp314-cp314-musllinux_1_2_ppc64le.whl", hash = "sha256:154e55ec0655291b5dd1b8731c637ecdb50975a2ae70c606d100750a540082f7", size = 237308, upload-time = "2025-10-06T05:37:20.969Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/11/99/ae3a33d5befd41ac0ca2cc7fd3aa707c9c324de2e89db0e0f45db9a64c26/frozenlist-1.8.0-cp314-cp314-musllinux_1_2_s390x.whl", hash = "sha256:4314debad13beb564b708b4a496020e5306c7333fa9a3ab90374169a20ffab30", size = 238210, upload-time = "2025-10-06T05:37:22.252Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/b2/60/b1d2da22f4970e7a155f0adde9b1435712ece01b3cd45ba63702aea33938/frozenlist-1.8.0-cp314-cp314-musllinux_1_2_x86_64.whl", hash = "sha256:073f8bf8becba60aa931eb3bc420b217bb7d5b8f4750e6f8b3be7f3da85d38b7", size = 231972, upload-time = "2025-10-06T05:37:23.5Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/3f/ab/945b2f32de889993b9c9133216c068b7fcf257d8595a0ac420ac8677cab0/frozenlist-1.8.0-cp314-cp314-win32.whl", hash = "sha256:bac9c42ba2ac65ddc115d930c78d24ab8d4f465fd3fc473cdedfccadb9429806", size = 40536, upload-time = "2025-10-06T05:37:25.581Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/59/ad/9caa9b9c836d9ad6f067157a531ac48b7d36499f5036d4141ce78c230b1b/frozenlist-1.8.0-cp314-cp314-win_amd64.whl", hash = "sha256:3e0761f4d1a44f1d1a47996511752cf3dcec5bbdd9cc2b4fe595caf97754b7a0", size = 44330, upload-time = "2025-10-06T05:37:26.928Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/82/13/e6950121764f2676f43534c555249f57030150260aee9dcf7d64efda11dd/frozenlist-1.8.0-cp314-cp314-win_arm64.whl", hash = "sha256:d1eaff1d00c7751b7c6662e9c5ba6eb2c17a2306ba5e2a37f24ddf3cc953402b", size = 40627, upload-time = "2025-10-06T05:37:28.075Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/c0/c7/43200656ecc4e02d3f8bc248df68256cd9572b3f0017f0a0c4e93440ae23/frozenlist-1.8.0-cp314-cp314t-macosx_10_13_universal2.whl", hash = "sha256:d3bb933317c52d7ea5004a1c442eef86f426886fba134ef8cf4226ea6ee1821d", size = 89238, upload-time = "2025-10-06T05:37:29.373Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/d1/29/55c5f0689b9c0fb765055629f472c0de484dcaf0acee2f7707266ae3583c/frozenlist-1.8.0-cp314-cp314t-macosx_10_13_x86_64.whl", hash = "sha256:8009897cdef112072f93a0efdce29cd819e717fd2f649ee3016efd3cd885a7ed", size = 50738, upload-time = "2025-10-06T05:37:30.792Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/ba/7d/b7282a445956506fa11da8c2db7d276adcbf2b17d8bb8407a47685263f90/frozenlist-1.8.0-cp314-cp314t-macosx_11_0_arm64.whl", hash = "sha256:2c5dcbbc55383e5883246d11fd179782a9d07a986c40f49abe89ddf865913930", size = 51739, upload-time = "2025-10-06T05:37:32.127Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/62/1c/3d8622e60d0b767a5510d1d3cf21065b9db874696a51ea6d7a43180a259c/frozenlist-1.8.0-cp314-cp314t-manylinux1_x86_64.manylinux_2_28_x86_64.manylinux_2_5_x86_64.whl", hash = "sha256:39ecbc32f1390387d2aa4f5a995e465e9e2f79ba3adcac92d68e3e0afae6657c", size = 284186, upload-time = "2025-10-06T05:37:33.21Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/2d/14/aa36d5f85a89679a85a1d44cd7a6657e0b1c75f61e7cad987b203d2daca8/frozenlist-1.8.0-cp314-cp314t-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:92db2bf818d5cc8d9c1f1fc56b897662e24ea5adb36ad1f1d82875bd64e03c24", size = 292196, upload-time = "2025-10-06T05:37:36.107Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/05/23/6bde59eb55abd407d34f77d39a5126fb7b4f109a3f611d3929f14b700c66/frozenlist-1.8.0-cp314-cp314t-manylinux2014_armv7l.manylinux_2_17_armv7l.manylinux_2_31_armv7l.whl", hash = "sha256:2dc43a022e555de94c3b68a4ef0b11c4f747d12c024a520c7101709a2144fb37", size = 273830, upload-time = "2025-10-06T05:37:37.663Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/d2/3f/22cff331bfad7a8afa616289000ba793347fcd7bc275f3b28ecea2a27909/frozenlist-1.8.0-cp314-cp314t-manylinux2014_ppc64le.manylinux_2_17_ppc64le.manylinux_2_28_ppc64le.whl", hash = "sha256:cb89a7f2de3602cfed448095bab3f178399646ab7c61454315089787df07733a", size = 294289, upload-time = "2025-10-06T05:37:39.261Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/a4/89/5b057c799de4838b6c69aa82b79705f2027615e01be996d2486a69ca99c4/frozenlist-1.8.0-cp314-cp314t-manylinux2014_s390x.manylinux_2_17_s390x.manylinux_2_28_s390x.whl", hash = "sha256:33139dc858c580ea50e7e60a1b0ea003efa1fd42e6ec7fdbad78fff65fad2fd2", size = 300318, upload-time = "2025-10-06T05:37:43.213Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/30/de/2c22ab3eb2a8af6d69dc799e48455813bab3690c760de58e1bf43b36da3e/frozenlist-1.8.0-cp314-cp314t-musllinux_1_2_aarch64.whl", hash = "sha256:168c0969a329b416119507ba30b9ea13688fafffac1b7822802537569a1cb0ef", size = 282814, upload-time = "2025-10-06T05:37:45.337Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/59/f7/970141a6a8dbd7f556d94977858cfb36fa9b66e0892c6dd780d2219d8cd8/frozenlist-1.8.0-cp314-cp314t-musllinux_1_2_armv7l.whl", hash = "sha256:28bd570e8e189d7f7b001966435f9dac6718324b5be2990ac496cf1ea9ddb7fe", size = 291762, upload-time = "2025-10-06T05:37:46.657Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/c1/15/ca1adae83a719f82df9116d66f5bb28bb95557b3951903d39135620ef157/frozenlist-1.8.0-cp314-cp314t-musllinux_1_2_ppc64le.whl", hash = "sha256:b2a095d45c5d46e5e79ba1e5b9cb787f541a8dee0433836cea4b96a2c439dcd8", size = 289470, upload-time = "2025-10-06T05:37:47.946Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/ac/83/dca6dc53bf657d371fbc88ddeb21b79891e747189c5de990b9dfff2ccba1/frozenlist-1.8.0-cp314-cp314t-musllinux_1_2_s390x.whl", hash = "sha256:eab8145831a0d56ec9c4139b6c3e594c7a83c2c8be25d5bcf2d86136a532287a", size = 289042, upload-time = "2025-10-06T05:37:49.499Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/96/52/abddd34ca99be142f354398700536c5bd315880ed0a213812bc491cff5e4/frozenlist-1.8.0-cp314-cp314t-musllinux_1_2_x86_64.whl", hash = "sha256:974b28cf63cc99dfb2188d8d222bc6843656188164848c4f679e63dae4b0708e", size = 283148, upload-time = "2025-10-06T05:37:50.745Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/af/d3/76bd4ed4317e7119c2b7f57c3f6934aba26d277acc6309f873341640e21f/frozenlist-1.8.0-cp314-cp314t-win32.whl", hash = "sha256:342c97bf697ac5480c0a7ec73cd700ecfa5a8a40ac923bd035484616efecc2df", size = 44676, upload-time = "2025-10-06T05:37:52.222Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/89/76/c615883b7b521ead2944bb3480398cbb07e12b7b4e4d073d3752eb721558/frozenlist-1.8.0-cp314-cp314t-win_amd64.whl", hash = "sha256:06be8f67f39c8b1dc671f5d83aaefd3358ae5cdcf8314552c57e7ed3e6475bdd", size = 49451, upload-time = "2025-10-06T05:37:53.425Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/e0/a3/5982da14e113d07b325230f95060e2169f5311b1017ea8af2a29b374c289/frozenlist-1.8.0-cp314-cp314t-win_arm64.whl", hash = "sha256:102e6314ca4da683dca92e3b1355490fed5f313b768500084fbe6371fddfdb79", size = 42507, upload-time = "2025-10-06T05:37:54.513Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/9a/9a/e35b4a917281c0b8419d4207f4334c8e8c5dbf4f3f5f9ada73958d937dcc/frozenlist-1.8.0-py3-none-any.whl", hash = "sha256:0c18a16eab41e82c295618a77502e17b195883241c563b00f0aa5106fc4eaa0d", size = 13409, upload-time = "2025-10-06T05:38:16.721Z" },
|
||||
]
|
||||
|
||||
|
|
@ -485,6 +562,21 @@ wheels = [
|
|||
{ url = "https://files.pythonhosted.org/packages/b5/ba/56699ff9b7c76ca12f1cdc27a886d0f81f2189c3455ff9f65246780f713d/greenlet-3.3.0-cp313-cp313-musllinux_1_2_aarch64.whl", hash = "sha256:ab97cf74045343f6c60a39913fa59710e4bd26a536ce7ab2397adf8b27e67c39", size = 1567256, upload-time = "2025-12-04T15:04:25.276Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/1e/37/f31136132967982d698c71a281a8901daf1a8fbab935dce7c0cf15f942cc/greenlet-3.3.0-cp313-cp313-musllinux_1_2_x86_64.whl", hash = "sha256:5375d2e23184629112ca1ea89a53389dddbffcf417dad40125713d88eb5f96e8", size = 1636483, upload-time = "2025-12-04T14:27:30.804Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/7e/71/ba21c3fb8c5dce83b8c01f458a42e99ffdb1963aeec08fff5a18588d8fd7/greenlet-3.3.0-cp313-cp313-win_amd64.whl", hash = "sha256:9ee1942ea19550094033c35d25d20726e4f1c40d59545815e1128ac58d416d38", size = 301833, upload-time = "2025-12-04T14:32:23.929Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/d7/7c/f0a6d0ede2c7bf092d00bc83ad5bafb7e6ec9b4aab2fbdfa6f134dc73327/greenlet-3.3.0-cp314-cp314-macosx_11_0_universal2.whl", hash = "sha256:60c2ef0f578afb3c8d92ea07ad327f9a062547137afe91f38408f08aacab667f", size = 275671, upload-time = "2025-12-04T14:23:05.267Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/44/06/dac639ae1a50f5969d82d2e3dd9767d30d6dbdbab0e1a54010c8fe90263c/greenlet-3.3.0-cp314-cp314-manylinux_2_24_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:0a5d554d0712ba1de0a6c94c640f7aeba3f85b3a6e1f2899c11c2c0428da9365", size = 646360, upload-time = "2025-12-04T14:50:10.026Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/e0/94/0fb76fe6c5369fba9bf98529ada6f4c3a1adf19e406a47332245ef0eb357/greenlet-3.3.0-cp314-cp314-manylinux_2_24_ppc64le.manylinux_2_28_ppc64le.whl", hash = "sha256:3a898b1e9c5f7307ebbde4102908e6cbfcb9ea16284a3abe15cab996bee8b9b3", size = 658160, upload-time = "2025-12-04T14:57:45.41Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/93/79/d2c70cae6e823fac36c3bbc9077962105052b7ef81db2f01ec3b9bf17e2b/greenlet-3.3.0-cp314-cp314-manylinux_2_24_s390x.manylinux_2_28_s390x.whl", hash = "sha256:dcd2bdbd444ff340e8d6bdf54d2f206ccddbb3ccfdcd3c25bf4afaa7b8f0cf45", size = 671388, upload-time = "2025-12-04T15:07:15.789Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/b8/14/bab308fc2c1b5228c3224ec2bf928ce2e4d21d8046c161e44a2012b5203e/greenlet-3.3.0-cp314-cp314-manylinux_2_24_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:5773edda4dc00e173820722711d043799d3adb4f01731f40619e07ea2750b955", size = 660166, upload-time = "2025-12-04T14:26:05.099Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/4b/d2/91465d39164eaa0085177f61983d80ffe746c5a1860f009811d498e7259c/greenlet-3.3.0-cp314-cp314-musllinux_1_2_aarch64.whl", hash = "sha256:ac0549373982b36d5fd5d30beb8a7a33ee541ff98d2b502714a09f1169f31b55", size = 1615193, upload-time = "2025-12-04T15:04:27.041Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/42/1b/83d110a37044b92423084d52d5d5a3b3a73cafb51b547e6d7366ff62eff1/greenlet-3.3.0-cp314-cp314-musllinux_1_2_x86_64.whl", hash = "sha256:d198d2d977460358c3b3a4dc844f875d1adb33817f0613f663a656f463764ccc", size = 1683653, upload-time = "2025-12-04T14:27:32.366Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/7c/9a/9030e6f9aa8fd7808e9c31ba4c38f87c4f8ec324ee67431d181fe396d705/greenlet-3.3.0-cp314-cp314-win_amd64.whl", hash = "sha256:73f51dd0e0bdb596fb0417e475fa3c5e32d4c83638296e560086b8d7da7c4170", size = 305387, upload-time = "2025-12-04T14:26:51.063Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/a0/66/bd6317bc5932accf351fc19f177ffba53712a202f9df10587da8df257c7e/greenlet-3.3.0-cp314-cp314t-macosx_11_0_universal2.whl", hash = "sha256:d6ed6f85fae6cdfdb9ce04c9bf7a08d666cfcfb914e7d006f44f840b46741931", size = 282638, upload-time = "2025-12-04T14:25:20.941Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/30/cf/cc81cb030b40e738d6e69502ccbd0dd1bced0588e958f9e757945de24404/greenlet-3.3.0-cp314-cp314t-manylinux_2_24_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:d9125050fcf24554e69c4cacb086b87b3b55dc395a8b3ebe6487b045b2614388", size = 651145, upload-time = "2025-12-04T14:50:11.039Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/9c/ea/1020037b5ecfe95ca7df8d8549959baceb8186031da83d5ecceff8b08cd2/greenlet-3.3.0-cp314-cp314t-manylinux_2_24_ppc64le.manylinux_2_28_ppc64le.whl", hash = "sha256:87e63ccfa13c0a0f6234ed0add552af24cc67dd886731f2261e46e241608bee3", size = 654236, upload-time = "2025-12-04T14:57:47.007Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/69/cc/1e4bae2e45ca2fa55299f4e85854606a78ecc37fead20d69322f96000504/greenlet-3.3.0-cp314-cp314t-manylinux_2_24_s390x.manylinux_2_28_s390x.whl", hash = "sha256:2662433acbca297c9153a4023fe2161c8dcfdcc91f10433171cf7e7d94ba2221", size = 662506, upload-time = "2025-12-04T15:07:16.906Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/57/b9/f8025d71a6085c441a7eaff0fd928bbb275a6633773667023d19179fe815/greenlet-3.3.0-cp314-cp314t-manylinux_2_24_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:3c6e9b9c1527a78520357de498b0e709fb9e2f49c3a513afd5a249007261911b", size = 653783, upload-time = "2025-12-04T14:26:06.225Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/f6/c7/876a8c7a7485d5d6b5c6821201d542ef28be645aa024cfe1145b35c120c1/greenlet-3.3.0-cp314-cp314t-musllinux_1_2_aarch64.whl", hash = "sha256:286d093f95ec98fdd92fcb955003b8a3d054b4e2cab3e2707a5039e7b50520fd", size = 1614857, upload-time = "2025-12-04T15:04:28.484Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/4f/dc/041be1dff9f23dac5f48a43323cd0789cb798342011c19a248d9c9335536/greenlet-3.3.0-cp314-cp314t-musllinux_1_2_x86_64.whl", hash = "sha256:6c10513330af5b8ae16f023e8ddbfb486ab355d04467c4679c5cfe4659975dd9", size = 1676034, upload-time = "2025-12-04T14:27:33.531Z" },
|
||||
]
|
||||
|
||||
[[package]]
|
||||
|
|
@ -719,6 +811,42 @@ wheels = [
|
|||
{ url = "https://files.pythonhosted.org/packages/ef/a0/f83ae75e42d694b3fbad3e047670e511c138be747bc713cf1b10d5096416/multidict-6.7.0-cp313-cp313t-win32.whl", hash = "sha256:19a1d55338ec1be74ef62440ca9e04a2f001a04d0cc49a4983dc320ff0f3212d", size = 47777, upload-time = "2025-10-06T14:50:47.154Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/dc/80/9b174a92814a3830b7357307a792300f42c9e94664b01dee8e457551fa66/multidict-6.7.0-cp313-cp313t-win_amd64.whl", hash = "sha256:3da4fb467498df97e986af166b12d01f05d2e04f978a9c1c680ea1988e0bc4b6", size = 53104, upload-time = "2025-10-06T14:50:48.851Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/cc/28/04baeaf0428d95bb7a7bea0e691ba2f31394338ba424fb0679a9ed0f4c09/multidict-6.7.0-cp313-cp313t-win_arm64.whl", hash = "sha256:b4121773c49a0776461f4a904cdf6264c88e42218aaa8407e803ca8025872792", size = 45503, upload-time = "2025-10-06T14:50:50.16Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/e2/b1/3da6934455dd4b261d4c72f897e3a5728eba81db59959f3a639245891baa/multidict-6.7.0-cp314-cp314-macosx_10_13_universal2.whl", hash = "sha256:3bab1e4aff7adaa34410f93b1f8e57c4b36b9af0426a76003f441ee1d3c7e842", size = 75128, upload-time = "2025-10-06T14:50:51.92Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/14/2c/f069cab5b51d175a1a2cb4ccdf7a2c2dabd58aa5bd933fa036a8d15e2404/multidict-6.7.0-cp314-cp314-macosx_10_13_x86_64.whl", hash = "sha256:b8512bac933afc3e45fb2b18da8e59b78d4f408399a960339598374d4ae3b56b", size = 44410, upload-time = "2025-10-06T14:50:53.275Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/42/e2/64bb41266427af6642b6b128e8774ed84c11b80a90702c13ac0a86bb10cc/multidict-6.7.0-cp314-cp314-macosx_11_0_arm64.whl", hash = "sha256:79dcf9e477bc65414ebfea98ffd013cb39552b5ecd62908752e0e413d6d06e38", size = 43205, upload-time = "2025-10-06T14:50:54.911Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/02/68/6b086fef8a3f1a8541b9236c594f0c9245617c29841f2e0395d979485cde/multidict-6.7.0-cp314-cp314-manylinux1_i686.manylinux_2_28_i686.manylinux_2_5_i686.whl", hash = "sha256:31bae522710064b5cbeddaf2e9f32b1abab70ac6ac91d42572502299e9953128", size = 245084, upload-time = "2025-10-06T14:50:56.369Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/15/ee/f524093232007cd7a75c1d132df70f235cfd590a7c9eaccd7ff422ef4ae8/multidict-6.7.0-cp314-cp314-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:4a0df7ff02397bb63e2fd22af2c87dfa39e8c7f12947bc524dbdc528282c7e34", size = 252667, upload-time = "2025-10-06T14:50:57.991Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/02/a5/eeb3f43ab45878f1895118c3ef157a480db58ede3f248e29b5354139c2c9/multidict-6.7.0-cp314-cp314-manylinux2014_armv7l.manylinux_2_17_armv7l.manylinux_2_31_armv7l.whl", hash = "sha256:7a0222514e8e4c514660e182d5156a415c13ef0aabbd71682fc714e327b95e99", size = 233590, upload-time = "2025-10-06T14:50:59.589Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/6a/1e/76d02f8270b97269d7e3dbd45644b1785bda457b474315f8cf999525a193/multidict-6.7.0-cp314-cp314-manylinux2014_ppc64le.manylinux_2_17_ppc64le.manylinux_2_28_ppc64le.whl", hash = "sha256:2397ab4daaf2698eb51a76721e98db21ce4f52339e535725de03ea962b5a3202", size = 264112, upload-time = "2025-10-06T14:51:01.183Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/76/0b/c28a70ecb58963847c2a8efe334904cd254812b10e535aefb3bcce513918/multidict-6.7.0-cp314-cp314-manylinux2014_s390x.manylinux_2_17_s390x.manylinux_2_28_s390x.whl", hash = "sha256:8891681594162635948a636c9fe0ff21746aeb3dd5463f6e25d9bea3a8a39ca1", size = 261194, upload-time = "2025-10-06T14:51:02.794Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/b4/63/2ab26e4209773223159b83aa32721b4021ffb08102f8ac7d689c943fded1/multidict-6.7.0-cp314-cp314-manylinux2014_x86_64.manylinux_2_17_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:18706cc31dbf402a7945916dd5cddf160251b6dab8a2c5f3d6d5a55949f676b3", size = 248510, upload-time = "2025-10-06T14:51:04.724Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/93/cd/06c1fa8282af1d1c46fd55c10a7930af652afdce43999501d4d68664170c/multidict-6.7.0-cp314-cp314-musllinux_1_2_aarch64.whl", hash = "sha256:f844a1bbf1d207dd311a56f383f7eda2d0e134921d45751842d8235e7778965d", size = 248395, upload-time = "2025-10-06T14:51:06.306Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/99/ac/82cb419dd6b04ccf9e7e61befc00c77614fc8134362488b553402ecd55ce/multidict-6.7.0-cp314-cp314-musllinux_1_2_armv7l.whl", hash = "sha256:d4393e3581e84e5645506923816b9cc81f5609a778c7e7534054091acc64d1c6", size = 239520, upload-time = "2025-10-06T14:51:08.091Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/fa/f3/a0f9bf09493421bd8716a362e0cd1d244f5a6550f5beffdd6b47e885b331/multidict-6.7.0-cp314-cp314-musllinux_1_2_i686.whl", hash = "sha256:fbd18dc82d7bf274b37aa48d664534330af744e03bccf696d6f4c6042e7d19e7", size = 245479, upload-time = "2025-10-06T14:51:10.365Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/8d/01/476d38fc73a212843f43c852b0eee266b6971f0e28329c2184a8df90c376/multidict-6.7.0-cp314-cp314-musllinux_1_2_ppc64le.whl", hash = "sha256:b6234e14f9314731ec45c42fc4554b88133ad53a09092cc48a88e771c125dadb", size = 258903, upload-time = "2025-10-06T14:51:12.466Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/49/6d/23faeb0868adba613b817d0e69c5f15531b24d462af8012c4f6de4fa8dc3/multidict-6.7.0-cp314-cp314-musllinux_1_2_s390x.whl", hash = "sha256:08d4379f9744d8f78d98c8673c06e202ffa88296f009c71bbafe8a6bf847d01f", size = 252333, upload-time = "2025-10-06T14:51:14.48Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/1e/cc/48d02ac22b30fa247f7dad82866e4b1015431092f4ba6ebc7e77596e0b18/multidict-6.7.0-cp314-cp314-musllinux_1_2_x86_64.whl", hash = "sha256:9fe04da3f79387f450fd0061d4dd2e45a72749d31bf634aecc9e27f24fdc4b3f", size = 243411, upload-time = "2025-10-06T14:51:16.072Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/4a/03/29a8bf5a18abf1fe34535c88adbdfa88c9fb869b5a3b120692c64abe8284/multidict-6.7.0-cp314-cp314-win32.whl", hash = "sha256:fbafe31d191dfa7c4c51f7a6149c9fb7e914dcf9ffead27dcfd9f1ae382b3885", size = 40940, upload-time = "2025-10-06T14:51:17.544Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/82/16/7ed27b680791b939de138f906d5cf2b4657b0d45ca6f5dd6236fdddafb1a/multidict-6.7.0-cp314-cp314-win_amd64.whl", hash = "sha256:2f67396ec0310764b9222a1728ced1ab638f61aadc6226f17a71dd9324f9a99c", size = 45087, upload-time = "2025-10-06T14:51:18.875Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/cd/3c/e3e62eb35a1950292fe39315d3c89941e30a9d07d5d2df42965ab041da43/multidict-6.7.0-cp314-cp314-win_arm64.whl", hash = "sha256:ba672b26069957ee369cfa7fc180dde1fc6f176eaf1e6beaf61fbebbd3d9c000", size = 42368, upload-time = "2025-10-06T14:51:20.225Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/8b/40/cd499bd0dbc5f1136726db3153042a735fffd0d77268e2ee20d5f33c010f/multidict-6.7.0-cp314-cp314t-macosx_10_13_universal2.whl", hash = "sha256:c1dcc7524066fa918c6a27d61444d4ee7900ec635779058571f70d042d86ed63", size = 82326, upload-time = "2025-10-06T14:51:21.588Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/13/8a/18e031eca251c8df76daf0288e6790561806e439f5ce99a170b4af30676b/multidict-6.7.0-cp314-cp314t-macosx_10_13_x86_64.whl", hash = "sha256:27e0b36c2d388dc7b6ced3406671b401e84ad7eb0656b8f3a2f46ed0ce483718", size = 48065, upload-time = "2025-10-06T14:51:22.93Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/40/71/5e6701277470a87d234e433fb0a3a7deaf3bcd92566e421e7ae9776319de/multidict-6.7.0-cp314-cp314t-macosx_11_0_arm64.whl", hash = "sha256:2a7baa46a22e77f0988e3b23d4ede5513ebec1929e34ee9495be535662c0dfe2", size = 46475, upload-time = "2025-10-06T14:51:24.352Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/fe/6a/bab00cbab6d9cfb57afe1663318f72ec28289ea03fd4e8236bb78429893a/multidict-6.7.0-cp314-cp314t-manylinux1_i686.manylinux_2_28_i686.manylinux_2_5_i686.whl", hash = "sha256:7bf77f54997a9166a2f5675d1201520586439424c2511723a7312bdb4bcc034e", size = 239324, upload-time = "2025-10-06T14:51:25.822Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/2a/5f/8de95f629fc22a7769ade8b41028e3e5a822c1f8904f618d175945a81ad3/multidict-6.7.0-cp314-cp314t-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:e011555abada53f1578d63389610ac8a5400fc70ce71156b0aa30d326f1a5064", size = 246877, upload-time = "2025-10-06T14:51:27.604Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/23/b4/38881a960458f25b89e9f4a4fdcb02ac101cfa710190db6e5528841e67de/multidict-6.7.0-cp314-cp314t-manylinux2014_armv7l.manylinux_2_17_armv7l.manylinux_2_31_armv7l.whl", hash = "sha256:28b37063541b897fd6a318007373930a75ca6d6ac7c940dbe14731ffdd8d498e", size = 225824, upload-time = "2025-10-06T14:51:29.664Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/1e/39/6566210c83f8a261575f18e7144736059f0c460b362e96e9cf797a24b8e7/multidict-6.7.0-cp314-cp314t-manylinux2014_ppc64le.manylinux_2_17_ppc64le.manylinux_2_28_ppc64le.whl", hash = "sha256:05047ada7a2fde2631a0ed706f1fd68b169a681dfe5e4cf0f8e4cb6618bbc2cd", size = 253558, upload-time = "2025-10-06T14:51:31.684Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/00/a3/67f18315100f64c269f46e6c0319fa87ba68f0f64f2b8e7fd7c72b913a0b/multidict-6.7.0-cp314-cp314t-manylinux2014_s390x.manylinux_2_17_s390x.manylinux_2_28_s390x.whl", hash = "sha256:716133f7d1d946a4e1b91b1756b23c088881e70ff180c24e864c26192ad7534a", size = 252339, upload-time = "2025-10-06T14:51:33.699Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/c8/2a/1cb77266afee2458d82f50da41beba02159b1d6b1f7973afc9a1cad1499b/multidict-6.7.0-cp314-cp314t-manylinux2014_x86_64.manylinux_2_17_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:d1bed1b467ef657f2a0ae62844a607909ef1c6889562de5e1d505f74457d0b96", size = 244895, upload-time = "2025-10-06T14:51:36.189Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/dd/72/09fa7dd487f119b2eb9524946ddd36e2067c08510576d43ff68469563b3b/multidict-6.7.0-cp314-cp314t-musllinux_1_2_aarch64.whl", hash = "sha256:ca43bdfa5d37bd6aee89d85e1d0831fb86e25541be7e9d376ead1b28974f8e5e", size = 241862, upload-time = "2025-10-06T14:51:41.291Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/65/92/bc1f8bd0853d8669300f732c801974dfc3702c3eeadae2f60cef54dc69d7/multidict-6.7.0-cp314-cp314t-musllinux_1_2_armv7l.whl", hash = "sha256:44b546bd3eb645fd26fb949e43c02a25a2e632e2ca21a35e2e132c8105dc8599", size = 232376, upload-time = "2025-10-06T14:51:43.55Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/09/86/ac39399e5cb9d0c2ac8ef6e10a768e4d3bc933ac808d49c41f9dc23337eb/multidict-6.7.0-cp314-cp314t-musllinux_1_2_i686.whl", hash = "sha256:a6ef16328011d3f468e7ebc326f24c1445f001ca1dec335b2f8e66bed3006394", size = 240272, upload-time = "2025-10-06T14:51:45.265Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/3d/b6/fed5ac6b8563ec72df6cb1ea8dac6d17f0a4a1f65045f66b6d3bf1497c02/multidict-6.7.0-cp314-cp314t-musllinux_1_2_ppc64le.whl", hash = "sha256:5aa873cbc8e593d361ae65c68f85faadd755c3295ea2c12040ee146802f23b38", size = 248774, upload-time = "2025-10-06T14:51:46.836Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/6b/8d/b954d8c0dc132b68f760aefd45870978deec6818897389dace00fcde32ff/multidict-6.7.0-cp314-cp314t-musllinux_1_2_s390x.whl", hash = "sha256:3d7b6ccce016e29df4b7ca819659f516f0bc7a4b3efa3bb2012ba06431b044f9", size = 242731, upload-time = "2025-10-06T14:51:48.541Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/16/9d/a2dac7009125d3540c2f54e194829ea18ac53716c61b655d8ed300120b0f/multidict-6.7.0-cp314-cp314t-musllinux_1_2_x86_64.whl", hash = "sha256:171b73bd4ee683d307599b66793ac80981b06f069b62eea1c9e29c9241aa66b0", size = 240193, upload-time = "2025-10-06T14:51:50.355Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/39/ca/c05f144128ea232ae2178b008d5011d4e2cea86e4ee8c85c2631b1b94802/multidict-6.7.0-cp314-cp314t-win32.whl", hash = "sha256:b2d7f80c4e1fd010b07cb26820aae86b7e73b681ee4889684fb8d2d4537aab13", size = 48023, upload-time = "2025-10-06T14:51:51.883Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/ba/8f/0a60e501584145588be1af5cc829265701ba3c35a64aec8e07cbb71d39bb/multidict-6.7.0-cp314-cp314t-win_amd64.whl", hash = "sha256:09929cab6fcb68122776d575e03c6cc64ee0b8fca48d17e135474b042ce515cd", size = 53507, upload-time = "2025-10-06T14:51:53.672Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/7f/ae/3148b988a9c6239903e786eac19c889fab607c31d6efa7fb2147e5680f23/multidict-6.7.0-cp314-cp314t-win_arm64.whl", hash = "sha256:cc41db090ed742f32bd2d2c721861725e6109681eddf835d0a82bd3a5c382827", size = 44804, upload-time = "2025-10-06T14:51:55.415Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/b7/da/7d22601b625e241d4f23ef1ebff8acfc60da633c9e7e7922e24d10f592b3/multidict-6.7.0-py3-none-any.whl", hash = "sha256:394fc5c42a333c9ffc3e421a4c85e08580d990e08b99f6bf35b4132114c5dcb3", size = 12317, upload-time = "2025-10-06T14:52:29.272Z" },
|
||||
]
|
||||
|
||||
|
|
@ -801,6 +929,28 @@ wheels = [
|
|||
{ url = "https://files.pythonhosted.org/packages/80/e9/aff53abbdd41b0ecca94285f325aff42357c6b5abc482a3fcb4994290b18/numpy-2.3.5-cp313-cp313t-win32.whl", hash = "sha256:70b37199913c1bd300ff6e2693316c6f869c7ee16378faf10e4f5e3275b299c3", size = 6405940, upload-time = "2025-11-16T22:51:11.541Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/d5/81/50613fec9d4de5480de18d4f8ef59ad7e344d497edbef3cfd80f24f98461/numpy-2.3.5-cp313-cp313t-win_amd64.whl", hash = "sha256:b501b5fa195cc9e24fe102f21ec0a44dffc231d2af79950b451e0d99cea02234", size = 12920341, upload-time = "2025-11-16T22:51:14.312Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/bb/ab/08fd63b9a74303947f34f0bd7c5903b9c5532c2d287bead5bdf4c556c486/numpy-2.3.5-cp313-cp313t-win_arm64.whl", hash = "sha256:a80afd79f45f3c4a7d341f13acbe058d1ca8ac017c165d3fa0d3de6bc1a079d7", size = 10262507, upload-time = "2025-11-16T22:51:16.846Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/ba/97/1a914559c19e32d6b2e233cf9a6a114e67c856d35b1d6babca571a3e880f/numpy-2.3.5-cp314-cp314-macosx_10_15_x86_64.whl", hash = "sha256:bf06bc2af43fa8d32d30fae16ad965663e966b1a3202ed407b84c989c3221e82", size = 16735706, upload-time = "2025-11-16T22:51:19.558Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/57/d4/51233b1c1b13ecd796311216ae417796b88b0616cfd8a33ae4536330748a/numpy-2.3.5-cp314-cp314-macosx_11_0_arm64.whl", hash = "sha256:052e8c42e0c49d2575621c158934920524f6c5da05a1d3b9bab5d8e259e045f0", size = 12264507, upload-time = "2025-11-16T22:51:22.492Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/45/98/2fe46c5c2675b8306d0b4a3ec3494273e93e1226a490f766e84298576956/numpy-2.3.5-cp314-cp314-macosx_14_0_arm64.whl", hash = "sha256:1ed1ec893cff7040a02c8aa1c8611b94d395590d553f6b53629a4461dc7f7b63", size = 5093049, upload-time = "2025-11-16T22:51:25.171Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/ce/0e/0698378989bb0ac5f1660c81c78ab1fe5476c1a521ca9ee9d0710ce54099/numpy-2.3.5-cp314-cp314-macosx_14_0_x86_64.whl", hash = "sha256:2dcd0808a421a482a080f89859a18beb0b3d1e905b81e617a188bd80422d62e9", size = 6626603, upload-time = "2025-11-16T22:51:27Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/5e/a6/9ca0eecc489640615642a6cbc0ca9e10df70df38c4d43f5a928ff18d8827/numpy-2.3.5-cp314-cp314-manylinux_2_27_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:727fd05b57df37dc0bcf1a27767a3d9a78cbbc92822445f32cc3436ba797337b", size = 14262696, upload-time = "2025-11-16T22:51:29.402Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/c8/f6/07ec185b90ec9d7217a00eeeed7383b73d7e709dae2a9a021b051542a708/numpy-2.3.5-cp314-cp314-manylinux_2_27_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:fffe29a1ef00883599d1dc2c51aa2e5d80afe49523c261a74933df395c15c520", size = 16597350, upload-time = "2025-11-16T22:51:32.167Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/75/37/164071d1dde6a1a84c9b8e5b414fa127981bad47adf3a6b7e23917e52190/numpy-2.3.5-cp314-cp314-musllinux_1_2_aarch64.whl", hash = "sha256:8f7f0e05112916223d3f438f293abf0727e1181b5983f413dfa2fefc4098245c", size = 16040190, upload-time = "2025-11-16T22:51:35.403Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/08/3c/f18b82a406b04859eb026d204e4e1773eb41c5be58410f41ffa511d114ae/numpy-2.3.5-cp314-cp314-musllinux_1_2_x86_64.whl", hash = "sha256:2e2eb32ddb9ccb817d620ac1d8dae7c3f641c1e5f55f531a33e8ab97960a75b8", size = 18536749, upload-time = "2025-11-16T22:51:39.698Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/40/79/f82f572bf44cf0023a2fe8588768e23e1592585020d638999f15158609e1/numpy-2.3.5-cp314-cp314-win32.whl", hash = "sha256:66f85ce62c70b843bab1fb14a05d5737741e74e28c7b8b5a064de10142fad248", size = 6335432, upload-time = "2025-11-16T22:51:42.476Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/a3/2e/235b4d96619931192c91660805e5e49242389742a7a82c27665021db690c/numpy-2.3.5-cp314-cp314-win_amd64.whl", hash = "sha256:e6a0bc88393d65807d751a614207b7129a310ca4fe76a74e5c7da5fa5671417e", size = 12919388, upload-time = "2025-11-16T22:51:45.275Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/07/2b/29fd75ce45d22a39c61aad74f3d718e7ab67ccf839ca8b60866054eb15f8/numpy-2.3.5-cp314-cp314-win_arm64.whl", hash = "sha256:aeffcab3d4b43712bb7a60b65f6044d444e75e563ff6180af8f98dd4b905dfd2", size = 10476651, upload-time = "2025-11-16T22:51:47.749Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/17/e1/f6a721234ebd4d87084cfa68d081bcba2f5cfe1974f7de4e0e8b9b2a2ba1/numpy-2.3.5-cp314-cp314t-macosx_10_15_x86_64.whl", hash = "sha256:17531366a2e3a9e30762c000f2c43a9aaa05728712e25c11ce1dbe700c53ad41", size = 16834503, upload-time = "2025-11-16T22:51:50.443Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/5c/1c/baf7ffdc3af9c356e1c135e57ab7cf8d247931b9554f55c467efe2c69eff/numpy-2.3.5-cp314-cp314t-macosx_11_0_arm64.whl", hash = "sha256:d21644de1b609825ede2f48be98dfde4656aefc713654eeee280e37cadc4e0ad", size = 12381612, upload-time = "2025-11-16T22:51:53.609Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/74/91/f7f0295151407ddc9ba34e699013c32c3c91944f9b35fcf9281163dc1468/numpy-2.3.5-cp314-cp314t-macosx_14_0_arm64.whl", hash = "sha256:c804e3a5aba5460c73955c955bdbd5c08c354954e9270a2c1565f62e866bdc39", size = 5210042, upload-time = "2025-11-16T22:51:56.213Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/2e/3b/78aebf345104ec50dd50a4d06ddeb46a9ff5261c33bcc58b1c4f12f85ec2/numpy-2.3.5-cp314-cp314t-macosx_14_0_x86_64.whl", hash = "sha256:cc0a57f895b96ec78969c34f682c602bf8da1a0270b09bc65673df2e7638ec20", size = 6724502, upload-time = "2025-11-16T22:51:58.584Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/02/c6/7c34b528740512e57ef1b7c8337ab0b4f0bddf34c723b8996c675bc2bc91/numpy-2.3.5-cp314-cp314t-manylinux_2_27_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:900218e456384ea676e24ea6a0417f030a3b07306d29d7ad843957b40a9d8d52", size = 14308962, upload-time = "2025-11-16T22:52:01.698Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/80/35/09d433c5262bc32d725bafc619e095b6a6651caf94027a03da624146f655/numpy-2.3.5-cp314-cp314t-manylinux_2_27_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:09a1bea522b25109bf8e6f3027bd810f7c1085c64a0c7ce050c1676ad0ba010b", size = 16655054, upload-time = "2025-11-16T22:52:04.267Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/7a/ab/6a7b259703c09a88804fa2430b43d6457b692378f6b74b356155283566ac/numpy-2.3.5-cp314-cp314t-musllinux_1_2_aarch64.whl", hash = "sha256:04822c00b5fd0323c8166d66c701dc31b7fbd252c100acd708c48f763968d6a3", size = 16091613, upload-time = "2025-11-16T22:52:08.651Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/c2/88/330da2071e8771e60d1038166ff9d73f29da37b01ec3eb43cb1427464e10/numpy-2.3.5-cp314-cp314t-musllinux_1_2_x86_64.whl", hash = "sha256:d6889ec4ec662a1a37eb4b4fb26b6100841804dac55bd9df579e326cdc146227", size = 18591147, upload-time = "2025-11-16T22:52:11.453Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/51/41/851c4b4082402d9ea860c3626db5d5df47164a712cb23b54be028b184c1c/numpy-2.3.5-cp314-cp314t-win32.whl", hash = "sha256:93eebbcf1aafdf7e2ddd44c2923e2672e1010bddc014138b229e49725b4d6be5", size = 6479806, upload-time = "2025-11-16T22:52:14.641Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/90/30/d48bde1dfd93332fa557cff1972fbc039e055a52021fbef4c2c4b1eefd17/numpy-2.3.5-cp314-cp314t-win_amd64.whl", hash = "sha256:c8a9958e88b65c3b27e22ca2a076311636850b612d6bbfb76e8d156aacde2aaf", size = 13105760, upload-time = "2025-11-16T22:52:17.975Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/2d/fd/4b5eb0b3e888d86aee4d198c23acec7d214baaf17ea93c1adec94c9518b9/numpy-2.3.5-cp314-cp314t-win_arm64.whl", hash = "sha256:6203fdf9f3dc5bdaed7319ad8698e685c7a3be10819f41d32a0723e611733b42", size = 10545459, upload-time = "2025-11-16T22:52:20.55Z" },
|
||||
]
|
||||
|
||||
[[package]]
|
||||
|
|
@ -868,6 +1018,22 @@ wheels = [
|
|||
{ url = "https://files.pythonhosted.org/packages/55/db/2570bc40fb13aaed1cbc3fbd725c3a60ee162477982123c3adc8971e7ac1/pandas-3.0.0-cp313-cp313t-musllinux_1_2_aarch64.whl", hash = "sha256:66f72fb172959af42a459e27a8d8d2c7e311ff4c1f7db6deb3b643dbc382ae08", size = 11323737, upload-time = "2026-01-21T15:51:20.784Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/bc/2e/297ac7f21c8181b62a4cccebad0a70caf679adf3ae5e83cb676194c8acc3/pandas-3.0.0-cp313-cp313t-musllinux_1_2_x86_64.whl", hash = "sha256:4a4a400ca18230976724a5066f20878af785f36c6756e498e94c2a5e5d57779c", size = 11771558, upload-time = "2026-01-21T15:51:22.977Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/0a/46/e1c6876d71c14332be70239acce9ad435975a80541086e5ffba2f249bcf6/pandas-3.0.0-cp313-cp313t-win_amd64.whl", hash = "sha256:940eebffe55528074341a5a36515f3e4c5e25e958ebbc764c9502cfc35ba3faa", size = 10473771, upload-time = "2026-01-21T15:51:25.285Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/c0/db/0270ad9d13c344b7a36fa77f5f8344a46501abf413803e885d22864d10bf/pandas-3.0.0-cp314-cp314-macosx_10_15_x86_64.whl", hash = "sha256:597c08fb9fef0edf1e4fa2f9828dd27f3d78f9b8c9b4a748d435ffc55732310b", size = 10312075, upload-time = "2026-01-21T15:51:28.5Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/09/9f/c176f5e9717f7c91becfe0f55a52ae445d3f7326b4a2cf355978c51b7913/pandas-3.0.0-cp314-cp314-macosx_11_0_arm64.whl", hash = "sha256:447b2d68ac5edcbf94655fe909113a6dba6ef09ad7f9f60c80477825b6c489fe", size = 9900213, upload-time = "2026-01-21T15:51:30.955Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/d9/e7/63ad4cc10b257b143e0a5ebb04304ad806b4e1a61c5da25f55896d2ca0f4/pandas-3.0.0-cp314-cp314-manylinux_2_24_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:debb95c77ff3ed3ba0d9aa20c3a2f19165cc7956362f9873fce1ba0a53819d70", size = 10428768, upload-time = "2026-01-21T15:51:33.018Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/9e/0e/4e4c2d8210f20149fd2248ef3fff26623604922bd564d915f935a06dd63d/pandas-3.0.0-cp314-cp314-manylinux_2_24_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:fedabf175e7cd82b69b74c30adbaa616de301291a5231138d7242596fc296a8d", size = 10882954, upload-time = "2026-01-21T15:51:35.287Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/c6/60/c9de8ac906ba1f4d2250f8a951abe5135b404227a55858a75ad26f84db47/pandas-3.0.0-cp314-cp314-musllinux_1_2_aarch64.whl", hash = "sha256:412d1a89aab46889f3033a386912efcdfa0f1131c5705ff5b668dda88305e986", size = 11430293, upload-time = "2026-01-21T15:51:37.57Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/a1/69/806e6637c70920e5787a6d6896fd707f8134c2c55cd761e7249a97b7dc5a/pandas-3.0.0-cp314-cp314-musllinux_1_2_x86_64.whl", hash = "sha256:e979d22316f9350c516479dd3a92252be2937a9531ed3a26ec324198a99cdd49", size = 11952452, upload-time = "2026-01-21T15:51:39.618Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/cb/de/918621e46af55164c400ab0ef389c9d969ab85a43d59ad1207d4ddbe30a5/pandas-3.0.0-cp314-cp314-win_amd64.whl", hash = "sha256:083b11415b9970b6e7888800c43c82e81a06cd6b06755d84804444f0007d6bb7", size = 9851081, upload-time = "2026-01-21T15:51:41.758Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/91/a1/3562a18dd0bd8c73344bfa26ff90c53c72f827df119d6d6b1dacc84d13e3/pandas-3.0.0-cp314-cp314-win_arm64.whl", hash = "sha256:5db1e62cb99e739fa78a28047e861b256d17f88463c76b8dafc7c1338086dca8", size = 9174610, upload-time = "2026-01-21T15:51:44.312Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/ce/26/430d91257eaf366f1737d7a1c158677caaf6267f338ec74e3a1ec444111c/pandas-3.0.0-cp314-cp314t-macosx_10_15_x86_64.whl", hash = "sha256:697b8f7d346c68274b1b93a170a70974cdc7d7354429894d5927c1effdcccd73", size = 10761999, upload-time = "2026-01-21T15:51:46.899Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/ec/1a/954eb47736c2b7f7fe6a9d56b0cb6987773c00faa3c6451a43db4beb3254/pandas-3.0.0-cp314-cp314t-macosx_11_0_arm64.whl", hash = "sha256:8cb3120f0d9467ed95e77f67a75e030b67545bcfa08964e349252d674171def2", size = 10410279, upload-time = "2026-01-21T15:51:48.89Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/20/fc/b96f3a5a28b250cd1b366eb0108df2501c0f38314a00847242abab71bb3a/pandas-3.0.0-cp314-cp314t-manylinux_2_24_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:33fd3e6baa72899746b820c31e4b9688c8e1b7864d7aec2de7ab5035c285277a", size = 10330198, upload-time = "2026-01-21T15:51:51.015Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/90/b3/d0e2952f103b4fbef1ef22d0c2e314e74fc9064b51cee30890b5e3286ee6/pandas-3.0.0-cp314-cp314t-manylinux_2_24_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:a8942e333dc67ceda1095227ad0febb05a3b36535e520154085db632c40ad084", size = 10728513, upload-time = "2026-01-21T15:51:53.387Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/76/81/832894f286df828993dc5fd61c63b231b0fb73377e99f6c6c369174cf97e/pandas-3.0.0-cp314-cp314t-musllinux_1_2_aarch64.whl", hash = "sha256:783ac35c4d0fe0effdb0d67161859078618b1b6587a1af15928137525217a721", size = 11345550, upload-time = "2026-01-21T15:51:55.329Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/34/a0/ed160a00fb4f37d806406bc0a79a8b62fe67f29d00950f8d16203ff3409b/pandas-3.0.0-cp314-cp314t-musllinux_1_2_x86_64.whl", hash = "sha256:125eb901e233f155b268bbef9abd9afb5819db74f0e677e89a61b246228c71ac", size = 11799386, upload-time = "2026-01-21T15:51:57.457Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/36/c8/2ac00d7255252c5e3cf61b35ca92ca25704b0188f7454ca4aec08a33cece/pandas-3.0.0-cp314-cp314t-win_amd64.whl", hash = "sha256:b86d113b6c109df3ce0ad5abbc259fe86a1bd4adfd4a31a89da42f84f65509bb", size = 10873041, upload-time = "2026-01-21T15:52:00.034Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/e6/3f/a80ac00acbc6b35166b42850e98a4f466e2c0d9c64054161ba9620f95680/pandas-3.0.0-cp314-cp314t-win_arm64.whl", hash = "sha256:1c39eab3ad38f2d7a249095f0a3d8f8c22cc0f847e98ccf5bbe732b272e2d9fa", size = 9441003, upload-time = "2026-01-21T15:52:02.281Z" },
|
||||
]
|
||||
|
||||
[[package]]
|
||||
|
|
@ -1034,7 +1200,7 @@ requires-dist = [
|
|||
{ name = "tomli", specifier = ">=2.0.1,<3.0.0" },
|
||||
{ name = "tomli-w", specifier = ">=1.0.0,<2.0.0" },
|
||||
{ name = "tomlkit", git = "https://github.com/pikers/tomlkit.git?branch=piker_pin" },
|
||||
{ name = "tractor", git = "https://github.com/goodboy/tractor.git?branch=main" },
|
||||
{ name = "tractor", git = "https://github.com/goodboy/tractor.git?branch=piker_pin" },
|
||||
{ name = "trio", specifier = ">=0.27" },
|
||||
{ name = "trio-typing", specifier = ">=0.10.0" },
|
||||
{ name = "trio-util", specifier = ">=0.7.0,<0.8.0" },
|
||||
|
|
@ -1055,7 +1221,7 @@ dev = [
|
|||
{ name = "prompt-toolkit", specifier = "==3.0.40" },
|
||||
{ name = "pyperclip", specifier = ">=1.9.0" },
|
||||
{ name = "pyqt6", specifier = ">=6.7.0,<7.0.0" },
|
||||
{ name = "pyqtgraph", git = "https://github.com/pikers/pyqtgraph.git" },
|
||||
{ name = "pyqtgraph", specifier = ">=0.14.0" },
|
||||
{ name = "pytest" },
|
||||
{ name = "qdarkstyle", specifier = ">=3.0.2,<4.0.0" },
|
||||
{ name = "rapidfuzz", specifier = ">=3.2.0,<4.0.0" },
|
||||
|
|
@ -1073,7 +1239,7 @@ repl = [
|
|||
testing = [{ name = "pytest" }]
|
||||
uis = [
|
||||
{ name = "pyqt6", specifier = ">=6.7.0,<7.0.0" },
|
||||
{ name = "pyqtgraph", git = "https://github.com/pikers/pyqtgraph.git" },
|
||||
{ name = "pyqtgraph", specifier = ">=0.14.0" },
|
||||
{ name = "qdarkstyle", specifier = ">=3.0.2,<4.0.0" },
|
||||
{ name = "rapidfuzz", specifier = ">=3.2.0,<4.0.0" },
|
||||
]
|
||||
|
|
@ -1201,6 +1367,36 @@ wheels = [
|
|||
{ url = "https://files.pythonhosted.org/packages/92/f7/1d4ec5841505f423469efbfc381d64b7b467438cd5a4bbcbb063f3b73d27/propcache-0.4.1-cp313-cp313t-win32.whl", hash = "sha256:2ad890caa1d928c7c2965b48f3a3815c853180831d0e5503d35cf00c472f4717", size = 41396, upload-time = "2025-10-08T19:47:47.202Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/48/f0/615c30622316496d2cbbc29f5985f7777d3ada70f23370608c1d3e081c1f/propcache-0.4.1-cp313-cp313t-win_amd64.whl", hash = "sha256:f7ee0e597f495cf415bcbd3da3caa3bd7e816b74d0d52b8145954c5e6fd3ff37", size = 44897, upload-time = "2025-10-08T19:47:48.336Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/fd/ca/6002e46eccbe0e33dcd4069ef32f7f1c9e243736e07adca37ae8c4830ec3/propcache-0.4.1-cp313-cp313t-win_arm64.whl", hash = "sha256:929d7cbe1f01bb7baffb33dc14eb5691c95831450a26354cd210a8155170c93a", size = 39789, upload-time = "2025-10-08T19:47:49.876Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/8e/5c/bca52d654a896f831b8256683457ceddd490ec18d9ec50e97dfd8fc726a8/propcache-0.4.1-cp314-cp314-macosx_10_13_universal2.whl", hash = "sha256:3f7124c9d820ba5548d431afb4632301acf965db49e666aa21c305cbe8c6de12", size = 78152, upload-time = "2025-10-08T19:47:51.051Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/65/9b/03b04e7d82a5f54fb16113d839f5ea1ede58a61e90edf515f6577c66fa8f/propcache-0.4.1-cp314-cp314-macosx_10_13_x86_64.whl", hash = "sha256:c0d4b719b7da33599dfe3b22d3db1ef789210a0597bc650b7cee9c77c2be8c5c", size = 44869, upload-time = "2025-10-08T19:47:52.594Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/b2/fa/89a8ef0468d5833a23fff277b143d0573897cf75bd56670a6d28126c7d68/propcache-0.4.1-cp314-cp314-macosx_11_0_arm64.whl", hash = "sha256:9f302f4783709a78240ebc311b793f123328716a60911d667e0c036bc5dcbded", size = 46596, upload-time = "2025-10-08T19:47:54.073Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/86/bd/47816020d337f4a746edc42fe8d53669965138f39ee117414c7d7a340cfe/propcache-0.4.1-cp314-cp314-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:c80ee5802e3fb9ea37938e7eecc307fb984837091d5fd262bb37238b1ae97641", size = 206981, upload-time = "2025-10-08T19:47:55.715Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/df/f6/c5fa1357cc9748510ee55f37173eb31bfde6d94e98ccd9e6f033f2fc06e1/propcache-0.4.1-cp314-cp314-manylinux2014_ppc64le.manylinux_2_17_ppc64le.manylinux_2_28_ppc64le.whl", hash = "sha256:ed5a841e8bb29a55fb8159ed526b26adc5bdd7e8bd7bf793ce647cb08656cdf4", size = 211490, upload-time = "2025-10-08T19:47:57.499Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/80/1e/e5889652a7c4a3846683401a48f0f2e5083ce0ec1a8a5221d8058fbd1adf/propcache-0.4.1-cp314-cp314-manylinux2014_s390x.manylinux_2_17_s390x.manylinux_2_28_s390x.whl", hash = "sha256:55c72fd6ea2da4c318e74ffdf93c4fe4e926051133657459131a95c846d16d44", size = 215371, upload-time = "2025-10-08T19:47:59.317Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/b2/f2/889ad4b2408f72fe1a4f6a19491177b30ea7bf1a0fd5f17050ca08cfc882/propcache-0.4.1-cp314-cp314-manylinux2014_x86_64.manylinux_2_17_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:8326e144341460402713f91df60ade3c999d601e7eb5ff8f6f7862d54de0610d", size = 201424, upload-time = "2025-10-08T19:48:00.67Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/27/73/033d63069b57b0812c8bd19f311faebeceb6ba31b8f32b73432d12a0b826/propcache-0.4.1-cp314-cp314-musllinux_1_2_aarch64.whl", hash = "sha256:060b16ae65bc098da7f6d25bf359f1f31f688384858204fe5d652979e0015e5b", size = 197566, upload-time = "2025-10-08T19:48:02.604Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/dc/89/ce24f3dc182630b4e07aa6d15f0ff4b14ed4b9955fae95a0b54c58d66c05/propcache-0.4.1-cp314-cp314-musllinux_1_2_armv7l.whl", hash = "sha256:89eb3fa9524f7bec9de6e83cf3faed9d79bffa560672c118a96a171a6f55831e", size = 193130, upload-time = "2025-10-08T19:48:04.499Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/a9/24/ef0d5fd1a811fb5c609278d0209c9f10c35f20581fcc16f818da959fc5b4/propcache-0.4.1-cp314-cp314-musllinux_1_2_ppc64le.whl", hash = "sha256:dee69d7015dc235f526fe80a9c90d65eb0039103fe565776250881731f06349f", size = 202625, upload-time = "2025-10-08T19:48:06.213Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/f5/02/98ec20ff5546f68d673df2f7a69e8c0d076b5abd05ca882dc7ee3a83653d/propcache-0.4.1-cp314-cp314-musllinux_1_2_s390x.whl", hash = "sha256:5558992a00dfd54ccbc64a32726a3357ec93825a418a401f5cc67df0ac5d9e49", size = 204209, upload-time = "2025-10-08T19:48:08.432Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/a0/87/492694f76759b15f0467a2a93ab68d32859672b646aa8a04ce4864e7932d/propcache-0.4.1-cp314-cp314-musllinux_1_2_x86_64.whl", hash = "sha256:c9b822a577f560fbd9554812526831712c1436d2c046cedee4c3796d3543b144", size = 197797, upload-time = "2025-10-08T19:48:09.968Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/ee/36/66367de3575db1d2d3f3d177432bd14ee577a39d3f5d1b3d5df8afe3b6e2/propcache-0.4.1-cp314-cp314-win32.whl", hash = "sha256:ab4c29b49d560fe48b696cdcb127dd36e0bc2472548f3bf56cc5cb3da2b2984f", size = 38140, upload-time = "2025-10-08T19:48:11.232Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/0c/2a/a758b47de253636e1b8aef181c0b4f4f204bf0dd964914fb2af90a95b49b/propcache-0.4.1-cp314-cp314-win_amd64.whl", hash = "sha256:5a103c3eb905fcea0ab98be99c3a9a5ab2de60228aa5aceedc614c0281cf6153", size = 41257, upload-time = "2025-10-08T19:48:12.707Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/34/5e/63bd5896c3fec12edcbd6f12508d4890d23c265df28c74b175e1ef9f4f3b/propcache-0.4.1-cp314-cp314-win_arm64.whl", hash = "sha256:74c1fb26515153e482e00177a1ad654721bf9207da8a494a0c05e797ad27b992", size = 38097, upload-time = "2025-10-08T19:48:13.923Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/99/85/9ff785d787ccf9bbb3f3106f79884a130951436f58392000231b4c737c80/propcache-0.4.1-cp314-cp314t-macosx_10_13_universal2.whl", hash = "sha256:824e908bce90fb2743bd6b59db36eb4f45cd350a39637c9f73b1c1ea66f5b75f", size = 81455, upload-time = "2025-10-08T19:48:15.16Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/90/85/2431c10c8e7ddb1445c1f7c4b54d886e8ad20e3c6307e7218f05922cad67/propcache-0.4.1-cp314-cp314t-macosx_10_13_x86_64.whl", hash = "sha256:c2b5e7db5328427c57c8e8831abda175421b709672f6cfc3d630c3b7e2146393", size = 46372, upload-time = "2025-10-08T19:48:16.424Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/01/20/b0972d902472da9bcb683fa595099911f4d2e86e5683bcc45de60dd05dc3/propcache-0.4.1-cp314-cp314t-macosx_11_0_arm64.whl", hash = "sha256:6f6ff873ed40292cd4969ef5310179afd5db59fdf055897e282485043fc80ad0", size = 48411, upload-time = "2025-10-08T19:48:17.577Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/e2/e3/7dc89f4f21e8f99bad3d5ddb3a3389afcf9da4ac69e3deb2dcdc96e74169/propcache-0.4.1-cp314-cp314t-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:49a2dc67c154db2c1463013594c458881a069fcf98940e61a0569016a583020a", size = 275712, upload-time = "2025-10-08T19:48:18.901Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/20/67/89800c8352489b21a8047c773067644e3897f02ecbbd610f4d46b7f08612/propcache-0.4.1-cp314-cp314t-manylinux2014_ppc64le.manylinux_2_17_ppc64le.manylinux_2_28_ppc64le.whl", hash = "sha256:005f08e6a0529984491e37d8dbc3dd86f84bd78a8ceb5fa9a021f4c48d4984be", size = 273557, upload-time = "2025-10-08T19:48:20.762Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/e2/a1/b52b055c766a54ce6d9c16d9aca0cad8059acd9637cdf8aa0222f4a026ef/propcache-0.4.1-cp314-cp314t-manylinux2014_s390x.manylinux_2_17_s390x.manylinux_2_28_s390x.whl", hash = "sha256:5c3310452e0d31390da9035c348633b43d7e7feb2e37be252be6da45abd1abcc", size = 280015, upload-time = "2025-10-08T19:48:22.592Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/48/c8/33cee30bd890672c63743049f3c9e4be087e6780906bfc3ec58528be59c1/propcache-0.4.1-cp314-cp314t-manylinux2014_x86_64.manylinux_2_17_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:4c3c70630930447f9ef1caac7728c8ad1c56bc5015338b20fed0d08ea2480b3a", size = 262880, upload-time = "2025-10-08T19:48:23.947Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/0c/b1/8f08a143b204b418285c88b83d00edbd61afbc2c6415ffafc8905da7038b/propcache-0.4.1-cp314-cp314t-musllinux_1_2_aarch64.whl", hash = "sha256:8e57061305815dfc910a3634dcf584f08168a8836e6999983569f51a8544cd89", size = 260938, upload-time = "2025-10-08T19:48:25.656Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/cf/12/96e4664c82ca2f31e1c8dff86afb867348979eb78d3cb8546a680287a1e9/propcache-0.4.1-cp314-cp314t-musllinux_1_2_armv7l.whl", hash = "sha256:521a463429ef54143092c11a77e04056dd00636f72e8c45b70aaa3140d639726", size = 247641, upload-time = "2025-10-08T19:48:27.207Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/18/ed/e7a9cfca28133386ba52278136d42209d3125db08d0a6395f0cba0c0285c/propcache-0.4.1-cp314-cp314t-musllinux_1_2_ppc64le.whl", hash = "sha256:120c964da3fdc75e3731aa392527136d4ad35868cc556fd09bb6d09172d9a367", size = 262510, upload-time = "2025-10-08T19:48:28.65Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/f5/76/16d8bf65e8845dd62b4e2b57444ab81f07f40caa5652b8969b87ddcf2ef6/propcache-0.4.1-cp314-cp314t-musllinux_1_2_s390x.whl", hash = "sha256:d8f353eb14ee3441ee844ade4277d560cdd68288838673273b978e3d6d2c8f36", size = 263161, upload-time = "2025-10-08T19:48:30.133Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/e7/70/c99e9edb5d91d5ad8a49fa3c1e8285ba64f1476782fed10ab251ff413ba1/propcache-0.4.1-cp314-cp314t-musllinux_1_2_x86_64.whl", hash = "sha256:ab2943be7c652f09638800905ee1bab2c544e537edb57d527997a24c13dc1455", size = 257393, upload-time = "2025-10-08T19:48:31.567Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/08/02/87b25304249a35c0915d236575bc3574a323f60b47939a2262b77632a3ee/propcache-0.4.1-cp314-cp314t-win32.whl", hash = "sha256:05674a162469f31358c30bcaa8883cb7829fa3110bf9c0991fe27d7896c42d85", size = 42546, upload-time = "2025-10-08T19:48:32.872Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/cb/ef/3c6ecf8b317aa982f309835e8f96987466123c6e596646d4e6a1dfcd080f/propcache-0.4.1-cp314-cp314t-win_amd64.whl", hash = "sha256:990f6b3e2a27d683cb7602ed6c86f15ee6b43b1194736f9baaeb93d0016633b1", size = 46259, upload-time = "2025-10-08T19:48:34.226Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/c4/2d/346e946d4951f37eca1e4f55be0f0174c52cd70720f84029b02f296f4a38/propcache-0.4.1-cp314-cp314t-win_arm64.whl", hash = "sha256:ecef2343af4cc68e05131e45024ba34f6095821988a9d0a02aa7c73fcc448aa9", size = 40428, upload-time = "2025-10-08T19:48:35.441Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/5b/5a/bc7b4a4ef808fa59a816c17b20c4bef6884daebbdf627ff2a161da67da19/propcache-0.4.1-py3-none-any.whl", hash = "sha256:af2a6052aeb6cf17d3e46ee169099044fd8224cbaf75c76a2ef596e8163e2237", size = 13305, upload-time = "2025-10-08T19:49:00.792Z" },
|
||||
]
|
||||
|
||||
|
|
@ -1240,6 +1436,20 @@ wheels = [
|
|||
{ url = "https://files.pythonhosted.org/packages/b9/f0/77aa5198fd3943682b2e4faaf179a674f0edea0d55d326d83cb2277d9363/pyarrow-22.0.0-cp313-cp313t-musllinux_1_2_aarch64.whl", hash = "sha256:a9d9ffdc2ab696f6b15b4d1f7cec6658e1d788124418cb30030afbae31c64746", size = 48066216, upload-time = "2025-10-24T10:07:43.528Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/79/87/a1937b6e78b2aff18b706d738c9e46ade5bfcf11b294e39c87706a0089ac/pyarrow-22.0.0-cp313-cp313t-musllinux_1_2_x86_64.whl", hash = "sha256:ec1a15968a9d80da01e1d30349b2b0d7cc91e96588ee324ce1b5228175043e95", size = 50288552, upload-time = "2025-10-24T10:07:53.519Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/60/ae/b5a5811e11f25788ccfdaa8f26b6791c9807119dffcf80514505527c384c/pyarrow-22.0.0-cp313-cp313t-win_amd64.whl", hash = "sha256:bba208d9c7decf9961998edf5c65e3ea4355d5818dd6cd0f6809bec1afb951cc", size = 28262504, upload-time = "2025-10-24T10:08:00.932Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/bd/b0/0fa4d28a8edb42b0a7144edd20befd04173ac79819547216f8a9f36f9e50/pyarrow-22.0.0-cp314-cp314-macosx_12_0_arm64.whl", hash = "sha256:9bddc2cade6561f6820d4cd73f99a0243532ad506bc510a75a5a65a522b2d74d", size = 34224062, upload-time = "2025-10-24T10:08:14.101Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/0f/a8/7a719076b3c1be0acef56a07220c586f25cd24de0e3f3102b438d18ae5df/pyarrow-22.0.0-cp314-cp314-macosx_12_0_x86_64.whl", hash = "sha256:e70ff90c64419709d38c8932ea9fe1cc98415c4f87ea8da81719e43f02534bc9", size = 35990057, upload-time = "2025-10-24T10:08:21.842Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/89/3c/359ed54c93b47fb6fe30ed16cdf50e3f0e8b9ccfb11b86218c3619ae50a8/pyarrow-22.0.0-cp314-cp314-manylinux_2_28_aarch64.whl", hash = "sha256:92843c305330aa94a36e706c16209cd4df274693e777ca47112617db7d0ef3d7", size = 45068002, upload-time = "2025-10-24T10:08:29.034Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/55/fc/4945896cc8638536ee787a3bd6ce7cec8ec9acf452d78ec39ab328efa0a1/pyarrow-22.0.0-cp314-cp314-manylinux_2_28_x86_64.whl", hash = "sha256:6dda1ddac033d27421c20d7a7943eec60be44e0db4e079f33cc5af3b8280ccde", size = 47737765, upload-time = "2025-10-24T10:08:38.559Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/cd/5e/7cb7edeb2abfaa1f79b5d5eb89432356155c8426f75d3753cbcb9592c0fd/pyarrow-22.0.0-cp314-cp314-musllinux_1_2_aarch64.whl", hash = "sha256:84378110dd9a6c06323b41b56e129c504d157d1a983ce8f5443761eb5256bafc", size = 48048139, upload-time = "2025-10-24T10:08:46.784Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/88/c6/546baa7c48185f5e9d6e59277c4b19f30f48c94d9dd938c2a80d4d6b067c/pyarrow-22.0.0-cp314-cp314-musllinux_1_2_x86_64.whl", hash = "sha256:854794239111d2b88b40b6ef92aa478024d1e5074f364033e73e21e3f76b25e0", size = 50314244, upload-time = "2025-10-24T10:08:55.771Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/3c/79/755ff2d145aafec8d347bf18f95e4e81c00127f06d080135dfc86aea417c/pyarrow-22.0.0-cp314-cp314-win_amd64.whl", hash = "sha256:b883fe6fd85adad7932b3271c38ac289c65b7337c2c132e9569f9d3940620730", size = 28757501, upload-time = "2025-10-24T10:09:59.891Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/0e/d2/237d75ac28ced3147912954e3c1a174df43a95f4f88e467809118a8165e0/pyarrow-22.0.0-cp314-cp314t-macosx_12_0_arm64.whl", hash = "sha256:7a820d8ae11facf32585507c11f04e3f38343c1e784c9b5a8b1da5c930547fe2", size = 34355506, upload-time = "2025-10-24T10:09:02.953Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/1e/2c/733dfffe6d3069740f98e57ff81007809067d68626c5faef293434d11bd6/pyarrow-22.0.0-cp314-cp314t-macosx_12_0_x86_64.whl", hash = "sha256:c6ec3675d98915bf1ec8b3c7986422682f7232ea76cad276f4c8abd5b7319b70", size = 36047312, upload-time = "2025-10-24T10:09:10.334Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/7c/2b/29d6e3782dc1f299727462c1543af357a0f2c1d3c160ce199950d9ca51eb/pyarrow-22.0.0-cp314-cp314t-manylinux_2_28_aarch64.whl", hash = "sha256:3e739edd001b04f654b166204fc7a9de896cf6007eaff33409ee9e50ceaff754", size = 45081609, upload-time = "2025-10-24T10:09:18.61Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/8d/42/aa9355ecc05997915af1b7b947a7f66c02dcaa927f3203b87871c114ba10/pyarrow-22.0.0-cp314-cp314t-manylinux_2_28_x86_64.whl", hash = "sha256:7388ac685cab5b279a41dfe0a6ccd99e4dbf322edfb63e02fc0443bf24134e91", size = 47703663, upload-time = "2025-10-24T10:09:27.369Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/ee/62/45abedde480168e83a1de005b7b7043fd553321c1e8c5a9a114425f64842/pyarrow-22.0.0-cp314-cp314t-musllinux_1_2_aarch64.whl", hash = "sha256:f633074f36dbc33d5c05b5dc75371e5660f1dbf9c8b1d95669def05e5425989c", size = 48066543, upload-time = "2025-10-24T10:09:34.908Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/84/e9/7878940a5b072e4f3bf998770acafeae13b267f9893af5f6d4ab3904b67e/pyarrow-22.0.0-cp314-cp314t-musllinux_1_2_x86_64.whl", hash = "sha256:4c19236ae2402a8663a2c8f21f1870a03cc57f0bef7e4b6eb3238cc82944de80", size = 50288838, upload-time = "2025-10-24T10:09:44.394Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/7b/03/f335d6c52b4a4761bcc83499789a1e2e16d9d201a58c327a9b5cc9a41bd9/pyarrow-22.0.0-cp314-cp314t-win_amd64.whl", hash = "sha256:0c34fe18094686194f204a3b1787a27456897d8a2d62caf84b61e8dfbc0252ae", size = 29185594, upload-time = "2025-10-24T10:09:53.111Z" },
|
||||
]
|
||||
|
||||
[[package]]
|
||||
|
|
@ -1277,6 +1487,32 @@ wheels = [
|
|||
{ url = "https://files.pythonhosted.org/packages/05/99/60f19eb1c8eb898882dd8875ea51ad0aac3aff5780b27247969e637cc26a/pycares-4.11.0-cp313-cp313-win32.whl", hash = "sha256:faa8321bc2a366189dcf87b3823e030edf5ac97a6b9a7fc99f1926c4bf8ef28e", size = 118918, upload-time = "2025-09-09T15:17:23.327Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/2a/14/bc89ad7225cba73068688397de09d7cad657d67b93641c14e5e18b88e685/pycares-4.11.0-cp313-cp313-win_amd64.whl", hash = "sha256:6f74b1d944a50fa12c5006fd10b45e1a45da0c5d15570919ce48be88e428264c", size = 144556, upload-time = "2025-09-09T15:17:24.341Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/af/88/4309576bd74b5e6fc1f39b9bc5e4b578df2cadb16bdc026ac0cc15663763/pycares-4.11.0-cp313-cp313-win_arm64.whl", hash = "sha256:4b6f7581793d8bb3014028b8397f6f80b99db8842da58f4409839c29b16397ad", size = 115692, upload-time = "2025-09-09T15:17:25.637Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/2a/70/a723bc79bdcac60361b40184b649282ac0ab433b90e9cc0975370c2ff9c9/pycares-4.11.0-cp314-cp314-macosx_10_13_x86_64.whl", hash = "sha256:df0a17f4e677d57bca3624752bbb515316522ad1ce0de07ed9d920e6c4ee5d35", size = 145910, upload-time = "2025-09-09T15:17:26.774Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/d5/4e/46311ef5a384b5f0bb206851135dde8f86b3def38fdbee9e3c03475d35ae/pycares-4.11.0-cp314-cp314-macosx_11_0_arm64.whl", hash = "sha256:3b44e54cad31d3c3be5e8149ac36bc1c163ec86e0664293402f6f846fb22ad00", size = 142053, upload-time = "2025-09-09T15:17:27.956Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/74/23/d236fc4f134d6311e4ad6445571e8285e84a3e155be36422ff20c0fbe471/pycares-4.11.0-cp314-cp314-manylinux_2_28_aarch64.whl", hash = "sha256:80752133442dc7e6dd9410cec227c49f69283c038c316a8585cca05ec32c2766", size = 637878, upload-time = "2025-09-09T15:17:29.173Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/f7/92/6edd41282b3f0e3d9defaba7b05c39730d51c37c165d9d3b319349c975aa/pycares-4.11.0-cp314-cp314-manylinux_2_28_ppc64le.whl", hash = "sha256:84b0b402dd333403fdce0e204aef1ef834d839c439c0c1aa143dc7d1237bb197", size = 687865, upload-time = "2025-09-09T15:17:30.549Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/a7/a9/4d7cf4d72600fd47d9518f9ce99703a3e8711fb08d2ef63d198056cdc9a9/pycares-4.11.0-cp314-cp314-manylinux_2_28_s390x.whl", hash = "sha256:c0eec184df42fc82e43197e073f9cc8f93b25ad2f11f230c64c2dc1c80dbc078", size = 678396, upload-time = "2025-09-09T15:17:32.304Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/0b/4b/e546eeb1d8ff6559e2e3bef31a6ea0c6e57ec826191941f83a3ce900ca89/pycares-4.11.0-cp314-cp314-manylinux_2_28_x86_64.whl", hash = "sha256:ee751409322ff10709ee867d5aea1dc8431eec7f34835f0f67afd016178da134", size = 640786, upload-time = "2025-09-09T15:17:33.602Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/0e/f5/b4572d9ee9c26de1f8d1dc80730df756276b9243a6794fa3101bbe56613d/pycares-4.11.0-cp314-cp314-musllinux_1_2_aarch64.whl", hash = "sha256:1732db81e348bfce19c9bf9448ba660aea03042eeeea282824da1604a5bd4dcf", size = 621857, upload-time = "2025-09-09T15:17:34.74Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/17/f2/639090376198bcaeff86562b25e1bce05a481cfb1e605f82ce62285230cd/pycares-4.11.0-cp314-cp314-musllinux_1_2_ppc64le.whl", hash = "sha256:702d21823996f139874aba5aa9bb786d69e93bde6e3915b99832eb4e335d31ae", size = 670130, upload-time = "2025-09-09T15:17:35.982Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/3a/c4/cf40773cd9c36a12cebbe1e9b6fb120f9160dc9bfe0398d81a20b6c69972/pycares-4.11.0-cp314-cp314-musllinux_1_2_s390x.whl", hash = "sha256:218619b912cef7c64a339ab0e231daea10c994a05699740714dff8c428b9694a", size = 653133, upload-time = "2025-09-09T15:17:37.179Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/32/6b/06054d977b0a9643821043b59f523f3db5e7684c4b1b4f5821994d5fa780/pycares-4.11.0-cp314-cp314-musllinux_1_2_x86_64.whl", hash = "sha256:719f7ddff024fdacde97b926b4b26d0cc25901d5ef68bb994a581c420069936d", size = 629344, upload-time = "2025-09-09T15:17:38.308Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/d6/6f/14bb0c2171a286d512e3f02d6168e608ffe5f6eceab78bf63e3073091ae3/pycares-4.11.0-cp314-cp314-win32.whl", hash = "sha256:d552fb2cb513ce910d1dc22dbba6420758a991a356f3cd1b7ec73a9e31f94d01", size = 121804, upload-time = "2025-09-09T15:17:39.388Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/24/dc/6822f9ad6941027f70e1cf161d8631456531a87061588ed3b1dcad07d49d/pycares-4.11.0-cp314-cp314-win_amd64.whl", hash = "sha256:23d50a0842e8dbdddf870a7218a7ab5053b68892706b3a391ecb3d657424d266", size = 148005, upload-time = "2025-09-09T15:17:40.44Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/ea/24/24ff3a80aa8471fbb62785c821a8e90f397ca842e0489f83ebf7ee274397/pycares-4.11.0-cp314-cp314-win_arm64.whl", hash = "sha256:836725754c32363d2c5d15b931b3ebd46b20185c02e850672cb6c5f0452c1e80", size = 119239, upload-time = "2025-09-09T15:17:42.094Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/54/fe/2f3558d298ff8db31d5c83369001ab72af3b86a0374d9b0d40dc63314187/pycares-4.11.0-cp314-cp314t-macosx_10_13_x86_64.whl", hash = "sha256:c9d839b5700542b27c1a0d359cbfad6496341e7c819c7fea63db9588857065ed", size = 146408, upload-time = "2025-09-09T15:17:43.74Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/3c/c8/516901e46a1a73b3a75e87a35f3a3a4fe085f1214f37d954c9d7e782bd6d/pycares-4.11.0-cp314-cp314t-macosx_11_0_arm64.whl", hash = "sha256:31b85ad00422b38f426e5733a71dfb7ee7eb65a99ea328c508d4f552b1760dc8", size = 142371, upload-time = "2025-09-09T15:17:45.186Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/ac/99/c3fba0aa575f331ebed91f87ba960ffbe0849211cdf103ab275bc0107ac6/pycares-4.11.0-cp314-cp314t-manylinux_2_28_aarch64.whl", hash = "sha256:cdac992206756b024b371760c55719eb5cd9d6b2cb25a8d5a04ae1b0ff426232", size = 647504, upload-time = "2025-09-09T15:17:46.503Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/5c/e4/1cdc3ec9c92f8069ec18c58b016b2df7c44a088e2849f37ed457554961aa/pycares-4.11.0-cp314-cp314t-manylinux_2_28_ppc64le.whl", hash = "sha256:ffb22cee640bc12ee0e654eba74ecfb59e2e0aebc5bccc3cc7ef92f487008af7", size = 697122, upload-time = "2025-09-09T15:17:47.772Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/9c/d5/bd8f370b97bb73e5bdd55dc2a78e18d6f49181cf77e88af0599d16f5c073/pycares-4.11.0-cp314-cp314t-manylinux_2_28_s390x.whl", hash = "sha256:00538826d2eaf4a0e4becb0753b0ac8d652334603c445c9566c9eb273657eb4c", size = 687543, upload-time = "2025-09-09T15:17:49.183Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/33/38/49b77b9cf5dffc0b1fdd86656975c3bc1a58b79bdc883a9ef749b17a013c/pycares-4.11.0-cp314-cp314t-manylinux_2_28_x86_64.whl", hash = "sha256:29daa36548c04cdcd1a78ae187a4b7b003f0b357a2f4f1f98f9863373eedc759", size = 649565, upload-time = "2025-09-09T15:17:51.03Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/3c/23/f6d57bfb99d00a6a7363f95c8d3a930fe82a868d9de24c64c8048d66f16a/pycares-4.11.0-cp314-cp314t-musllinux_1_2_aarch64.whl", hash = "sha256:cf306f3951740d7bed36149a6d8d656a7d5432dd4bbc6af3bb6554361fc87401", size = 631242, upload-time = "2025-09-09T15:17:52.298Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/33/a2/7b9121c71cfe06a8474e221593f83a78176fae3b79e5853d2dfd13ab01cc/pycares-4.11.0-cp314-cp314t-musllinux_1_2_ppc64le.whl", hash = "sha256:386da2581db4ea2832629e275c061103b0be32f9391c5dfaea7f6040951950ad", size = 680304, upload-time = "2025-09-09T15:17:53.638Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/5b/07/dfe76807f637d8b80e1a59dfc4a1bceabdd0205a45b2ebf78b415ae72af3/pycares-4.11.0-cp314-cp314t-musllinux_1_2_s390x.whl", hash = "sha256:45d3254a694459fdb0640ef08724ca9d4b4f6ff6d7161c9b526d7d2e2111379e", size = 661039, upload-time = "2025-09-09T15:17:55.024Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/b2/9b/55d50c5acd46cbe95d0da27740a83e721d89c0ce7e42bff9891a9f29a855/pycares-4.11.0-cp314-cp314t-musllinux_1_2_x86_64.whl", hash = "sha256:eddf5e520bb88b23b04ac1f28f5e9a7c77c718b8b4af3a4a7a2cc4a600f34502", size = 637560, upload-time = "2025-09-09T15:17:56.492Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/1f/79/2b2e723d1b929dbe7f99e80a56abb29a4f86988c1f73195d960d706b1629/pycares-4.11.0-cp314-cp314t-win32.whl", hash = "sha256:8a75a406432ce39ce0ca41edff7486df6c970eb0fe5cfbe292f195a6b8654461", size = 122235, upload-time = "2025-09-09T15:17:57.576Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/93/fe/bf3b3ed9345a38092e72cd9890a5df5c2349fc27846a714d823a41f0ee27/pycares-4.11.0-cp314-cp314t-win_amd64.whl", hash = "sha256:3784b80d797bcc2ff2bf3d4b27f46d8516fe1707ff3b82c2580dc977537387f9", size = 148575, upload-time = "2025-09-09T15:17:58.699Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/ce/20/c0c5cfcf89725fe533b27bc5f714dc4efa8e782bf697c36f9ddf04ba975d/pycares-4.11.0-cp314-cp314t-win_arm64.whl", hash = "sha256:afc6503adf8b35c21183b9387be64ca6810644ef54c9ef6c99d1d5635c01601b", size = 119690, upload-time = "2025-09-09T15:17:59.809Z" },
|
||||
]
|
||||
|
||||
[[package]]
|
||||
|
|
@ -1361,15 +1597,24 @@ wheels = [
|
|||
{ url = "https://files.pythonhosted.org/packages/cd/8d/a2eaccc88cc53e6370e3728593ea80d10a132f87078ce7cbcfc8c33d9b3f/pyqt6_sip-13.10.3-cp313-cp313-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:e234a3af9539f71bb566e7136317b92f189a89553970284d833cd63cca4dafdd", size = 323466, upload-time = "2025-12-06T13:19:34.445Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/47/f8/55a93c3eda94c94fc10c2537f55ca98d9bb1982bf65c03ee2302c250b6aa/pyqt6_sip-13.10.3-cp313-cp313-win_amd64.whl", hash = "sha256:a856b9b2a4700c8dded1c870811d5ba26722238d57c9098904a99570429d112b", size = 53468, upload-time = "2025-12-06T13:19:36.877Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/41/a3/ee0633507350442580a2cd893e4edb7170d87fef1c790365e7bc4999ce40/pyqt6_sip-13.10.3-cp313-cp313-win_arm64.whl", hash = "sha256:9e48e5d6ac9e1a61d5abdfb2191a0ffb19948eefd5adacdd0c1dedbed06222aa", size = 48645, upload-time = "2025-12-06T13:19:38.216Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/a1/70/a22362c2632d07d8e29431418e0485f12a41b3c4844f15b60ca5a969e01c/pyqt6_sip-13.10.3-cp314-cp314-macosx_10_15_universal2.whl", hash = "sha256:eb7afe41329ce2eca99118f01776a047a2a150c550258dff1746505af223f997", size = 112432, upload-time = "2025-12-06T13:19:39.153Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/25/72/e0a7e4489ea5b948aef707a7d76baf6722a65aabd7e4d3c253583eb6b268/pyqt6_sip-13.10.3-cp314-cp314-manylinux1_x86_64.manylinux_2_5_x86_64.whl", hash = "sha256:6122fe4ccba5a5023581c2c3c57deab6eab56d8e931beec20b05666a46a38e6a", size = 301341, upload-time = "2025-12-06T13:19:41.642Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/1f/43/0a648469a7e4f07df1c4ad6443f892e55631f24f7af30c7c946e458a82d1/pyqt6_sip-13.10.3-cp314-cp314-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:3286a98e93608d51048e9046f557117424c8366be266b33ff852ee54ffa7b9bf", size = 324062, upload-time = "2025-12-06T13:19:40.308Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/f3/0d/67d2095a932c007210437318c31fbc8376deb4e4491907861c4b9ac4ad9e/pyqt6_sip-13.10.3-cp314-cp314-win_amd64.whl", hash = "sha256:4fc6229ba7276266e3805b5517e7413cba79538f0c3ce7d2042a2027a90f99cf", size = 55076, upload-time = "2025-12-06T13:19:42.61Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/f8/cd/f121be0271dc73d54f3580584103c046a8d2c06a2686b594b77fd677a5ef/pyqt6_sip-13.10.3-cp314-cp314-win_arm64.whl", hash = "sha256:efef47667ca009557d7ecf985b15f0bf440584fd634ee0eab19ec296effc7cca", size = 49464, upload-time = "2025-12-06T13:19:43.638Z" },
|
||||
]
|
||||
|
||||
[[package]]
|
||||
name = "pyqtgraph"
|
||||
version = "0.12.3"
|
||||
source = { git = "https://github.com/pikers/pyqtgraph.git#373f9561ea8ec4fef9b4e8bdcdd4bbf372dd6512" }
|
||||
version = "0.14.0"
|
||||
source = { registry = "https://pypi.org/simple" }
|
||||
dependencies = [
|
||||
{ name = "colorama" },
|
||||
{ name = "numpy" },
|
||||
]
|
||||
wheels = [
|
||||
{ url = "https://files.pythonhosted.org/packages/32/36/4c242f81fdcbfa4fb62a5645f6af79191f4097a0577bd5460c24f19cc4ef/pyqtgraph-0.14.0-py3-none-any.whl", hash = "sha256:7abb7c3e17362add64f8711b474dffac5e7b0e9245abdf992e9a44119b7aa4f5", size = 1924755, upload-time = "2025-11-16T19:43:22.251Z" },
|
||||
]
|
||||
|
||||
[[package]]
|
||||
name = "pyreadline3"
|
||||
|
|
@ -1456,6 +1701,24 @@ wheels = [
|
|||
{ url = "https://files.pythonhosted.org/packages/de/94/980b50a6531b3019e45ddeada0626d45fa85cbe22300844a7983285bed3b/pyyaml-6.0.3-cp313-cp313-win32.whl", hash = "sha256:d0eae10f8159e8fdad514efdc92d74fd8d682c933a6dd088030f3834bc8e6b26", size = 137427, upload-time = "2025-09-25T21:32:32.58Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/97/c9/39d5b874e8b28845e4ec2202b5da735d0199dbe5b8fb85f91398814a9a46/pyyaml-6.0.3-cp313-cp313-win_amd64.whl", hash = "sha256:79005a0d97d5ddabfeeea4cf676af11e647e41d81c9a7722a193022accdb6b7c", size = 154090, upload-time = "2025-09-25T21:32:33.659Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/73/e8/2bdf3ca2090f68bb3d75b44da7bbc71843b19c9f2b9cb9b0f4ab7a5a4329/pyyaml-6.0.3-cp313-cp313-win_arm64.whl", hash = "sha256:5498cd1645aa724a7c71c8f378eb29ebe23da2fc0d7a08071d89469bf1d2defb", size = 140246, upload-time = "2025-09-25T21:32:34.663Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/9d/8c/f4bd7f6465179953d3ac9bc44ac1a8a3e6122cf8ada906b4f96c60172d43/pyyaml-6.0.3-cp314-cp314-macosx_10_13_x86_64.whl", hash = "sha256:8d1fab6bb153a416f9aeb4b8763bc0f22a5586065f86f7664fc23339fc1c1fac", size = 181814, upload-time = "2025-09-25T21:32:35.712Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/bd/9c/4d95bb87eb2063d20db7b60faa3840c1b18025517ae857371c4dd55a6b3a/pyyaml-6.0.3-cp314-cp314-macosx_11_0_arm64.whl", hash = "sha256:34d5fcd24b8445fadc33f9cf348c1047101756fd760b4dacb5c3e99755703310", size = 173809, upload-time = "2025-09-25T21:32:36.789Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/92/b5/47e807c2623074914e29dabd16cbbdd4bf5e9b2db9f8090fa64411fc5382/pyyaml-6.0.3-cp314-cp314-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:501a031947e3a9025ed4405a168e6ef5ae3126c59f90ce0cd6f2bfc477be31b7", size = 766454, upload-time = "2025-09-25T21:32:37.966Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/02/9e/e5e9b168be58564121efb3de6859c452fccde0ab093d8438905899a3a483/pyyaml-6.0.3-cp314-cp314-manylinux2014_s390x.manylinux_2_17_s390x.manylinux_2_28_s390x.whl", hash = "sha256:b3bc83488de33889877a0f2543ade9f70c67d66d9ebb4ac959502e12de895788", size = 836355, upload-time = "2025-09-25T21:32:39.178Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/88/f9/16491d7ed2a919954993e48aa941b200f38040928474c9e85ea9e64222c3/pyyaml-6.0.3-cp314-cp314-manylinux2014_x86_64.manylinux_2_17_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:c458b6d084f9b935061bc36216e8a69a7e293a2f1e68bf956dcd9e6cbcd143f5", size = 794175, upload-time = "2025-09-25T21:32:40.865Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/dd/3f/5989debef34dc6397317802b527dbbafb2b4760878a53d4166579111411e/pyyaml-6.0.3-cp314-cp314-musllinux_1_2_aarch64.whl", hash = "sha256:7c6610def4f163542a622a73fb39f534f8c101d690126992300bf3207eab9764", size = 755228, upload-time = "2025-09-25T21:32:42.084Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/d7/ce/af88a49043cd2e265be63d083fc75b27b6ed062f5f9fd6cdc223ad62f03e/pyyaml-6.0.3-cp314-cp314-musllinux_1_2_x86_64.whl", hash = "sha256:5190d403f121660ce8d1d2c1bb2ef1bd05b5f68533fc5c2ea899bd15f4399b35", size = 789194, upload-time = "2025-09-25T21:32:43.362Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/23/20/bb6982b26a40bb43951265ba29d4c246ef0ff59c9fdcdf0ed04e0687de4d/pyyaml-6.0.3-cp314-cp314-win_amd64.whl", hash = "sha256:4a2e8cebe2ff6ab7d1050ecd59c25d4c8bd7e6f400f5f82b96557ac0abafd0ac", size = 156429, upload-time = "2025-09-25T21:32:57.844Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/f4/f4/a4541072bb9422c8a883ab55255f918fa378ecf083f5b85e87fc2b4eda1b/pyyaml-6.0.3-cp314-cp314-win_arm64.whl", hash = "sha256:93dda82c9c22deb0a405ea4dc5f2d0cda384168e466364dec6255b293923b2f3", size = 143912, upload-time = "2025-09-25T21:32:59.247Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/7c/f9/07dd09ae774e4616edf6cda684ee78f97777bdd15847253637a6f052a62f/pyyaml-6.0.3-cp314-cp314t-macosx_10_13_x86_64.whl", hash = "sha256:02893d100e99e03eda1c8fd5c441d8c60103fd175728e23e431db1b589cf5ab3", size = 189108, upload-time = "2025-09-25T21:32:44.377Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/4e/78/8d08c9fb7ce09ad8c38ad533c1191cf27f7ae1effe5bb9400a46d9437fcf/pyyaml-6.0.3-cp314-cp314t-macosx_11_0_arm64.whl", hash = "sha256:c1ff362665ae507275af2853520967820d9124984e0f7466736aea23d8611fba", size = 183641, upload-time = "2025-09-25T21:32:45.407Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/7b/5b/3babb19104a46945cf816d047db2788bcaf8c94527a805610b0289a01c6b/pyyaml-6.0.3-cp314-cp314t-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:6adc77889b628398debc7b65c073bcb99c4a0237b248cacaf3fe8a557563ef6c", size = 831901, upload-time = "2025-09-25T21:32:48.83Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/8b/cc/dff0684d8dc44da4d22a13f35f073d558c268780ce3c6ba1b87055bb0b87/pyyaml-6.0.3-cp314-cp314t-manylinux2014_s390x.manylinux_2_17_s390x.manylinux_2_28_s390x.whl", hash = "sha256:a80cb027f6b349846a3bf6d73b5e95e782175e52f22108cfa17876aaeff93702", size = 861132, upload-time = "2025-09-25T21:32:50.149Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/b1/5e/f77dc6b9036943e285ba76b49e118d9ea929885becb0a29ba8a7c75e29fe/pyyaml-6.0.3-cp314-cp314t-manylinux2014_x86_64.manylinux_2_17_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:00c4bdeba853cc34e7dd471f16b4114f4162dc03e6b7afcc2128711f0eca823c", size = 839261, upload-time = "2025-09-25T21:32:51.808Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/ce/88/a9db1376aa2a228197c58b37302f284b5617f56a5d959fd1763fb1675ce6/pyyaml-6.0.3-cp314-cp314t-musllinux_1_2_aarch64.whl", hash = "sha256:66e1674c3ef6f541c35191caae2d429b967b99e02040f5ba928632d9a7f0f065", size = 805272, upload-time = "2025-09-25T21:32:52.941Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/da/92/1446574745d74df0c92e6aa4a7b0b3130706a4142b2d1a5869f2eaa423c6/pyyaml-6.0.3-cp314-cp314t-musllinux_1_2_x86_64.whl", hash = "sha256:16249ee61e95f858e83976573de0f5b2893b3677ba71c9dd36b9cf8be9ac6d65", size = 829923, upload-time = "2025-09-25T21:32:54.537Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/f0/7a/1c7270340330e575b92f397352af856a8c06f230aa3e76f86b39d01b416a/pyyaml-6.0.3-cp314-cp314t-win_amd64.whl", hash = "sha256:4ad1906908f2f5ae4e5a8ddfce73c320c2a1429ec52eafd27138b7f1cbe341c9", size = 174062, upload-time = "2025-09-25T21:32:55.767Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/f1/12/de94a39c2ef588c7e6455cfbe7343d3b2dc9d6b6b2f40c4c6565744c873d/pyyaml-6.0.3-cp314-cp314t-win_arm64.whl", hash = "sha256:ebc55a14a21cb14062aa4162f906cd962b28e2e9ea38f9b4391244cd8de4ae0b", size = 149341, upload-time = "2025-09-25T21:32:56.828Z" },
|
||||
]
|
||||
|
||||
[[package]]
|
||||
|
|
@ -1521,6 +1784,28 @@ wheels = [
|
|||
{ url = "https://files.pythonhosted.org/packages/c1/ab/1d0354b7d1771a28fa7fe089bc23acec2bdd3756efa2419f463e3ed80e16/rapidfuzz-3.14.3-cp313-cp313t-win32.whl", hash = "sha256:489ce98a895c98cad284f0a47960c3e264c724cb4cfd47a1430fa091c0c25204", size = 1757773, upload-time = "2025-11-01T11:53:57.628Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/0b/0c/71ef356adc29e2bdf74cd284317b34a16b80258fa0e7e242dd92cc1e6d10/rapidfuzz-3.14.3-cp313-cp313t-win_amd64.whl", hash = "sha256:656e52b054d5b5c2524169240e50cfa080b04b1c613c5f90a2465e84888d6f15", size = 1576797, upload-time = "2025-11-01T11:53:59.455Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/fe/d2/0e64fc27bb08d4304aa3d11154eb5480bcf5d62d60140a7ee984dc07468a/rapidfuzz-3.14.3-cp313-cp313t-win_arm64.whl", hash = "sha256:c7e40c0a0af02ad6e57e89f62bef8604f55a04ecae90b0ceeda591bbf5923317", size = 829940, upload-time = "2025-11-01T11:54:01.1Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/32/6f/1b88aaeade83abc5418788f9e6b01efefcd1a69d65ded37d89cd1662be41/rapidfuzz-3.14.3-cp314-cp314-macosx_10_15_x86_64.whl", hash = "sha256:442125473b247227d3f2de807a11da6c08ccf536572d1be943f8e262bae7e4ea", size = 1942086, upload-time = "2025-11-01T11:54:02.592Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/a0/2c/b23861347436cb10f46c2bd425489ec462790faaa360a54a7ede5f78de88/rapidfuzz-3.14.3-cp314-cp314-macosx_11_0_arm64.whl", hash = "sha256:1ec0c8c0c3d4f97ced46b2e191e883f8c82dbbf6d5ebc1842366d7eff13cd5a6", size = 1386993, upload-time = "2025-11-01T11:54:04.12Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/83/86/5d72e2c060aa1fbdc1f7362d938f6b237dff91f5b9fc5dd7cc297e112250/rapidfuzz-3.14.3-cp314-cp314-manylinux_2_26_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:2dc37bc20272f388b8c3a4eba4febc6e77e50a8f450c472def4751e7678f55e4", size = 1379126, upload-time = "2025-11-01T11:54:05.777Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/c9/bc/ef2cee3e4d8b3fc22705ff519f0d487eecc756abdc7c25d53686689d6cf2/rapidfuzz-3.14.3-cp314-cp314-manylinux_2_27_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:dee362e7e79bae940a5e2b3f6d09c6554db6a4e301cc68343886c08be99844f1", size = 3159304, upload-time = "2025-11-01T11:54:07.351Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/a0/36/dc5f2f62bbc7bc90be1f75eeaf49ed9502094bb19290dfb4747317b17f12/rapidfuzz-3.14.3-cp314-cp314-manylinux_2_31_armv7l.whl", hash = "sha256:4b39921df948388a863f0e267edf2c36302983459b021ab928d4b801cbe6a421", size = 1218207, upload-time = "2025-11-01T11:54:09.641Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/df/7e/8f4be75c1bc62f47edf2bbbe2370ee482fae655ebcc4718ac3827ead3904/rapidfuzz-3.14.3-cp314-cp314-musllinux_1_2_aarch64.whl", hash = "sha256:beda6aa9bc44d1d81242e7b291b446be352d3451f8217fcb068fc2933927d53b", size = 2401245, upload-time = "2025-11-01T11:54:11.543Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/05/38/f7c92759e1bb188dd05b80d11c630ba59b8d7856657baf454ff56059c2ab/rapidfuzz-3.14.3-cp314-cp314-musllinux_1_2_armv7l.whl", hash = "sha256:6a014ba09657abfcfeed64b7d09407acb29af436d7fc075b23a298a7e4a6b41c", size = 2518308, upload-time = "2025-11-01T11:54:13.134Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/c7/ac/85820f70fed5ecb5f1d9a55f1e1e2090ef62985ef41db289b5ac5ec56e28/rapidfuzz-3.14.3-cp314-cp314-musllinux_1_2_x86_64.whl", hash = "sha256:32eeafa3abce138bb725550c0e228fc7eaeec7059aa8093d9cbbec2b58c2371a", size = 4265011, upload-time = "2025-11-01T11:54:15.087Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/46/a9/616930721ea9835c918af7cde22bff17f9db3639b0c1a7f96684be7f5630/rapidfuzz-3.14.3-cp314-cp314-win32.whl", hash = "sha256:adb44d996fc610c7da8c5048775b21db60dd63b1548f078e95858c05c86876a3", size = 1742245, upload-time = "2025-11-01T11:54:17.19Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/06/8a/f2fa5e9635b1ccafda4accf0e38246003f69982d7c81f2faa150014525a4/rapidfuzz-3.14.3-cp314-cp314-win_amd64.whl", hash = "sha256:f3d15d8527e2b293e38ce6e437631af0708df29eafd7c9fc48210854c94472f9", size = 1584856, upload-time = "2025-11-01T11:54:18.764Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/ef/97/09e20663917678a6d60d8e0e29796db175b1165e2079830430342d5298be/rapidfuzz-3.14.3-cp314-cp314-win_arm64.whl", hash = "sha256:576e4b9012a67e0bf54fccb69a7b6c94d4e86a9540a62f1a5144977359133583", size = 833490, upload-time = "2025-11-01T11:54:20.753Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/03/1b/6b6084576ba87bf21877c77218a0c97ba98cb285b0c02eaaee3acd7c4513/rapidfuzz-3.14.3-cp314-cp314t-macosx_10_15_x86_64.whl", hash = "sha256:cec3c0da88562727dd5a5a364bd9efeb535400ff0bfb1443156dd139a1dd7b50", size = 1968658, upload-time = "2025-11-01T11:54:22.25Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/38/c0/fb02a0db80d95704b0a6469cc394e8c38501abf7e1c0b2afe3261d1510c2/rapidfuzz-3.14.3-cp314-cp314t-macosx_11_0_arm64.whl", hash = "sha256:d1fa009f8b1100e4880868137e7bf0501422898f7674f2adcd85d5a67f041296", size = 1410742, upload-time = "2025-11-01T11:54:23.863Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/a4/72/3fbf12819fc6afc8ec75a45204013b40979d068971e535a7f3512b05e765/rapidfuzz-3.14.3-cp314-cp314t-manylinux_2_26_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:1b86daa7419b5e8b180690efd1fdbac43ff19230803282521c5b5a9c83977655", size = 1382810, upload-time = "2025-11-01T11:54:25.571Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/0f/18/0f1991d59bb7eee28922a00f79d83eafa8c7bfb4e8edebf4af2a160e7196/rapidfuzz-3.14.3-cp314-cp314t-manylinux_2_27_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:c7bd1816db05d6c5ffb3a4df0a2b7b56fb8c81ef584d08e37058afa217da91b1", size = 3166349, upload-time = "2025-11-01T11:54:27.195Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/0d/f0/baa958b1989c8f88c78bbb329e969440cf330b5a01a982669986495bb980/rapidfuzz-3.14.3-cp314-cp314t-manylinux_2_31_armv7l.whl", hash = "sha256:33da4bbaf44e9755b0ce192597f3bde7372fe2e381ab305f41b707a95ac57aa7", size = 1214994, upload-time = "2025-11-01T11:54:28.821Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/e4/a0/cd12ec71f9b2519a3954febc5740291cceabc64c87bc6433afcb36259f3b/rapidfuzz-3.14.3-cp314-cp314t-musllinux_1_2_aarch64.whl", hash = "sha256:3fecce764cf5a991ee2195a844196da840aba72029b2612f95ac68a8b74946bf", size = 2403919, upload-time = "2025-11-01T11:54:30.393Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/0b/ce/019bd2176c1644098eced4f0595cb4b3ef52e4941ac9a5854f209d0a6e16/rapidfuzz-3.14.3-cp314-cp314t-musllinux_1_2_armv7l.whl", hash = "sha256:ecd7453e02cf072258c3a6b8e930230d789d5d46cc849503729f9ce475d0e785", size = 2508346, upload-time = "2025-11-01T11:54:32.048Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/23/f8/be16c68e2c9e6c4f23e8f4adbb7bccc9483200087ed28ff76c5312da9b14/rapidfuzz-3.14.3-cp314-cp314t-musllinux_1_2_x86_64.whl", hash = "sha256:ea188aa00e9bcae8c8411f006a5f2f06c4607a02f24eab0d8dc58566aa911f35", size = 4274105, upload-time = "2025-11-01T11:54:33.701Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/a1/d1/5ab148e03f7e6ec8cd220ccf7af74d3aaa4de26dd96df58936beb7cba820/rapidfuzz-3.14.3-cp314-cp314t-win32.whl", hash = "sha256:7ccbf68100c170e9a0581accbe9291850936711548c6688ce3bfb897b8c589ad", size = 1793465, upload-time = "2025-11-01T11:54:35.331Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/cd/97/433b2d98e97abd9fff1c470a109b311669f44cdec8d0d5aa250aceaed1fb/rapidfuzz-3.14.3-cp314-cp314t-win_amd64.whl", hash = "sha256:9ec02e62ae765a318d6de38df609c57fc6dacc65c0ed1fd489036834fd8a620c", size = 1623491, upload-time = "2025-11-01T11:54:38.085Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/e2/f6/e2176eb94f94892441bce3ddc514c179facb65db245e7ce3356965595b19/rapidfuzz-3.14.3-cp314-cp314t-win_arm64.whl", hash = "sha256:e805e52322ae29aa945baf7168b6c898120fbc16d2b8f940b658a5e9e3999253", size = 851487, upload-time = "2025-11-01T11:54:40.176Z" },
|
||||
]
|
||||
|
||||
[[package]]
|
||||
|
|
@ -1647,6 +1932,22 @@ wheels = [
|
|||
{ url = "https://files.pythonhosted.org/packages/55/92/afed3d497f7c186dc71e6ee6d4fcb0acfa5f7d0a1a2878f8beae379ae0cc/tomli-2.3.0-cp313-cp313-musllinux_1_2_x86_64.whl", hash = "sha256:ad805ea85eda330dbad64c7ea7a4556259665bdf9d2672f5dccc740eb9d3ca05", size = 248909, upload-time = "2025-10-08T22:01:23.859Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/f8/84/ef50c51b5a9472e7265ce1ffc7f24cd4023d289e109f669bdb1553f6a7c2/tomli-2.3.0-cp313-cp313-win32.whl", hash = "sha256:97d5eec30149fd3294270e889b4234023f2c69747e555a27bd708828353ab606", size = 96946, upload-time = "2025-10-08T22:01:24.893Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/b2/b7/718cd1da0884f281f95ccfa3a6cc572d30053cba64603f79d431d3c9b61b/tomli-2.3.0-cp313-cp313-win_amd64.whl", hash = "sha256:0c95ca56fbe89e065c6ead5b593ee64b84a26fca063b5d71a1122bf26e533999", size = 107705, upload-time = "2025-10-08T22:01:26.153Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/19/94/aeafa14a52e16163008060506fcb6aa1949d13548d13752171a755c65611/tomli-2.3.0-cp314-cp314-macosx_10_13_x86_64.whl", hash = "sha256:cebc6fe843e0733ee827a282aca4999b596241195f43b4cc371d64fc6639da9e", size = 154244, upload-time = "2025-10-08T22:01:27.06Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/db/e4/1e58409aa78eefa47ccd19779fc6f36787edbe7d4cd330eeeedb33a4515b/tomli-2.3.0-cp314-cp314-macosx_11_0_arm64.whl", hash = "sha256:4c2ef0244c75aba9355561272009d934953817c49f47d768070c3c94355c2aa3", size = 148637, upload-time = "2025-10-08T22:01:28.059Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/26/b6/d1eccb62f665e44359226811064596dd6a366ea1f985839c566cd61525ae/tomli-2.3.0-cp314-cp314-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:c22a8bf253bacc0cf11f35ad9808b6cb75ada2631c2d97c971122583b129afbc", size = 241925, upload-time = "2025-10-08T22:01:29.066Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/70/91/7cdab9a03e6d3d2bb11beae108da5bdc1c34bdeb06e21163482544ddcc90/tomli-2.3.0-cp314-cp314-manylinux2014_x86_64.manylinux_2_17_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:0eea8cc5c5e9f89c9b90c4896a8deefc74f518db5927d0e0e8d4a80953d774d0", size = 249045, upload-time = "2025-10-08T22:01:31.98Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/15/1b/8c26874ed1f6e4f1fcfeb868db8a794cbe9f227299402db58cfcc858766c/tomli-2.3.0-cp314-cp314-musllinux_1_2_aarch64.whl", hash = "sha256:b74a0e59ec5d15127acdabd75ea17726ac4c5178ae51b85bfe39c4f8a278e879", size = 245835, upload-time = "2025-10-08T22:01:32.989Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/fd/42/8e3c6a9a4b1a1360c1a2a39f0b972cef2cc9ebd56025168c4137192a9321/tomli-2.3.0-cp314-cp314-musllinux_1_2_x86_64.whl", hash = "sha256:b5870b50c9db823c595983571d1296a6ff3e1b88f734a4c8f6fc6188397de005", size = 253109, upload-time = "2025-10-08T22:01:34.052Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/22/0c/b4da635000a71b5f80130937eeac12e686eefb376b8dee113b4a582bba42/tomli-2.3.0-cp314-cp314-win32.whl", hash = "sha256:feb0dacc61170ed7ab602d3d972a58f14ee3ee60494292d384649a3dc38ef463", size = 97930, upload-time = "2025-10-08T22:01:35.082Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/b9/74/cb1abc870a418ae99cd5c9547d6bce30701a954e0e721821df483ef7223c/tomli-2.3.0-cp314-cp314-win_amd64.whl", hash = "sha256:b273fcbd7fc64dc3600c098e39136522650c49bca95df2d11cf3b626422392c8", size = 107964, upload-time = "2025-10-08T22:01:36.057Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/54/78/5c46fff6432a712af9f792944f4fcd7067d8823157949f4e40c56b8b3c83/tomli-2.3.0-cp314-cp314t-macosx_10_13_x86_64.whl", hash = "sha256:940d56ee0410fa17ee1f12b817b37a4d4e4dc4d27340863cc67236c74f582e77", size = 163065, upload-time = "2025-10-08T22:01:37.27Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/39/67/f85d9bd23182f45eca8939cd2bc7050e1f90c41f4a2ecbbd5963a1d1c486/tomli-2.3.0-cp314-cp314t-macosx_11_0_arm64.whl", hash = "sha256:f85209946d1fe94416debbb88d00eb92ce9cd5266775424ff81bc959e001acaf", size = 159088, upload-time = "2025-10-08T22:01:38.235Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/26/5a/4b546a0405b9cc0659b399f12b6adb750757baf04250b148d3c5059fc4eb/tomli-2.3.0-cp314-cp314t-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:a56212bdcce682e56b0aaf79e869ba5d15a6163f88d5451cbde388d48b13f530", size = 268193, upload-time = "2025-10-08T22:01:39.712Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/42/4f/2c12a72ae22cf7b59a7fe75b3465b7aba40ea9145d026ba41cb382075b0e/tomli-2.3.0-cp314-cp314t-manylinux2014_x86_64.manylinux_2_17_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:c5f3ffd1e098dfc032d4d3af5c0ac64f6d286d98bc148698356847b80fa4de1b", size = 275488, upload-time = "2025-10-08T22:01:40.773Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/92/04/a038d65dbe160c3aa5a624e93ad98111090f6804027d474ba9c37c8ae186/tomli-2.3.0-cp314-cp314t-musllinux_1_2_aarch64.whl", hash = "sha256:5e01decd096b1530d97d5d85cb4dff4af2d8347bd35686654a004f8dea20fc67", size = 272669, upload-time = "2025-10-08T22:01:41.824Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/be/2f/8b7c60a9d1612a7cbc39ffcca4f21a73bf368a80fc25bccf8253e2563267/tomli-2.3.0-cp314-cp314t-musllinux_1_2_x86_64.whl", hash = "sha256:8a35dd0e643bb2610f156cca8db95d213a90015c11fee76c946aa62b7ae7e02f", size = 279709, upload-time = "2025-10-08T22:01:43.177Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/7e/46/cc36c679f09f27ded940281c38607716c86cf8ba4a518d524e349c8b4874/tomli-2.3.0-cp314-cp314t-win32.whl", hash = "sha256:a1f7f282fe248311650081faafa5f4732bdbfef5d45fe3f2e702fbc6f2d496e0", size = 107563, upload-time = "2025-10-08T22:01:44.233Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/84/ff/426ca8683cf7b753614480484f6437f568fd2fda2edbdf57a2d3d8b27a0b/tomli-2.3.0-cp314-cp314t-win_amd64.whl", hash = "sha256:70a251f8d4ba2d9ac2542eecf008b3c8a9fc5c3f9f02c56a9d7952612be2fdba", size = 119756, upload-time = "2025-10-08T22:01:45.234Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/77/b8/0135fadc89e73be292b473cb820b4f5a08197779206b33191e801feeae40/tomli-2.3.0-py3-none-any.whl", hash = "sha256:e95b1af3c5b07d9e643909b5abbec77cd9f1217e6d0bca72b0234736b9fb1f1b", size = 14408, upload-time = "2025-10-08T22:01:46.04Z" },
|
||||
]
|
||||
|
||||
|
|
@ -1676,7 +1977,7 @@ wheels = [
|
|||
[[package]]
|
||||
name = "tractor"
|
||||
version = "0.1.0a6.dev0"
|
||||
source = { git = "https://github.com/goodboy/tractor.git?branch=main#e77198bb64f0467a50e251ed140daee439752354" }
|
||||
source = { git = "https://github.com/goodboy/tractor.git?branch=piker_pin#36307c59175a1d04fecc77ef2c28f5c943b5f3d1" }
|
||||
dependencies = [
|
||||
{ name = "bidict" },
|
||||
{ name = "cffi" },
|
||||
|
|
@ -1822,6 +2123,18 @@ wheels = [
|
|||
{ url = "https://files.pythonhosted.org/packages/15/c0/0be24758891ef825f2065cd5db8741aaddabe3e248ee6acc5e8a80f04005/uvloop-0.22.1-cp313-cp313-manylinux2014_x86_64.manylinux_2_17_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:0530a5fbad9c9e4ee3f2b33b148c6a64d47bbad8000ea63704fa8260f4cf728e", size = 4366890, upload-time = "2025-10-16T22:16:40.547Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/d2/53/8369e5219a5855869bcee5f4d317f6da0e2c669aecf0ef7d371e3d084449/uvloop-0.22.1-cp313-cp313-musllinux_1_2_aarch64.whl", hash = "sha256:bc5ef13bbc10b5335792360623cc378d52d7e62c2de64660616478c32cd0598e", size = 4119472, upload-time = "2025-10-16T22:16:41.694Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/f8/ba/d69adbe699b768f6b29a5eec7b47dd610bd17a69de51b251126a801369ea/uvloop-0.22.1-cp313-cp313-musllinux_1_2_x86_64.whl", hash = "sha256:1f38ec5e3f18c8a10ded09742f7fb8de0108796eb673f30ce7762ce1b8550cad", size = 4239051, upload-time = "2025-10-16T22:16:43.224Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/90/cd/b62bdeaa429758aee8de8b00ac0dd26593a9de93d302bff3d21439e9791d/uvloop-0.22.1-cp314-cp314-macosx_10_13_universal2.whl", hash = "sha256:3879b88423ec7e97cd4eba2a443aa26ed4e59b45e6b76aabf13fe2f27023a142", size = 1362067, upload-time = "2025-10-16T22:16:44.503Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/0d/f8/a132124dfda0777e489ca86732e85e69afcd1ff7686647000050ba670689/uvloop-0.22.1-cp314-cp314-macosx_10_13_x86_64.whl", hash = "sha256:4baa86acedf1d62115c1dc6ad1e17134476688f08c6efd8a2ab076e815665c74", size = 752423, upload-time = "2025-10-16T22:16:45.968Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/a3/94/94af78c156f88da4b3a733773ad5ba0b164393e357cc4bd0ab2e2677a7d6/uvloop-0.22.1-cp314-cp314-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:297c27d8003520596236bdb2335e6b3f649480bd09e00d1e3a99144b691d2a35", size = 4272437, upload-time = "2025-10-16T22:16:47.451Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/b5/35/60249e9fd07b32c665192cec7af29e06c7cd96fa1d08b84f012a56a0b38e/uvloop-0.22.1-cp314-cp314-manylinux2014_x86_64.manylinux_2_17_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:c1955d5a1dd43198244d47664a5858082a3239766a839b2102a269aaff7a4e25", size = 4292101, upload-time = "2025-10-16T22:16:49.318Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/02/62/67d382dfcb25d0a98ce73c11ed1a6fba5037a1a1d533dcbb7cab033a2636/uvloop-0.22.1-cp314-cp314-musllinux_1_2_aarch64.whl", hash = "sha256:b31dc2fccbd42adc73bc4e7cdbae4fc5086cf378979e53ca5d0301838c5682c6", size = 4114158, upload-time = "2025-10-16T22:16:50.517Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/f0/7a/f1171b4a882a5d13c8b7576f348acfe6074d72eaf52cccef752f748d4a9f/uvloop-0.22.1-cp314-cp314-musllinux_1_2_x86_64.whl", hash = "sha256:93f617675b2d03af4e72a5333ef89450dfaa5321303ede6e67ba9c9d26878079", size = 4177360, upload-time = "2025-10-16T22:16:52.646Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/79/7b/b01414f31546caf0919da80ad57cbfe24c56b151d12af68cee1b04922ca8/uvloop-0.22.1-cp314-cp314t-macosx_10_13_universal2.whl", hash = "sha256:37554f70528f60cad66945b885eb01f1bb514f132d92b6eeed1c90fd54ed6289", size = 1454790, upload-time = "2025-10-16T22:16:54.355Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/d4/31/0bb232318dd838cad3fa8fb0c68c8b40e1145b32025581975e18b11fab40/uvloop-0.22.1-cp314-cp314t-macosx_10_13_x86_64.whl", hash = "sha256:b76324e2dc033a0b2f435f33eb88ff9913c156ef78e153fb210e03c13da746b3", size = 796783, upload-time = "2025-10-16T22:16:55.906Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/42/38/c9b09f3271a7a723a5de69f8e237ab8e7803183131bc57c890db0b6bb872/uvloop-0.22.1-cp314-cp314t-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:badb4d8e58ee08dad957002027830d5c3b06aea446a6a3744483c2b3b745345c", size = 4647548, upload-time = "2025-10-16T22:16:57.008Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/c1/37/945b4ca0ac27e3dc4952642d4c900edd030b3da6c9634875af6e13ae80e5/uvloop-0.22.1-cp314-cp314t-manylinux2014_x86_64.manylinux_2_17_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:b91328c72635f6f9e0282e4a57da7470c7350ab1c9f48546c0f2866205349d21", size = 4467065, upload-time = "2025-10-16T22:16:58.206Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/97/cc/48d232f33d60e2e2e0b42f4e73455b146b76ebe216487e862700457fbf3c/uvloop-0.22.1-cp314-cp314t-musllinux_1_2_aarch64.whl", hash = "sha256:daf620c2995d193449393d6c62131b3fbd40a63bf7b307a1527856ace637fe88", size = 4328384, upload-time = "2025-10-16T22:16:59.36Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/e4/16/c1fd27e9549f3c4baf1dc9c20c456cd2f822dbf8de9f463824b0c0357e06/uvloop-0.22.1-cp314-cp314t-musllinux_1_2_x86_64.whl", hash = "sha256:6cde23eeda1a25c75b2e07d39970f3374105d5eafbaab2a4482be82f272d5a5e", size = 4296730, upload-time = "2025-10-16T22:17:00.744Z" },
|
||||
]
|
||||
|
||||
[[package]]
|
||||
|
|
@ -1879,6 +2192,26 @@ wheels = [
|
|||
{ url = "https://files.pythonhosted.org/packages/e8/cf/7d848740203c7b4b27eb55dbfede11aca974a51c3d894f6cc4b865f42f58/wrapt-1.17.3-cp313-cp313-win32.whl", hash = "sha256:53e5e39ff71b3fc484df8a522c933ea2b7cdd0d5d15ae82e5b23fde87d44cbd8", size = 36711, upload-time = "2025-08-12T05:53:10.074Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/57/54/35a84d0a4d23ea675994104e667ceff49227ce473ba6a59ba2c84f250b74/wrapt-1.17.3-cp313-cp313-win_amd64.whl", hash = "sha256:1f0b2f40cf341ee8cc1a97d51ff50dddb9fcc73241b9143ec74b30fc4f44f6cb", size = 38885, upload-time = "2025-08-12T05:53:08.695Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/01/77/66e54407c59d7b02a3c4e0af3783168fff8e5d61def52cda8728439d86bc/wrapt-1.17.3-cp313-cp313-win_arm64.whl", hash = "sha256:7425ac3c54430f5fc5e7b6f41d41e704db073309acfc09305816bc6a0b26bb16", size = 36896, upload-time = "2025-08-12T05:52:55.34Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/02/a2/cd864b2a14f20d14f4c496fab97802001560f9f41554eef6df201cd7f76c/wrapt-1.17.3-cp314-cp314-macosx_10_13_universal2.whl", hash = "sha256:cf30f6e3c077c8e6a9a7809c94551203c8843e74ba0c960f4a98cd80d4665d39", size = 54132, upload-time = "2025-08-12T05:51:49.864Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/d5/46/d011725b0c89e853dc44cceb738a307cde5d240d023d6d40a82d1b4e1182/wrapt-1.17.3-cp314-cp314-macosx_10_13_x86_64.whl", hash = "sha256:e228514a06843cae89621384cfe3a80418f3c04aadf8a3b14e46a7be704e4235", size = 39091, upload-time = "2025-08-12T05:51:38.935Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/2e/9e/3ad852d77c35aae7ddebdbc3b6d35ec8013af7d7dddad0ad911f3d891dae/wrapt-1.17.3-cp314-cp314-macosx_11_0_arm64.whl", hash = "sha256:5ea5eb3c0c071862997d6f3e02af1d055f381b1d25b286b9d6644b79db77657c", size = 39172, upload-time = "2025-08-12T05:51:59.365Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/c3/f7/c983d2762bcce2326c317c26a6a1e7016f7eb039c27cdf5c4e30f4160f31/wrapt-1.17.3-cp314-cp314-manylinux1_x86_64.manylinux_2_28_x86_64.manylinux_2_5_x86_64.whl", hash = "sha256:281262213373b6d5e4bb4353bc36d1ba4084e6d6b5d242863721ef2bf2c2930b", size = 87163, upload-time = "2025-08-12T05:52:40.965Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/e4/0f/f673f75d489c7f22d17fe0193e84b41540d962f75fce579cf6873167c29b/wrapt-1.17.3-cp314-cp314-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:dc4a8d2b25efb6681ecacad42fca8859f88092d8732b170de6a5dddd80a1c8fa", size = 87963, upload-time = "2025-08-12T05:52:20.326Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/df/61/515ad6caca68995da2fac7a6af97faab8f78ebe3bf4f761e1b77efbc47b5/wrapt-1.17.3-cp314-cp314-musllinux_1_2_aarch64.whl", hash = "sha256:373342dd05b1d07d752cecbec0c41817231f29f3a89aa8b8843f7b95992ed0c7", size = 86945, upload-time = "2025-08-12T05:52:21.581Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/d3/bd/4e70162ce398462a467bc09e768bee112f1412e563620adc353de9055d33/wrapt-1.17.3-cp314-cp314-musllinux_1_2_x86_64.whl", hash = "sha256:d40770d7c0fd5cbed9d84b2c3f2e156431a12c9a37dc6284060fb4bec0b7ffd4", size = 86857, upload-time = "2025-08-12T05:52:43.043Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/2b/b8/da8560695e9284810b8d3df8a19396a6e40e7518059584a1a394a2b35e0a/wrapt-1.17.3-cp314-cp314-win32.whl", hash = "sha256:fbd3c8319de8e1dc79d346929cd71d523622da527cca14e0c1d257e31c2b8b10", size = 37178, upload-time = "2025-08-12T05:53:12.605Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/db/c8/b71eeb192c440d67a5a0449aaee2310a1a1e8eca41676046f99ed2487e9f/wrapt-1.17.3-cp314-cp314-win_amd64.whl", hash = "sha256:e1a4120ae5705f673727d3253de3ed0e016f7cd78dc463db1b31e2463e1f3cf6", size = 39310, upload-time = "2025-08-12T05:53:11.106Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/45/20/2cda20fd4865fa40f86f6c46ed37a2a8356a7a2fde0773269311f2af56c7/wrapt-1.17.3-cp314-cp314-win_arm64.whl", hash = "sha256:507553480670cab08a800b9463bdb881b2edeed77dc677b0a5915e6106e91a58", size = 37266, upload-time = "2025-08-12T05:52:56.531Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/77/ed/dd5cf21aec36c80443c6f900449260b80e2a65cf963668eaef3b9accce36/wrapt-1.17.3-cp314-cp314t-macosx_10_13_universal2.whl", hash = "sha256:ed7c635ae45cfbc1a7371f708727bf74690daedc49b4dba310590ca0bd28aa8a", size = 56544, upload-time = "2025-08-12T05:51:51.109Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/8d/96/450c651cc753877ad100c7949ab4d2e2ecc4d97157e00fa8f45df682456a/wrapt-1.17.3-cp314-cp314t-macosx_10_13_x86_64.whl", hash = "sha256:249f88ed15503f6492a71f01442abddd73856a0032ae860de6d75ca62eed8067", size = 40283, upload-time = "2025-08-12T05:51:39.912Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/d1/86/2fcad95994d9b572db57632acb6f900695a648c3e063f2cd344b3f5c5a37/wrapt-1.17.3-cp314-cp314t-macosx_11_0_arm64.whl", hash = "sha256:5a03a38adec8066d5a37bea22f2ba6bbf39fcdefbe2d91419ab864c3fb515454", size = 40366, upload-time = "2025-08-12T05:52:00.693Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/64/0e/f4472f2fdde2d4617975144311f8800ef73677a159be7fe61fa50997d6c0/wrapt-1.17.3-cp314-cp314t-manylinux1_x86_64.manylinux_2_28_x86_64.manylinux_2_5_x86_64.whl", hash = "sha256:5d4478d72eb61c36e5b446e375bbc49ed002430d17cdec3cecb36993398e1a9e", size = 108571, upload-time = "2025-08-12T05:52:44.521Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/cc/01/9b85a99996b0a97c8a17484684f206cbb6ba73c1ce6890ac668bcf3838fb/wrapt-1.17.3-cp314-cp314t-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:223db574bb38637e8230eb14b185565023ab624474df94d2af18f1cdb625216f", size = 113094, upload-time = "2025-08-12T05:52:22.618Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/25/02/78926c1efddcc7b3aa0bc3d6b33a822f7d898059f7cd9ace8c8318e559ef/wrapt-1.17.3-cp314-cp314t-musllinux_1_2_aarch64.whl", hash = "sha256:e405adefb53a435f01efa7ccdec012c016b5a1d3f35459990afc39b6be4d5056", size = 110659, upload-time = "2025-08-12T05:52:24.057Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/dc/ee/c414501ad518ac3e6fe184753632fe5e5ecacdcf0effc23f31c1e4f7bfcf/wrapt-1.17.3-cp314-cp314t-musllinux_1_2_x86_64.whl", hash = "sha256:88547535b787a6c9ce4086917b6e1d291aa8ed914fdd3a838b3539dc95c12804", size = 106946, upload-time = "2025-08-12T05:52:45.976Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/be/44/a1bd64b723d13bb151d6cc91b986146a1952385e0392a78567e12149c7b4/wrapt-1.17.3-cp314-cp314t-win32.whl", hash = "sha256:41b1d2bc74c2cac6f9074df52b2efbef2b30bdfe5f40cb78f8ca22963bc62977", size = 38717, upload-time = "2025-08-12T05:53:15.214Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/79/d9/7cfd5a312760ac4dd8bf0184a6ee9e43c33e47f3dadc303032ce012b8fa3/wrapt-1.17.3-cp314-cp314t-win_amd64.whl", hash = "sha256:73d496de46cd2cdbdbcce4ae4bcdb4afb6a11234a1df9c085249d55166b95116", size = 41334, upload-time = "2025-08-12T05:53:14.178Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/46/78/10ad9781128ed2f99dbc474f43283b13fea8ba58723e98844367531c18e9/wrapt-1.17.3-cp314-cp314t-win_arm64.whl", hash = "sha256:f38e60678850c42461d4202739f9bf1e3a737c7ad283638251e79cc49effb6b6", size = 38471, upload-time = "2025-08-12T05:52:57.784Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/1f/f6/a933bd70f98e9cf3e08167fc5cd7aaaca49147e48411c0bd5ae701bb2194/wrapt-1.17.3-py3-none-any.whl", hash = "sha256:7171ae35d2c33d326ac19dd8facb1e82e5fd04ef8c6c0e394d7af55a55051c22", size = 23591, upload-time = "2025-08-12T05:53:20.674Z" },
|
||||
]
|
||||
|
||||
|
|
@ -1974,6 +2307,38 @@ wheels = [
|
|||
{ url = "https://files.pythonhosted.org/packages/e0/e5/11f140a58bf4c6ad7aca69a892bff0ee638c31bea4206748fc0df4ebcb3a/yarl-1.22.0-cp313-cp313t-win32.whl", hash = "sha256:1834bb90991cc2999f10f97f5f01317f99b143284766d197e43cd5b45eb18d03", size = 86943, upload-time = "2025-10-06T14:11:10.284Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/31/74/8b74bae38ed7fe6793d0c15a0c8207bbb819cf287788459e5ed230996cdd/yarl-1.22.0-cp313-cp313t-win_amd64.whl", hash = "sha256:ff86011bd159a9d2dfc89c34cfd8aff12875980e3bd6a39ff097887520e60249", size = 93715, upload-time = "2025-10-06T14:11:11.739Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/69/66/991858aa4b5892d57aef7ee1ba6b4d01ec3b7eb3060795d34090a3ca3278/yarl-1.22.0-cp313-cp313t-win_arm64.whl", hash = "sha256:7861058d0582b847bc4e3a4a4c46828a410bca738673f35a29ba3ca5db0b473b", size = 83857, upload-time = "2025-10-06T14:11:13.586Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/46/b3/e20ef504049f1a1c54a814b4b9bed96d1ac0e0610c3b4da178f87209db05/yarl-1.22.0-cp314-cp314-macosx_10_13_universal2.whl", hash = "sha256:34b36c2c57124530884d89d50ed2c1478697ad7473efd59cfd479945c95650e4", size = 140520, upload-time = "2025-10-06T14:11:15.465Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/e4/04/3532d990fdbab02e5ede063676b5c4260e7f3abea2151099c2aa745acc4c/yarl-1.22.0-cp314-cp314-macosx_10_13_x86_64.whl", hash = "sha256:0dd9a702591ca2e543631c2a017e4a547e38a5c0f29eece37d9097e04a7ac683", size = 93504, upload-time = "2025-10-06T14:11:17.106Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/11/63/ff458113c5c2dac9a9719ac68ee7c947cb621432bcf28c9972b1c0e83938/yarl-1.22.0-cp314-cp314-macosx_11_0_arm64.whl", hash = "sha256:594fcab1032e2d2cc3321bb2e51271e7cd2b516c7d9aee780ece81b07ff8244b", size = 94282, upload-time = "2025-10-06T14:11:19.064Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/a7/bc/315a56aca762d44a6aaaf7ad253f04d996cb6b27bad34410f82d76ea8038/yarl-1.22.0-cp314-cp314-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:f3d7a87a78d46a2e3d5b72587ac14b4c16952dd0887dbb051451eceac774411e", size = 372080, upload-time = "2025-10-06T14:11:20.996Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/3f/3f/08e9b826ec2e099ea6e7c69a61272f4f6da62cb5b1b63590bb80ca2e4a40/yarl-1.22.0-cp314-cp314-manylinux2014_armv7l.manylinux_2_17_armv7l.manylinux_2_31_armv7l.whl", hash = "sha256:852863707010316c973162e703bddabec35e8757e67fcb8ad58829de1ebc8590", size = 338696, upload-time = "2025-10-06T14:11:22.847Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/e3/9f/90360108e3b32bd76789088e99538febfea24a102380ae73827f62073543/yarl-1.22.0-cp314-cp314-manylinux2014_ppc64le.manylinux_2_17_ppc64le.manylinux_2_28_ppc64le.whl", hash = "sha256:131a085a53bfe839a477c0845acf21efc77457ba2bcf5899618136d64f3303a2", size = 387121, upload-time = "2025-10-06T14:11:24.889Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/98/92/ab8d4657bd5b46a38094cfaea498f18bb70ce6b63508fd7e909bd1f93066/yarl-1.22.0-cp314-cp314-manylinux2014_s390x.manylinux_2_17_s390x.manylinux_2_28_s390x.whl", hash = "sha256:078a8aefd263f4d4f923a9677b942b445a2be970ca24548a8102689a3a8ab8da", size = 394080, upload-time = "2025-10-06T14:11:27.307Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/f5/e7/d8c5a7752fef68205296201f8ec2bf718f5c805a7a7e9880576c67600658/yarl-1.22.0-cp314-cp314-manylinux2014_x86_64.manylinux_2_17_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:bca03b91c323036913993ff5c738d0842fc9c60c4648e5c8d98331526df89784", size = 372661, upload-time = "2025-10-06T14:11:29.387Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/b6/2e/f4d26183c8db0bb82d491b072f3127fb8c381a6206a3a56332714b79b751/yarl-1.22.0-cp314-cp314-musllinux_1_2_aarch64.whl", hash = "sha256:68986a61557d37bb90d3051a45b91fa3d5c516d177dfc6dd6f2f436a07ff2b6b", size = 364645, upload-time = "2025-10-06T14:11:31.423Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/80/7c/428e5812e6b87cd00ee8e898328a62c95825bf37c7fa87f0b6bb2ad31304/yarl-1.22.0-cp314-cp314-musllinux_1_2_armv7l.whl", hash = "sha256:4792b262d585ff0dff6bcb787f8492e40698443ec982a3568c2096433660c694", size = 355361, upload-time = "2025-10-06T14:11:33.055Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/ec/2a/249405fd26776f8b13c067378ef4d7dd49c9098d1b6457cdd152a99e96a9/yarl-1.22.0-cp314-cp314-musllinux_1_2_ppc64le.whl", hash = "sha256:ebd4549b108d732dba1d4ace67614b9545b21ece30937a63a65dd34efa19732d", size = 381451, upload-time = "2025-10-06T14:11:35.136Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/67/a8/fb6b1adbe98cf1e2dd9fad71003d3a63a1bc22459c6e15f5714eb9323b93/yarl-1.22.0-cp314-cp314-musllinux_1_2_s390x.whl", hash = "sha256:f87ac53513d22240c7d59203f25cc3beac1e574c6cd681bbfd321987b69f95fd", size = 383814, upload-time = "2025-10-06T14:11:37.094Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/d9/f9/3aa2c0e480fb73e872ae2814c43bc1e734740bb0d54e8cb2a95925f98131/yarl-1.22.0-cp314-cp314-musllinux_1_2_x86_64.whl", hash = "sha256:22b029f2881599e2f1b06f8f1db2ee63bd309e2293ba2d566e008ba12778b8da", size = 370799, upload-time = "2025-10-06T14:11:38.83Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/50/3c/af9dba3b8b5eeb302f36f16f92791f3ea62e3f47763406abf6d5a4a3333b/yarl-1.22.0-cp314-cp314-win32.whl", hash = "sha256:6a635ea45ba4ea8238463b4f7d0e721bad669f80878b7bfd1f89266e2ae63da2", size = 82990, upload-time = "2025-10-06T14:11:40.624Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/ac/30/ac3a0c5bdc1d6efd1b41fa24d4897a4329b3b1e98de9449679dd327af4f0/yarl-1.22.0-cp314-cp314-win_amd64.whl", hash = "sha256:0d6e6885777af0f110b0e5d7e5dda8b704efed3894da26220b7f3d887b839a79", size = 88292, upload-time = "2025-10-06T14:11:42.578Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/df/0a/227ab4ff5b998a1b7410abc7b46c9b7a26b0ca9e86c34ba4b8d8bc7c63d5/yarl-1.22.0-cp314-cp314-win_arm64.whl", hash = "sha256:8218f4e98d3c10d683584cb40f0424f4b9fd6e95610232dd75e13743b070ee33", size = 82888, upload-time = "2025-10-06T14:11:44.863Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/06/5e/a15eb13db90abd87dfbefb9760c0f3f257ac42a5cac7e75dbc23bed97a9f/yarl-1.22.0-cp314-cp314t-macosx_10_13_universal2.whl", hash = "sha256:45c2842ff0e0d1b35a6bf1cd6c690939dacb617a70827f715232b2e0494d55d1", size = 146223, upload-time = "2025-10-06T14:11:46.796Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/18/82/9665c61910d4d84f41a5bf6837597c89e665fa88aa4941080704645932a9/yarl-1.22.0-cp314-cp314t-macosx_10_13_x86_64.whl", hash = "sha256:d947071e6ebcf2e2bee8fce76e10faca8f7a14808ca36a910263acaacef08eca", size = 95981, upload-time = "2025-10-06T14:11:48.845Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/5d/9a/2f65743589809af4d0a6d3aa749343c4b5f4c380cc24a8e94a3c6625a808/yarl-1.22.0-cp314-cp314t-macosx_11_0_arm64.whl", hash = "sha256:334b8721303e61b00019474cc103bdac3d7b1f65e91f0bfedeec2d56dfe74b53", size = 97303, upload-time = "2025-10-06T14:11:50.897Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/b0/ab/5b13d3e157505c43c3b43b5a776cbf7b24a02bc4cccc40314771197e3508/yarl-1.22.0-cp314-cp314t-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:1e7ce67c34138a058fd092f67d07a72b8e31ff0c9236e751957465a24b28910c", size = 361820, upload-time = "2025-10-06T14:11:52.549Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/fb/76/242a5ef4677615cf95330cfc1b4610e78184400699bdda0acb897ef5e49a/yarl-1.22.0-cp314-cp314t-manylinux2014_armv7l.manylinux_2_17_armv7l.manylinux_2_31_armv7l.whl", hash = "sha256:d77e1b2c6d04711478cb1c4ab90db07f1609ccf06a287d5607fcd90dc9863acf", size = 323203, upload-time = "2025-10-06T14:11:54.225Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/8c/96/475509110d3f0153b43d06164cf4195c64d16999e0c7e2d8a099adcd6907/yarl-1.22.0-cp314-cp314t-manylinux2014_ppc64le.manylinux_2_17_ppc64le.manylinux_2_28_ppc64le.whl", hash = "sha256:c4647674b6150d2cae088fc07de2738a84b8bcedebef29802cf0b0a82ab6face", size = 363173, upload-time = "2025-10-06T14:11:56.069Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/c9/66/59db471aecfbd559a1fd48aedd954435558cd98c7d0da8b03cc6c140a32c/yarl-1.22.0-cp314-cp314t-manylinux2014_s390x.manylinux_2_17_s390x.manylinux_2_28_s390x.whl", hash = "sha256:efb07073be061c8f79d03d04139a80ba33cbd390ca8f0297aae9cce6411e4c6b", size = 373562, upload-time = "2025-10-06T14:11:58.783Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/03/1f/c5d94abc91557384719da10ff166b916107c1b45e4d0423a88457071dd88/yarl-1.22.0-cp314-cp314t-manylinux2014_x86_64.manylinux_2_17_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:e51ac5435758ba97ad69617e13233da53908beccc6cfcd6c34bbed8dcbede486", size = 339828, upload-time = "2025-10-06T14:12:00.686Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/5f/97/aa6a143d3afba17b6465733681c70cf175af89f76ec8d9286e08437a7454/yarl-1.22.0-cp314-cp314t-musllinux_1_2_aarch64.whl", hash = "sha256:33e32a0dd0c8205efa8e83d04fc9f19313772b78522d1bdc7d9aed706bfd6138", size = 347551, upload-time = "2025-10-06T14:12:02.628Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/43/3c/45a2b6d80195959239a7b2a8810506d4eea5487dce61c2a3393e7fc3c52e/yarl-1.22.0-cp314-cp314t-musllinux_1_2_armv7l.whl", hash = "sha256:bf4a21e58b9cde0e401e683ebd00f6ed30a06d14e93f7c8fd059f8b6e8f87b6a", size = 334512, upload-time = "2025-10-06T14:12:04.871Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/86/a0/c2ab48d74599c7c84cb104ebd799c5813de252bea0f360ffc29d270c2caa/yarl-1.22.0-cp314-cp314t-musllinux_1_2_ppc64le.whl", hash = "sha256:e4b582bab49ac33c8deb97e058cd67c2c50dac0dd134874106d9c774fd272529", size = 352400, upload-time = "2025-10-06T14:12:06.624Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/32/75/f8919b2eafc929567d3d8411f72bdb1a2109c01caaab4ebfa5f8ffadc15b/yarl-1.22.0-cp314-cp314t-musllinux_1_2_s390x.whl", hash = "sha256:0b5bcc1a9c4839e7e30b7b30dd47fe5e7e44fb7054ec29b5bb8d526aa1041093", size = 357140, upload-time = "2025-10-06T14:12:08.362Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/cf/72/6a85bba382f22cf78add705d8c3731748397d986e197e53ecc7835e76de7/yarl-1.22.0-cp314-cp314t-musllinux_1_2_x86_64.whl", hash = "sha256:c0232bce2170103ec23c454e54a57008a9a72b5d1c3105dc2496750da8cfa47c", size = 341473, upload-time = "2025-10-06T14:12:10.994Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/35/18/55e6011f7c044dc80b98893060773cefcfdbf60dfefb8cb2f58b9bacbd83/yarl-1.22.0-cp314-cp314t-win32.whl", hash = "sha256:8009b3173bcd637be650922ac455946197d858b3630b6d8787aa9e5c4564533e", size = 89056, upload-time = "2025-10-06T14:12:13.317Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/f9/86/0f0dccb6e59a9e7f122c5afd43568b1d31b8ab7dda5f1b01fb5c7025c9a9/yarl-1.22.0-cp314-cp314t-win_amd64.whl", hash = "sha256:9fb17ea16e972c63d25d4a97f016d235c78dd2344820eb35bc034bc32012ee27", size = 96292, upload-time = "2025-10-06T14:12:15.398Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/48/b7/503c98092fb3b344a179579f55814b613c1fbb1c23b3ec14a7b008a66a6e/yarl-1.22.0-cp314-cp314t-win_arm64.whl", hash = "sha256:9f6d73c1436b934e3f01df1e1b21ff765cd1d28c77dfb9ace207f746d4610ee1", size = 85171, upload-time = "2025-10-06T14:12:16.935Z" },
|
||||
{ url = "https://files.pythonhosted.org/packages/73/ae/b48f95715333080afb75a4504487cbe142cae1268afc482d06692d605ae6/yarl-1.22.0-py3-none-any.whl", hash = "sha256:1380560bdba02b6b6c90de54133c81c9f2a453dee9912fe58c1dcced1edb7cff", size = 46814, upload-time = "2025-10-06T14:12:53.872Z" },
|
||||
]
|
||||
|
||||
|
|
|
|||
Loading…
Reference in New Issue